13) Ms. Dowd gave each student 6 liters of water to perform an experiment. Before starting the experiment, students had to verify the volume of water they received by taking three different measurements. Which of the following was the most precise measurement Ms. Dowd received? *
A) 5.9
B) 6.045
C) 6.0014
D) 6.12

Answers

Answer 1
The most precise measurement is C.
Answer 2
I'd say C, because the other answers are in the tenths, hundredths, or thousandths. C is in the ten-thousandths. Hope that helped

Related Questions

What is the product written in scientific notation? (5.91×10−3)⋅(8.7×1010)

Answers

(5.91×10^−3)⋅(8.7×10^10)
=(5.91 × 8.7)⋅(10^-3 × 10^10)
= 51.417 x 10^7
= 5.1417 x 10^8

hope it helps

Answer:

Product [tex]5.1417 *10^{8})[/tex].

Step-by-step explanation:

Given : [tex](5.91* 10^{-3} )(8.7*10^{10})[/tex].

To find : What is the product written in scientific notation.

Solution : We have given

[tex](5.91* 10^{-3} )(8.7*10^{10})[/tex].

Combine like terms

[tex]5.91 * 8.7 * 10^{-3}*10^{10})[/tex].

[tex]51.417 * 10^{-3}*10^{10})[/tex].

[tex]51.417 *10^{7})[/tex].

In scientific notation

[tex]5.1417 *10^{8})[/tex].

Therefore, Product [tex]5.1417 *10^{8})[/tex].

Which equation can be used to find the value of b if side a measures 8.7 cm? 8.7 + b = 54.6 17.4 + b = 54.6 26.1 + b = 54.6 34.8 + b = 5

Answers

The correct equation is 8.7 + b = 54.6
because it is given that measure of side a is 8.7cm, in all other equations the values of a is different.
from the first equation we can find the value of b, that is
b = 54.6 - 8.7 = 45.9
so, value of b is 45.9cm

Find the perimeter of the figure. 2 1/4 in, 4 1/12in, 3 2/3in

Answers

 it would = out to be  9 18/73

Shown here is a frequency distribution for the rise in tides at 30 selected locations in the U.S.Find the variance and standard deviation

Answers

It’s is going to be 15 since 30/2 equals 15
answer: 15 since 30/2 equals 15
hope this helps:D


plz give me brainiest

Hurry please!! Use any model you choose to solve the story problem. Zoey found that box of dog food was left in the pantry. She shared this food equally among her 4 dogs. What fraction of the full box of dog food did each dog get?

Answers

There is a box that is full which is 100% so if she is splitting the box equally she will be giving each dog 25% of the box or 1/4 of the box.

What is the equation of a line with a slope of 2 that goes through the point (4,12)?

Answers

Formula for point-slope: [tex]y - y1 = m(x-x1)[/tex]
Plug in the values: [tex]y -12 = 2(x - 4) [/tex]

And there you have your answer in point-slope form

With a tail wind, a plane traveled 840 miles in 3hrs. With the same wind as a head wind, the return trip took 30 minutes longer. Find the plane's airspeed(in still air) and the wind speed....
So lost smh

Answers

Tail Wind: 840 miles in 3 hours (i.e. Plane is going with the wind)
Head Wind: 840 miles in 3.5 hours (i.e. Plane is going against the wind)

Let the plane speed (without wind) i.e. airspeed = v
Let the wind speed = w

The two equations can be made
1. v + w = 840 miles in 3 hours 
   v + w = 280 miles per hour
2. v - w = 840 miles in 3.5 hours
    v - w = 240 miles per hour

This is a set of simultaneous equations. We can either solve with substitution or elimination. I choose elimination

v + w = 280
- (v - w = 240)
2w = 40
w = 20
So the wind speed, w, is 20 miles per hour

We can then substitute w = 20 into either equation to find v.
+ w = 280 miles per hour
v + 20 = 280
v = 260

So the planes airspeed, v, is 260 miles per hour


Final answer:

To find the plane's airspeed (in still air) and wind speed, we can use the concept of relative velocity. By setting up a system of equations using the distances and times for the outbound and return trips, we can solve for the values of the airspeed and wind speed. Solving these equations, we find that the plane's airspeed is 230 mph and the wind speed is 70 mph.

Explanation:

To find the plane's airspeed and wind speed, we can use the concept of relative velocity. Let's assume the plane's airspeed (in still air) is P mph and the wind speed is W mph.

On the outbound trip, with a tailwind, the plane's groundspeed (the speed relative to the ground) will be the sum of its airspeed and the wind speed: P + W mph. Since the distance traveled is 840 miles and the time taken is 3 hours, we have the equation: Distance = Speed * Time, where Speed is the groundspeed. Therefore, we can write the equation as: 840 = (P + W) * 3.

On the return trip, with the same wind as a headwind, the plane's groundspeed will be the difference between its airspeed and the wind speed: P - W mph. As it took 30 minutes longer, the time taken will be 3 hours + 0.5 hours = 3.5 hours. Using the same equation, we have: 840 = (P - W) * 3.5.

Now we have a system of equations, which we can solve to find the values of P and W. Solving these equations, we get:

Airspeed (in still air) = 230 mph

Wind speed = 70 mph

Learn more about finding airspeed and wind speed here:

https://brainly.com/question/19908126

#SPJ2

What is the slope?
What is the y intercept?
What is the x intercept?
What is the equation of the line in slope intercept form?
What is the equation of the line in standard form?

Answers

the slope is -2 or -2/1 
the x intercept is -8 
the y intercept is -4
the equation of the line in slope intercept form is y= -2x-4
the equation of the line in standard form is -2x-4y=0

Answer: Slope- (-1/2)

Y intercept- (-4)

the x intercept is -8  

the equation of the line in slope intercept form is y= -1/2x-4

the equation of the line in standard form is -1/2x-4y=0

I am doing Geometry and I don't know how to do this!

Answers

A) 3x + 5 + y + 20 = 180
B) x + 15 + 4y -15 = 180

A) 3x + y = 155
B) x + 4y = 180
multiplying B) by -3
B) -3x -12y = -540 than adding this to A)
A) 3x + y = 155 equals

-11y = -385

y = 35  then putting this into equation A)

A) 3x + 5 + 35 + 20 = 180
3x = 120
x = 40


What is the point slope form of the line with slope −1/4 that passes through the point (−2, 9) ?



y+9=−14(x−2)

y−2=−14(x+9)

y+2=−14(x−9)

y−9=−14(x+2)

Answers

y - 9 = -1/4 ( x + 2)

answer
y−9=−14(x+2) 
last one

Answer:

Step-by-step explanation:

Point slope form of the equation with point (a,b) and slope m is given by this equation

y-b=m(x-a)

Here we are given that the slope is -1/4 so m= -1/4

and the point is (-2,9) so a =-2 and b =9

Hence plugging the values in the equation we get

y-9 = -1/4 (x-(-2))

y -9 =-1/4 (x+2)

Find measure of angle d A. 122 degrees B. 61 degrees C. 238 degrees D. Not enough information

Answers

Final answer:

To find the measure of angle d, you can use the dot product formula and inverse cosine function.

Explanation:

To find the measure of angle d, we need to consider the given information about vectors A and B. The vector A is represented as (122 cm, <145°) and the vector B is represented as (110 cm, <270°). The angle between two vectors can be found using the dot product formula: cos(theta) = A · B / (|A| * |B|). So, we can calculate the dot product and magnitude of vectors A and B, and then use the inverse cosine function to find the angle between them. The measure of angle d is __ degrees.

Liam bought a picture frame that cost $12 plus 8% sales tax. He wrote the expression 1.08(12) to find his total cost.

Which expression is equivalent to the total cost? 
(12+0.08)12

12 + 0.08

1+0.08(12)

(1+0.08)12

Answers

The Answer Is D.(1+0.08)12







                       Hope It Helps Mark Me The Brainlyest PLEASE

The expression which is equivalent to the total cost comprising of the cost of frame and sales tax is (1 + 0.08)12

Given the Parameters :

Cost of frame = $12

Sales tax = 8% = 0.08

The total cost can be expressed thus :

Cost of frame = 100% of $12

Sales tax amount = 8% of $12

This can be expressed as :

(100% + 8%) × 12

(1 + 0.08) × 12

Therefore, the appropriate expression ls (1 + 0.08)12

Learn more : https://brainly.com/question/18109354

what did the candle say to the match

Answers

you light up my life

Which graph represents the solution set of the system of inequalities?

{3y≥x−9
3x+y>−3
WHICH ONE ?

Answers

the first graph

the solid line passes through (0,-3) and (0,9)

 dotted line passes through (0,-3) and (0,-1)

 see attached sketch

What is the square root of 99 simplified?

Answers

Step-by-step explanation: To simplify the square root of 99, first create a factor tree that has 2 branches.

99 factors as 11 × 9 and 9 factors as 3 × 3.

Since we have a pair of 3's in our factor tree, a 3 can come out of the radical. Since we have a 11 that doesn't match up, it stays inside the radical and this gives us the answer of [tex]\sqrt[3]{11}[/tex].

I have also attached my work in the image provided.

The square root of 99, when simplified as much as possible, is approximately 9.94987437.

We have,

The square root of a number is a value that, when multiplied by itself, gives the original number.

In the case of the square root of 99, there is no whole number that can be multiplied by itself to result in 99.

Therefore, the square root of 99 is an irrational number.

To find an approximate value for the square root of 99, we can use a calculator or mathematical methods.

The square root of 99 is approximately 9.94987437.

This means that when we multiply 9.94987437 by itself, we get a value close to 99.

Since 9.94987437 cannot be simplified further as a whole number or a simplified radical, it is the most accurate representation of the square root of 99.

Thus,

The square root of 99, when simplified as much as possible, is approximately 9.94987437.

Learn more about expressions here:

https://brainly.com/question/3118662

#SPJ6

what is the estimate of 39% of 120

Answers

It  is 47 because you had to turn 39 into a fraction of 100. So you would do .39x1120. Which would give you the fraction of 46.8. That number rounded is 47.


A new car has an msrp of $20,150, and it comes with a sport package priced at $1500, a stereo package priced at $500, and a destination charge of $700. what is the sticker price of this car?

Answers

22850 is the answer
Thanks (:

A 120 lb person would weight about 20 lb on the earth's moon .A 150 lb. person would weight 28lb. on lo, a moon of jupiter.

Answers

find the common ratio numerator

What is the area of a rectangle with vertices at ​ (−6, 3) ​, ​ (−3, 6) ​ , (1, 2) , and (−2, −1) ? Enter your answer in the box. Do not round any side lengths.

Answers

You would have to find the magnitude of the sides to find out the area. 

A=(-6, 3) 
B= (-3,6) 
C= (1, 2) 
D= (-2, -1) 

A-B = √(x₁-x₂)²+(y₁-y₂)² 
=√(-6+3)²+(3-6)²
=√9+9
=√18 
=4.24

C-D=√(x₁-x₂)²+(y₁-y₂)² 
=√(1+2)²+(2+1)²
=√9+9 
=4.24 

Area= lxw 
A=√18x√18
a=18 

Hope I helped :) 

The area of the rectangle is 18 square units if the vertices at ​ (−6, 3) ​, ​ (−3, 6) ​ , (1, 2) , and (−2, −1).

What is the area of the rectangle?

It is defined as the area occupied by the rectangle in two-dimensional planner geometry.

The area of a rectangle can be calculated using the following formula:

Rectangle area = length x width

It is defined as the two-dimensional geometry in which the angle between the adjacent sides is 90 degrees. It is a type of quadrilateral.

It is given that:

A rectangle with vertices at a​ (−6, 3) ​, ​b (−3, 6) ​ , c(1, 2) , and d(−2, −1)"

As we know,

The distance formula can be given as:

[tex]\rm d=\sqrt{(x_2-x_1)^2+(y_2-y_1)^2}[/tex]

ab = √(x₁-x₂)²+(y₁-y₂)²

=√(-6+3)²+(3-6)²

= √18

cd =√(1+2)²+(2+1)²

= √18

Area= lxw

A=√18x√18

a=18

Thus, the area of the rectangle is 18 square units if the vertices at ​ (−6, 3) ​, (−3, 6) ​ , (1, 2) , and (−2, −1).

Learn more about the rectangle here:

https://brainly.com/question/15019502

#SPJ5

If x is an even number, the function f(x) = 2x − 1 gives an odd number. Identify the set of odd numbers corresponding to this set of even numbers: {0, 2, 4, 6, 8}.

Answers

x = {0, 2, 4, 6, 8}.

=> f(x) = 2x - 1


x                  f(x) = 2x - 1

0                   2*0 - 1 = - 1

2                   2*2 - 1 = 3

4                   2*4 - 1 = 7

6                   2*6 - 1 = 11

8                   2*8 - 1 = 15

Answer: {-1, 3, 7, 11, 15}

Write a compound inequality that represents the situation.

all real numbers at least –6 and at most 3

Answers

Answer:

[tex]\[-6 \leqslant x \leqslant 3\][/tex]

Step-by-step explanation:

The requirement is to represent a compound inequality with all real numbers at least –6 and at most 3.

This can be broken into two parts:

a) All real numbers at least -6

[tex]\[x\geqslant -6\][/tex]

b) All real numbers at most 3

[tex]\[x \leqslant 3\][/tex]

Combining the two inequalities to generate the compound inequality:

[tex]\[-6 \leqslant x \leqslant 3\][/tex]

arlene grossman earns $235 per week her federal income tax is $36.00 her FICA tax is 6.2% arlene is also subject to a 3% state income tax and a 1% city tax whats her net pay

Answers

Arlene Grossman will net $175.03 per week. She loses 10.2% in taxes, which is $23.97 and she loses an additional $36 in income tax. $235 minus $23.97 minus $36 equals $175.03.

What is the exterior angle of triangle ABC

These are the points:
A=3, B=10, C=6

Answers

Based off of  what I can see in the  photo (its too blurry to know for sure) and what I think you're asking:

The angle of a triangle always adds up to 360degrees, so base it on that and the acute and obtuse  angles  and get the degrees from there, the angle would be those degrees you find or <10, 5, 4 (what I assume  is a 5)

Customers have two options when renting video games from a rental store. Plan A requires a $5 monthly fee and $1 per video rental. Plan B requires an $8 monthly fee and $0.75 per video rental. How many video rentals would be required each month for the plans to cost the same amount?

Answers

for the first rental it's 35 times the second one is 24 times

What is the area of a parallelogram whose vertices are A(−1, 12) , B(13, 12) , C(2, −5) , and D(−12, −5) ?

Answers

238 square units. The area of a parallelogram is the base multiplied by the height. You can use any of its four sides as the base, so pick the one that is easiest to deal with. Examining the parallelogram, you'll notice that line segments AB and CD are both parallel to the x axis which makes it extremely easy to calculate the height which is 12 - (-5) = 17. The length of AB is 13 - (-1) = 14. So the area of the parallelogram is 14 * 17 = 238

If you ask three strangers about their birthdays, what is the probability:

Answers

Part A:

The probability that the birthday of three strangers were on Wednesday is given by

[tex]\left( \frac{1}{7} \right)^3= \bold{\frac{1}{343}} [/tex]



Part B:

The probability that the birthday of three strangers were on different days of the week is given by

[tex]\left( \frac{1}{7} \right)\left( \frac{1}{6} \right)\left( \frac{1}{5} \right)= \bold{\frac{1}{210}} [/tex]



Part C:

The probability that none of the three strangers were born on Saturday is given by

[tex]\left( \frac{6}{7} \right)^3= \bold{\frac{216}{343}}[/tex]

A diver descends to a location of −5014 meters relative to the surface of the water. He then descends another 1012 meters.

What is the diver’s final location relative to the surface of the water?

Enter your answer as a simplified mixed number in the box.

Answers

Its -60 3/4


Hope this helps!~

Answer: Using operations with fractions, the diver's final location is:

- 60 3/4 meters relative to the surface of the water (60 3/4 meters below the surface of the water).


Solution:

Initial location: -50 1/4 meters

He descends another 10 1/2 meters: -10 1/2 meters

Final location = Initial location - 10 1/2 meters

Final location = - 50 1/4 meters - 10 1/2 meters

Final location = - (50+10) (1/4+1/2) meters

Final location = - 60 [(1)(1)+2(1)]/4 meters

Final location = - 60 (1+2)/4 meters

Final location = - 60 3/4 meters

If f(x) = 5x, what is f–1(x)?
A. f–1(x) = –5x
B. f-1(x)=-1/5x
C. f-1(x)=1/5x
D. f–1(x) = 5x

Answers

To get the inverse of a function interchange
the x's with the y'x and solve for y, as follows:
y=5x-7


Interchange to get:
x=5y-7
Solve for y to get:
y=(1/5)x+(7/5)

so I think it might be c


Answer:

The answer is C.

Step-by-step explanation:

Step 1: Replace f(x) with y.

     f(x)=5x >>>>> y=5x

Step 2: Switch x and y.

     y=5x >>>>> x=5y

Step 3: Solve for y

     x=5y >>>> y= x/5

Then you have to do the inverse of dividing by 5. Which is multipilying by 1/5. This leaves you with,

      y= 1/5x

Step 4: Write in standard inverse notation (Replace y with f^-1(x))

      f^-1(x)=1/5x  

Note: These steps work with ANY problem where you have to find the inverse function. I hope this helps :)

     

You are designing a rectangular sign for your school’s football team. The sign will be 6 yd wide and 9 ft high. How many square yards of material do you need?

Answers

First, you would convert length and width to yards. 
You would be left with 6yds and 3yds. 

Then, to find the area of the sign, you would multiply them. 
6 x 3 = 

Your answer would be, 18 square yards

I hope this helps!
You are looking of the area of the material.
Since it is a rectangle, you have to do  length x width
The length is 6 and the width is 3
so 6x3=18.


You would need 18 square yards of material.

What is the answer to p/3 -2=1

Answers

(p/3) - 2 = 1

p/3 = 1 + 2

p/3 = 3

3(p/3) = 3(3)

p = 9
Other Questions
Which of the following tests uses calipers to assess body composition? A. skinfold test B. sit-and-reach C. arm hang D. curl-up How might a decrease in biodiversity affect medical discoveries and treatments? When brought to the surface of the moon will a mass have more or less weight than it did on the surface of the earth, or will it be the same in weight? Determine the growth defined by the equation y=3(3.4)x Which of the barbiturates would you expect to be the more effective sedative? barbital hexethal? san francisco has recycled facility that accepts unused paint.Volunteers blend and mix the paint and give it away in 5-gallon buckets.Write and solve an equation to find the number of buckets of paint given away from the 30,000 gallons that are donated. How many moles of c9h8o4 are in a 0.300 g tablet of aspirin? Preferred stock of leaping dolphin inc. pays 8% on the $100 par value. what is the value of the stock if the appropriate discount rate is 6%? Which of these excerpts from "The First Seven Years" by Bernard Malamud best exemplifies the desire to improve one's socioeconomic status? Bill has a mortgage loan on his personal residence. he decides to pay 18 months of interest in advance on october 1, 2016. the total advanced interest payment is $36,000. how much of the advance interest payment can he deduct in 2016?a. $36,000b. $6,000c. $24,000d. mortgage interest is not deductible.e. if a taxpayer makes an advance payment, he may not deduct any interest. What are some questions that a 1700's colonist might ask someone who is moving to the United States today? Which is a characteristics of an autobiography? What do you think tom and daisy were saying in the kitchen? a population that increases 5 percent every year is said to be experiencing What is the equation of the quadratic function with roots -3 and 1 and a vertex a (-1, -8)? Unlike the kings and queens of England, monarchs in France Explain how a story about a dog might be an ideal way to explore the theme of how laws work. Include specific examples of dogs' traits and behaviors. Your answer should be at least one hundred and fifty words.What does it by saying the theme of laws? I need to understand that is all. Round 977.259856871 to 3 decimal places Amongst the Mayan peoples, painters were a part of the ____________.a.working classc.ruling classb.slave classd.lower classPlease select the best answer from the choices providedABCD Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Steam Workshop Downloader