brainiest to best answer!

The deepest part of the Mariana trench (the deepest trench in the world’s oceans) is at an elevation of -11.033 kilometers. The elevation of the deepest part of the Atacama trench is -8.065 kilometers. What is the net change in elevation from the Atacama trench to the Mariana trench?
19.098 kilometers
2.968 kilometers
-2.968 kilometers
-19.098 kilometers

Answers

Answer 1
if you subtract -11.033--8.065 that will give you -2.968, so -2968 would be your answer. I hope this helps, good luck. 
Answer 2

The net change in elevation from the Atacama trench to the Mariana trench is 2.968km.

What is the net change in elevation from the Atacama trench to the Mariana trench?

We know that the deepest part of Mariana trench is at -11.033 km, while the deepest part of the Atacama trench is -8.065km.

To find the net change, we need to find the difference between the largest value and the smallest value.

So we get:

D = -8.065km - (-11.033 km) = 2.968km

Then the correct option is the second one.

If you want to learn more about differences:

https://brainly.com/question/7243416

#SPJ2


Related Questions

Please help!
What is the equation of this graphed line?



Enter your answer in slope-intercept form in the box.

Answers

y=2x+2 because the slope of the line is 12/6 which simplifies to 2, and the y-intercept of the line is also 2.

Answer:

[tex]y=2x+2[/tex]

Step-by-step explanation:

step 1

Find the slope

The formula to calculate the slope between two points is equal to

[tex]m=\frac{y2-y1}{x2-x1}[/tex]

we have

[tex]A(-4,-6)\ B(2,6)[/tex]

Substitute the values

[tex]m=\frac{6+6}{2+4}[/tex]

[tex]m=\frac{12}{6}=2[/tex]

step 2

we know that

The equation of the line into slope intercept form is equal to

[tex]y=mx+b[/tex]

we have

[tex]m=2[/tex]

[tex]B(2,6)[/tex]

substitute and solve for b

[tex]y=mx+b[/tex] ------> [tex]6=(2*2)+b[/tex]

[tex]6=4+b[/tex]

[tex]b=2[/tex]

The equation of the line is equal to

[tex]y=2x+2[/tex]


Which compound inequality has no solution? x ≤ –2 and 2x ≥ 6 x ≤ –1 and 5x ≤ 5 x ≤ –1 and 3x ≥ –3 x ≤ –2 and 4x ≤ –8

Answers

x <= -2  and 2x >= 6    is the smae as
 x <= -2 and x >= 3
Now x can not satisfy both inequalities so the first one has no solution

hope you have an amazing wonderful spectacular day/night 

Answer:x <= -2 and 2x >= 6 is the smae as

x <= -2 and x >= 3

Step-by-step explanation:

Solve by substitution-5x+4y=22 x - 3y = 0A) No solution.
b. (6, 2)
c. Infinitely many solutions.
d. (-6, 2)
e. (-6, -2)

Answers

We want to use substitution to solve
-5x + 4y = 22           (1)
 x - 3y = 0                (2)

From (2), obtain
x = 3y                      (3)
Substitute (3) into (1).
-5(3y) + 4y = 22
-15y + 4y = 22
-11y = 22
y = -2
From (3), obtain
x = 3y = 3*(-2) = -6

Answer: e. (-6, -2)

HELP ME PLEASE ! I NEED TO DO THIS QUICKLY !!!!! Translate each sentence into an equation!!!!!!!!!!!! 7 berries are 5 less than twice them number of berries Mickey had for lunch! AND also another one Negative 4 times the difference of a number and 7 is 12

Answers

7 + 5 = 2M (any variable)

-4 * (n-7) = 12
first one: (7 - 5) ÷ 2 = 1
the other im not sure about.

2 sides of an isoceles triangle are 2 and 12. find the length of the third side

Answers

To the length of the third side, we need to know the angle between the given sides.

You did not provide this information.

You then need to use the law of cosines.

The third side of the isosceles triangle with the given sides of 2 and 12 is 12 units.

To find the length of the third side of an isosceles triangle where two sides are given as 2 and 12, we must consider two cases.

In an isosceles triangle, two sides are equal in length and the two angles opposite these sides are also equal. This means either the two given sides are the equal sides, which is not possible since they are different lengths, or one of the given lengths will be the base and the equal sides are yet to be determined.

Case 1: If the side of length 2 is the base, the length of the equal longer sides will both be 12.

Case 2: If the side of length 12 is the base, then the length of the two equal sides must both be 2.

However, we must recognize that the first case is incorrect because it does not form a triangle (a triangle cannot have two sides of length 12 and one side of length 2, as the two longer sides would be parallel and never meet to form a triangle).

Therefore, the correct answer is given by Case 2: the third side of the triangle, which is the base, is 12 units long, and the two equal sides are 2 units long each.

The sum of two numbers is 68 . the smaller number is 12 less than the larger number. what are the numbers?

Answers

The larger number is 56 because if you do 68-12=56

Final answer:

To solve the problem, we defined two variables for the larger (x) and smaller (y) numbers. Using the provided information, we set up two equations and solved them to find the numbers: x (the larger number) is 40, and y (the smaller number) is 28.

Explanation:

Step-by-Step Solution to Find the Two Numbers

Let's denote the larger number as x and the smaller number as y. We are given two pieces of information:

The sum of the two numbers is 68.

The smaller number is 12 less than the larger number.

These two statements can be turned into two equations:

x + y = 68 (Equation 1)

y = x - 12 (Equation 2)

Now, we can substitute Equation 2 into Equation 1 to find x:

x + (x - 12) = 68

2x - 12 = 68

Add 12 to both sides:

2x = 80

Divide both sides by 2:

x = 40

Now that we know the larger number, x, we can find y using Equation 2:

y = 40 - 12

y = 28

So, the two numbers are 40 and 28

can you please explain to me which functions are odd?

f(x)=-1/2x^4+5

f(x)=-8x^3+5x

f(x)=-4/x^3-x+1

f(x)=x^5/x^4-1

f(x)=-sqrt2x

f(x)=3sqrtx -x^3

thank you!

Answers

A function is odd if f(-x)=-f(x).
So given a function, to check whether it is odd or not, we calculate f(-x). If it is equal to -f(x), then the function is odd; if not, it is not odd.


[tex]\displaystyle{f(x)= -\frac{1}{2}x^4+5 [/tex]

[tex]\displaystyle{f(-x)= -\frac{1}{2}(-x)^4+5= -\frac{1}{2}x^4+5\neq-f(x)[/tex]

thus the function is not odd


[tex]\displaystyle{f(x)=-8x^3+5x[/tex]

[tex]\displaystyle{f(-x)=-8(-x)^3+5(-x)=8x^3-5x=-(-8x^3+5x)=-f(x)[/tex]

thus the function is odd



[tex]\displaystyle{f(x)=- \frac{4}{x^3}-x+1 [/tex]

[tex]\displaystyle{f(-x)=- \frac{4}{(-x)^3}-(-x)+1= \frac{4}{x^3}+x+1\neq-f(x)[/tex]

thus the function is not odd



[tex]\displaystyle{f(x)= \frac{x^5}{x^4-1} [/tex]

[tex]\displaystyle{f(-x)= \frac{(-x)^5}{(-x)^4-1}= \frac{-x^5}{x^4-1}=- \frac{x^5}{x^4-1}=-f(x) [/tex]

thus the function is odd



[tex]\displaystyle{f(x)=-\sqrt{2x}[/tex]

[tex]\displaystyle{f(-x)=-\sqrt{2(-x)}= -\sqrt{-2x} [/tex]

In this particular case f(x) and f(-x) can both exist only for x=0 (because one of them is certainly negative). Thus the function is not odd


[tex]\displaystyle{f(x)=3 \sqrt{x} -x^3[/tex]

similarly to the previous case,  the Domain of f is [0, infinity) and f(-x) cannot be calculated except for x=0. So the function is not odd.

Kanisha has x green apples and y red apples.

Which statement explains why x + y and y + x will each find the total number of apples that Kanisha has?

In addition, the order of the variables matters in the expression.

The expressions are not equivalent because there are two variables.

The first expression has a greater value than the second expression.

In addition, the order of the variables does not matter in the expression.

Answers

the last one 
its the one because it makes the most sense

Answer:

the answer is in addition the order of the variables does not matter in the expression

Step-by-step explanation:

i took the test

Q.17

Select the correct numerical form of this number written in scientific notation.

1.2 × 10^4

0.00012
120,000
12,000
1,200

Answers

The answer is:  [D]:  "1,200" .
________________________________________
We take the "1.2" and move the decimal FOUR (4) places to the right.

So, when we move the decimal place ONE place to the right, we have "12". 
When we move it TWO places to the right, we have "120".
When we move it THREE places to the right, we have 1200".
When we move it FOUR places to the right, we have "1200".
_________________________________________________
Note:  When we move the "decimal place" to the right or left, and that "decimal place is "non-existent", we add a "zero to the [right or left].

"1200" can be written as:  "1,200" .
_________________________________________________
The answer is:  [D]:  " 1,200 " .
_________________________________________________

Answer:

its 12,000

Step-by-step explanation:

On wensday on a track myles run 7 laps for every 3 laps that elijah run on friday elijahrun 16 more laps than on wensday making the number of laps he run and myles run the same .how many laps did eligah run on wensday

Answers

the answer would be 31

Maya spent her allowance on playing an arcade game a few times and riding the Ferris wheel more than once.Write about what additional information you would need to create a two-variable equation for the scenario. What kind of problem could you solve with your equation?

Answers

from the information we have now we could write this equation: 

ax+by=z
where
a - number of times she played arcade
x- prize of arcade
b- number of times of Ferris wheel
y- prize of Ferris 
z- the whole allowance

so in order to make it a two-variable equasion we need to know the value of three more variables. 

If let's say we know a, b, and z we could solve the problem of how much cheaper/more expensive the arcade is than ferris wheel (we could find something like x=2y, for example ( we don't know yet, we need more variables) so we'd know that one game is more expensive than the other.

To write a two-variable equation, I would first need to know how much Maya’s allowance was. Then, I would need the cost of playing the arcade game and of riding the Ferris wheel. I could let the equation be cost of playing the arcade games plus cost of riding the Ferris wheel equals the total allowance. My variables would represent the number of times Maya played the arcade game and the number of times she rode the Ferris wheel. With this equation I could solve for how many times she rode the Ferris wheel given the number of times she played the arcade game u welcome

what is 3 divided by 7.71?

Answers

3 ÷ 7.71 = 0.38910....
You could round to 0.4 or 0.39 , etc.
2.57 here is the answer

How to find the angle measure of an isosceles triangle if you only know the side lengths?

Answers

Hello Tbeck227, how to find the angle measure of an isosceles triangle if you only know the side lengths is, for all the angles, though it would be unreasonable to use it for all three, since once we know two the third is easy. Lubin suggested using the Cosine Law for the first calculation and the Sine Law for the second. This is faster than Cosine Law done twice. The suggestion is to use the Cosine Law to determine the angle opposite a largest side.

Please help! Use the quadratic function to predict y if x equals 6. Y=2x^2-2x-2

A) y= -58
B) y= 58
C) y=-60
D) y= 60

Answers

b) y=58 you follow the instructions

Answer:

The correct option is B.

Step-by-step explanation:

The given quadratic function is

[tex]y=2x^2-2x-2[/tex]

We have to find the value of the function y at x=6.

Substitute x=6 in the given function.

[tex]y=2(6)^2-2(6)-2[/tex]

[tex]y=2(36)-12-2[/tex]

[tex]y=72-14[/tex]

[tex]y=58[/tex]

The value of the function is 58 at x=6 is 58.

Therefore the correct option is B.

The functions f(x) = –(x + 4)2 + 2 and g(x) = (x − 2)2 − 2 have been rewritten using the completing-the-square method. Is the vertex for each function a minimum or a maximum? Explain your reasoning for each function.

Answers

The vertex for the first equation is a maximum because it undergoes a reflection across the x-axis, so the parabola opens in the opposite direction.

The vertex for the second equation is a minimum because the parabola opens upward.

Final answer:

The completing-the-square method allows rewriting quadratic functions to determine the vertex. The coefficient of the squared term determines if the vertex is a minimum or maximum.

Explanation:

The completing-the-square method allows us to rewrite quadratic functions in a form that reveals the vertex of the parabola. To determine if the vertex is a minimum or a maximum, we need to consider the coefficient of the squared term. In the function f(x) = –(x + 4)² + 2, the coefficient is negative, indicating that the parabola opens downwards, and the vertex is a maximum. In the function g(x) = (x − 2)² − 2, the coefficient is positive, indicating that the parabola opens upwards, and the vertex is a minimum.

the ordered pair (2 16) is a solution to which equation(s)

A. y=(2x)^2

B. y=2x^2

C. y=2x+2

D. y=(x+2)^2

Answers

A. y = (2x)^2


Replace x and y with your point
16= (2•2)^2
16= (4)^2
16= 16

What is the minimum value for P = x - 2y over the feasibility region defined by the constraints shown below?

A. 8
B. -2
C. -16
D. -14

Answers

the answer is -14

Hope this helps : )


Determine if the statement is always, sometimes or never true. A natural number is a whole number.

Answers

true, soo true, because every number that is natural is whole  
Natural numbers are the positive integer set. Those are the numbers from 1 to infinity. (also called counting numbers) That does does NOT include fractions, negatives, or decimals. Zero is the ONLY whole number that is NOT a natural number. So yes, a natural number is always a whole number. :) 

Given: AB = 12
AC = 6
Prove: C is the midpoint of AB.


Proof:
We are given that AB = 12 and AC = 6. Applying the segment addition property, we get AC + CB = AB. Applying the substitution property, we get 6 + CB = 12. The subtraction property can be used to find CB = 6. The symmetric property shows that 6 = AC. Since CB = 6 and 6 = AC, AC = CB by the property. So, AC ≅ CB by the definition of congruent segments. Finally, C is the midpoint of AB because it divides AB into two congruent segments.

Answers

Answer:

Pretty sure its the Transitive Property

Step-by-step explanation:

It's a dropdown on Edge so there's no A B C or D

Final answer:

To prove that point C is the midpoint of segment AB, we apply the segment addition property and the definition of congruent segments.

Explanation:

To prove that point C is the midpoint of segment AB, we can use the segment addition property. We are given that AB = 12 and AC = 6. By applying the segment addition property, we get AC + CB = AB. Substituting the given values, we have 6 + CB = 12. Solving for CB using the subtraction property, we find that CB = 6.

Now, by using the symmetric property, we can see that 6 = AC. Since CB = 6 and 6 = AC, we can conclude that AC is congruent to CB by the definition of congruent segments. This implies that C is the midpoint of AB, as it divides AB into two congruent segments.

A customer wants you to enlarge a photo to 2 3/4 its current height. The photo’s current height is 3 1/4 inches. What should its enlarged height be, in inches?

Answers

3 1/4 * 2 3/4  =  13/4 *  11/4 =143 /16  = 8 15/16 inches
2 3/4* 3 1/4 = 13/4*11/4= 143/16 WHICH IS EQUALS TO 8 15/16

Find the slope of the line.

Answers

Your slope would be -1/4x. If you look at the y-intercept on your graph, which is -2, you would start to count up one box and over 4 boxes to the left. We call this rise/run. So knowing what the slope is now, your entire equation would be            y= -1/4x - 2. (Also, if the line is going up towards the left it is a negative slope, if it's to the right it is positive.) I hope this helps love! :) 

We can use the points (-4, -1) and (0, -2) to solve.

Formula: y2-y1/x2-x1

= -2-(-1)/0-(-4)

= -1/4

Best of Luck!

Two cards are drawn at random without replacement from a standard 52-card deck. what is the probability we see at least one club and at least one ace?

Answers

What do you mean "one club"? Like any card that has the symbol of clubs?

The probability we see at least one club and at least one ace would be 0.019225

What is the probability?

Probability refers to a possibility that deals with the occurrence of random events.

The probability of all the events occurring need to be 1.

The formula of probability is defined as the ratio of a number of favorable outcomes to the total number of outcomes.

The Total number of cards in a deck = 52

Number of aces in a standard deck = 4

Number of clubs in a standard deck = 13

The Probability = required outcome / Total possible outcomes

P(ace) = 4 / 52 = 0.0769

P(club) = 13 / 52 = 1/4 = 0.25

Therefore, the probability we see at least one club and at least one ace

0.0769 x 0.25

= 0.019225

Learn more about probability here;

https://brainly.com/question/11234923

#SPJ2

Which is the directrix of a parabola with equation x^2=y

Answers

[tex]\bf \textit{parabola vertex form with focus point distance}\\\\ \begin{array}{llll} (y-{{ k}})^2=4{{ p}}(x-{{ h}}) \\\\ \boxed{(x-{{ h}})^2=4{{ p}}(y-{{ k}})} \\ \end{array} \qquad \begin{array}{llll} vertex\ ({{ h}},{{ k}})\\\\ {{ p}}=\textit{distance from vertex to }\\ \qquad \textit{ focus or directrix} \end{array}\\\\ -------------------------------\\\\ x^2=y=(x-0)^2=1(y-0)\implies (x-0)^2=4\stackrel{p}{\left( \frac{1}{4} \right)}(y-0)[/tex]

now, notice, the vertex is at h = 0, k = 0, or 0,0, at the origin, the squared variable is the "x", and thus is a vertical parabola.  The leading term's coefficient is positive, so is going upwards, and the "p" distance is that much.

So the directrix is from the vertex, down "p" distance, check the picture below.

"if calvin buys 4 pounds of starfruit and 3 pounds of oranges, how much is his total utility"

Answers

He would have bought 7 pound
This is because you would add 4 and 3 together

Hope this helps!

The Calvin has a total of 252 utility coming from Oranges and Starfruit.

What is the unitary method?

The unitary method is a method for solving a problem by the first value of a single unit and then finding the value by multiplying the single value.

Given that oranges cost $2 per pound and starfruit costs $5 per pound.

The utility coming from Oranges and Starfruit, therefore he needs to spend his $26 on buying the oranges and starfruit

Since all in all he also spend $23 on it, and still has remaining $3 in his pocket,

Thus his total utility is 252.

Hence, The Calvin has a total of 252 utility coming from Oranges and Starfruit.

Learn more about the unitary method, please visit the link given below;

https://brainly.com/question/23423168

#SPJ5

The complete question is

The oranges cost $2 per pound and starfruit costs $5 per pound. calvin has $26 to spend. if calvin buys 4 pounds of starfruit and 3 pounds of oranges, how much is his total utility?

ray OJ bisects angle IOK, if angle IOJ= 2x-5 and measure of angle JOK=x+11, then find measure of angle IOJ

Answers

Final answer:

Given ray OJ bisects angle IOK, we can set an equation for angles IOJ and JOK, solve for x and substitute x into the given measure of angle IOJ: 2*(16)-5 equals 27 degrees.

Explanation:

Since ray OJ bisects angle IOK, it means that angle IOJ and angle JOK are equal in measurement. Given in the problem, angle IOJ= 2x-5 and angle JOK= x+11. Because they are equal, we can set up the equation 2x-5 = x+11.

To solve for x, we subtract x from both sides of the equation, resulting in x-5 =11. And then, if we add 5 to both sides of the equation, the end result is x = 16.

Substituting x into the given measurement for angle IOJ, which is 2x-5, we would get the measure of angle IOJ as 2*(16)-5 = 27 degrees.

Learn more about Angle Bisector here:

https://brainly.com/question/37543581

#SPJ12

Using exponents what is the simplified form of the expression 12x^5/6x^2

Answers

First, we can simplify the 12/6 to 2/1 by factoring our 6. Next, remember that when we divide the same base with different exponents, we subtract the exponents. Thus, x^5/x^2 = x^(5-2) = x^3. Thus, the answer is 2x^3.

The required simplified form of the expression 12x⁵/6x² is 2x³.

What are exponential expressions?

Exponential expressions, as the name indicates, involve exponents. We already know that the exponent of a number (base) specifies how many times the number (base) has been multiplied. To answer the exponential expressions, we may need to apply the relationship between exponents and logarithms.

The exponential expression is given in the question as:

12x⁵/6x²

To simplify the expression 12x⁵/6x², we can start by dividing 12 by 6 to get:

12x⁵/6x² = (12/6)x⁵/x² = 2x⁵/x²

Then, we can use the quotient of powers rule, which states that when we divide two powers with the same base, we can subtract the exponents to get:

2x⁵/x² = 2x⁵⁻² = 2x³

Therefore, the expression is 2x³ equivalent to the given expression 12x⁵/6x².

Learn more about exponential function here:

brainly.com/question/11487261

#SPJ5

A chess board has 64 squares. if you put one grain of rice on the first square, two grains on the second square, four grains on the third, eight grains on the fourth, and so on. how many grains are on the last square. no calculators.

Answers

On the first square, you have 2^0 rice grains on it.
On the second, you have 2^1 rice grains on it.
On the third, you have 2^2 rice grains on it.
Repeat this pattern.
On the 64th (last square), you have 2^63 rice grains on it.
I'm not sure how you would calculate 2^63 without a calculator...
Have an awesome day! :)
Consider this geometric sequence.

1, 2, 4, 8, ...
By considering the ratio between the first and the second, and the second and the third, we can begin to see that it has an equal ratio of 2.

Using the geometric sequence formula:
[tex]T_{n} = a_1 \cdot r^{n}[/tex]
[tex]T_{n} = 1 \cdot 2^{n}[/tex]
[tex]\text{Last square occurs when n = 64: } T_{64} = 2^{64}[/tex]

This means there will be 2^64 grains on the last square.

Solve for x: 3 over 4 x + 5 over 8 = 4x. . x = __________________ Write your answer as a fraction in simplest form. Use the \"/\" symbol for the fraction bar

Answers

[tex] { \frac{3}{4x} } + { \frac{5}{8} } = 4x \\ 3 + { \frac{5(4x)}{8} } = 4x(4x)
[/tex]
[tex] (8)3 + 20x = (8)16x^2 [/tex]
[tex] 24 + 20x = 128x^2 \\ 128x^2 - 20x - 24 = 0 \\ 4(32x^2 - 5x - 6) = 0 \\ 32x^2 - 5x - 6 = 0 [/tex]

[tex] Solve\ using\ the\ formular\ \boxed{ x= { \frac{-b \pm \sqrt{b^2 - 4ac}}{2a} } } \\ x= { \frac{-(-5) \pm \sqrt{(-5)^2 - 4(32)(-6)}}{2(32)} } \\ x= { \frac{5 \pm \sqrt{793}}{64} } \\ x = 0.51812\ or\ x=-0.36187 [/tex]

[tex] x [/tex] cannot be written as a fraction.

PLEASE HELP!!

What is the length of the midsegment of this trapezoid?

Enter your answer in the box.

Answers

Answer:

7 units

Step-by-step explanation:

The length of the midsegment of this trapezoid will be 7 units.

What is mean by Rectangle?

A rectangle is a two dimension figure with 4 sides, 4 corners and 4 right angles. The opposite sides of the rectangle are equal and parallel to each other.

Given that;

The coordinates of the vertices of the trapezoid are,

A = (-2, 4)

B = (4, 3)

C = (4 , -5)

D = (- 2, - 2)

Now,

Since, We know that;

The length of the midsegment of a trapezoid is always equal to the half of the sum of the parallel sides.

Here, Line AD and BC are parallel lines.

And, The length of AD = √(- 2 - (-2))² + (- 2 - 4)²

                                   = √-6²

                                  = 6

And, The length of BC = √(4 - 4)² + (- 5 - 3)²

                                   = √-8²

                                   = 8

Thus, The length of the midsegment of this trapezoid = (6 + 8)/2

                                                                                    = 14/2

                                                                                    = 7 units.

Therefore, The length of the midsegment of this trapezoid will be 7 units.

Learn more about the rectangle visit:

https://brainly.com/question/25292087

#SPJ6

HELP PLEASE
Solve the system by substitution
-4.5x - 2y = -12.5
3.25x - y = -0.75

Answers

from the second equation ,we can know that y=3.25x+0.75
plug it into the first equation
-4.5x-2(3.25x+0.75)=-12.5
-4.5x-6.5x-1.5=-12.5
-11x=-11
x=1
plug it back into the second equation, y=3.25x+0.75=4
the answer would be (1,4)
You can also go on mathwey it would solve it fast
Other Questions
Unlike the kings and queens of England, monarchs in France Explain how a story about a dog might be an ideal way to explore the theme of how laws work. Include specific examples of dogs' traits and behaviors. Your answer should be at least one hundred and fifty words.What does it by saying the theme of laws? I need to understand that is all. Round 977.259856871 to 3 decimal places Amongst the Mayan peoples, painters were a part of the ____________.a.working classc.ruling classb.slave classd.lower classPlease select the best answer from the choices providedABCD Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Inner-city schools in american continue to have tremendous problems. approximately _____ of the high schools in the united states produce _____ of the country's dropouts. For 15 points The region or area you live today looks nothing like it did when first created. For years man has built new structures or modified the world around us in some way. Choose something around you or somewhere in the world and describe what man has done to modify the area and the change it has brought. (PLEASE HELP!!!)(47 POINTS!!!!!)in one to three paragraphs, compare and contrast the Amy Tan story, Two Kinds and Collier's "Marigolds". Discuss two differences and two similarities. Support your analysis with text evidence and MLA formatting for in text citations. Make one text to self connection about either story. Discuss the major functions of the lymphatic system City of pasadena in california in known for? A train leaves little rock, arkansas, and travels north at 70 kilometers per hour. another train leaves at the same time and travels south at 55 kilometers per hour. how long will it take before they are 375 kilometers apart? Identify the participle in the sentence.The idling engine sound fine to me now._______Is there a business future in manufactured houses, Dad?A: FutureB: IsC: housesD: DadPaying for the flute, Tammy smiled happily and skipped all the way home.A: none of the above B: smiled happilyC: all the way home D: Paying for the flute What specific nutrition guidelines has your school district put in place?Name at least three. Select the correct statement to describe when a sample of liquid water vaporizes into water vapor.A. Temperature decreases and molecular motion increases while shape becomes less defined.B. Temperature decreases and molecular motion decreases while shape becomes more defined.C. Temperature increases and molecular motion decreases while shape becomes more defined.D. Temperature increases and molecular motion increases while shape becomes less defined. Write an equation to represent: four-fifths of z added to six equals eightA) 4/5 z + 6 = 8 B) 4/5 + 6z = 8 C) 4/5 (6)(z) = 8 D) 4/5 (6) + z = 8 A fruit juice container holds 16 servings. If the servings size in 6 ounces, how many ounces does the container hold in all? How does the graph of g(x)=x+7 differ from the graph of f(x)=x?The graph of g(x)=x+7 is the graph of f(x)=x shifted right 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted up 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted left 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted down 7 units. who were the first hominids to walk upright? A. homo erectus B. homo habilis c. Australopithecus d. neanderthals In a cross-country race with a 35 participants, the mean finish time was 21 minutes . Which statement must be true ? Find the total capacity of twenty five containers of cranberry juice if each bottle holds 5 quarts 1 pint 6 oz A) 142 pints 6 oz B) 140 pints 6 oz C) 142 pints 9 oz D) 142 pints 1 pint 6 oz E) None Steam Workshop Downloader