Evaluate the probability of finding an electron in a small region of a hydrogen 1s orbital

Answers

Answer 1
Use the equation for the wavefunction for a 1 s H atom (page 25 of the 5th edition of the textbook, page 21 of the 4th edition of textbook) and square it: Ψ2r,Θ,Φ( ) =1πa03e−2ra0to get the probability density.

Then take the ratio of the probability density at r=0.55 ao and at r=0.Ψ 20.55ao,Θ, Φ( )Ψ20,Θ,Φ( )=1πao3e−2 0.55ao( )ao1πao3e−2 0( )ao=e−2 0.55ao( )aoe−2 0( )ao==e−2(0.55)1=0.3329 = 0.33

The ratio of the probability density at r = 0.55 a0 to that at r = 0 is 0.33.

See attachment for better understanding.
Evaluate The Probability Of Finding An Electron In A Small Region Of A Hydrogen 1s Orbital

Related Questions

How many cl atoms are in 0.0728 g of pcl3?

Answers

The answer is there are 9.57 x 10²⁰ number of Cl atoms are in 0.0728 g of PCl₃.

Number of moles = mass / molar mass

Mass of PCl₃ = 0.0728 g and molar mass of PCl₃ = 137.33g/mol

Number of moles of PCl₃ = 0.0728 / 137.33 = 5.3 x 10⁻⁴

In one mole there are Avogadro’s number of molecules that is 6.02 x 10²³

So, in 5.3 x 10⁻⁴ moles of PCl₃, there are =5.3 x 10⁻⁴ x 6.02 x 10²³ = 3.19 x 10²⁰

Now there is 3 atoms of Cl in PCl₃ so in 3.19 x 10²⁰ molecules of PCl₃, number of Cl atoms = 3.19 x 10²⁰ x 3 = 9.57 x 10²⁰ atoms

Final answer:

To find the number of chlorine atoms in a given mass of PCl3, you calculate the number of moles of PCl3, using its molar mass. Then, multiply the number of moles by three (since there are three chlorine atoms in each molecule of PCl3), and then use Avogadro's number to convert the number of moles to atoms. The resulting number is 9.56 x 10^20 Cl atoms.

Explanation:

First, determine the molar mass of PCl3. Phosphorus (P) has an atomic mass of about 31g/mol, and Chlorine (Cl) has an atomic mass of about 35.5 g/mol. Since there are three chlorine atoms in PCl3, the molar mass of PCl3 becomes 31 + 3 * 35.5 = 137 g/mol.

Then, calculate the number of moles in 0.0728 g of PCl3. This is done by dividing the mass of the sample by the molar mass of PCl3: 0.0728 g / 137 g/mol = 0.000531 moles of PCl3.

Since each mole of PCl3 contains three moles of Cl, we multiply the number of moles of the compound by three to get the number of moles of Cl: 0.000531 moles * 3 =  0.00159 moles of Cl.

Then, using Avogadro's number (6.02 x 10^23), we can convert the number of moles to the number of atoms. 0.00159 moles * 6.02 x 10^23 atoms/mol = 9.56 x 10^20 atoms.

So, there are around 9.56 x 10^20 atoms of chlorine (Cl) in a 0.0728 g sample of PCl3.

Learn more about calculating atoms here:

https://brainly.com/question/35917637

#SPJ6

Describe the preparation of 40 liters of 0.02 m phosphate buffer, ph 6.9

Answers

By following these steps, you can prepare 40 liters of 0.02 M phosphate buffer with a pH of 6.9 using solid Na3PO4 and 1M HCl:

Step 1: Calculate the amount of Na3PO4 required

Step 2: Prepare the Na3PO4 solution

Step 3: Calculate the amount of HCl required

Step 4: Adjust the pH

To prepare 40 liters of 0.02 M phosphate buffer solution with a pH of 6.9, starting from solid Na3PO4 and 1M HCl, we can follow these steps:

Step 1: Calculate the amount of Na3PO4 required

The phosphate buffer will be prepared using the following equilibrium reaction:

Na3PO4 + 3HCl → 3NaCl + H3PO4

We need to calculate the amount of Na3PO4 required to make a 0.02 M solution in 40 liters.

First, calculate the moles of phosphate ions required:

Moles of phosphate ions = Molarity × Volume

Moles of phosphate ions = 0.02 mol/L × 40 L = 0.8 moles

Since Na3PO4 dissociates into three moles of phosphate ions, the moles of Na3PO4 needed will be one-third of the moles of phosphate ions:

Moles of Na3PO4 = 0.8 moles / 3 = 0.2667 moles

Step 2: Prepare the Na3PO4 solution

Weigh out the calculated amount of Na3PO4 and dissolve it in water to make up the 40 liters of solution.

Step 3: Calculate the amount of HCl required

The pH of the buffer is adjusted using HCl. To achieve a pH of 6.9, we need to calculate the amount of 1M HCl needed.

Step 4: Adjust the pH

Add the calculated amount of 1M HCl to the Na3PO4 solution while monitoring the pH using a pH meter or pH paper. The pH should be adjusted to 6.9 by adding small amounts of HCl at a time and then checking the pH until the desired pH is reached.

By following these steps, you can prepare 40 liters of 0.02 M phosphate buffer with a pH of 6.9 using solid Na3PO4 and 1M HCl.

The probable question may be:

Describe the preparation of 40 liters of 0.02 M phosphate buffer, pH 6.9, starting from solid Na3PO4 and 1M HCl.

What is the de Broglie wavelength (in meters) of a 45-g golf ball traveling at 72 m/s?

Answers

Data:

mass = 45 g = 0.045 kg

velocity = 72 m/s

Formula:

wavelength = Planck constant / (mass * velocity)

Solution:

Planck constant is 6.63 * 10^ -34 J*s

=> wavelength = 6.63 * 10 ^ -34 J*s / (0.045 kg * 72 m/s)

wavelength = 2.05 * 10^ - 34 m

Answer: 2.05 * 10 ^  -34 m

Assuming ideal gas behavior, what is the pressure in atm exerted by 1.57 mol Cl2(g) confined to a volume of 1.50 L at 273K?

Answers

The formula for ideal gas law is:

P V = n R T

where

P is pressure = ?

V is volume = 1.50 L

n is number of moles = 1.57 mol

R is gas constant = 0.08205746 L atm / mol K

T is temperature = 273 K

 

P = 1.57 mol * 0.08205746 L atm / mol K * 273 K / 1.50 L

P = 23.45 atm

The bond enthalpy in no is 632 kj/mol and that of each no bond in no2 is 469 kj/mol. explain the difference in bond enthalpies between the two molecules. 1. the bond type does not explain the difference. 2. no has a singl

Answers

Bond enthalpy or bond energy is the amount of energy that is needed in order to break or take out one mole of the substance. The bond energy is varied between the compounds NO and NO₂ because of the different configuration of the atoms in order to form the compound.

That being said, it is also noted that the bonds will have different lengths and the molecules will have different shape and are also composed of different numbers of atoms. 
Final answer:

The bond enthalpy is the energy required to break a chemical bond. The bond enthalpy of NO2 is lower than NO because NO2 has a double bond which is stronger and thus requires more energy to break compared to the single bond in NO.

Explanation:

The bond enthalpy, or energy, is a measure of the strength of a chemical bond. It is identified by the energy required, in joules or kilojoules per mole (kJ/mol), to break a chemical bond. In this case, we are comparing the bond enthalpy of NO, a molecule with a single bond, and that of NO2, a molecule with double bonds between the atoms.

The bond enthalpy in NO is 632 kJ/mol and that of each NO bond in NO2 is 469 kJ/mol. The difference in bond enthalpies is due to the difference in the number of electron pairs in the bond. The strength of a bond between two atoms increases as the number of electron pairs in the bond increases. Simply put, a single covalent bond (as in NO) is typically weaker than a double bond (as present in NO2), and therefore, requires less energy to break. Hence the bond enthalpy is lower for NO2 as it is harder to break its double bond.

It's important to remember that the exact values of bond enthalpy also depend on the specific atoms in the bond and their electronegativity, which is why there are some discrepancies seen in bond enthalpies in different molecules.

Learn more about Bond Enthalpy here:

https://brainly.com/question/29633366

#SPJ11

which has prokaryotic cells

Answers

An organism is said to have a prokaryotic cell if its cell is a very simple one that does not contain any true nucleus and which do not have membrane bound organelles. Prokaryotes are usually unicellular organisms, examples are bacteria. One key feature of prokaryotic cell is a piece of circular, double stranded DNA which is usually found in the cell.

Prokaryotic cells are found in bacteria and archaea.

What is Prokaryotic cells

Prokaryotic cells are a type of cell that lacks a nucleus and other membrane-bound organelles. They are found in bacteria and archaea, which are two domains of microorganisms.

Prokaryotic cells are structurally simpler compared to eukaryotic cells, which are found in plants, animals, fungi, and protists.

Learn more about prokaryotic cells at

https://brainly.com/question/25774476

#SPJ6

The instrument that is commonly used to measure the intensity of radioactivity is called a _____.

Answers

Geiger counter, hope this helps food luck
Geiger Counter is the answer

which of the following identifies the number and location of protons in a lithium atom

Answers

Final answer:

A lithium atom always contains three protons located in its nucleus, defining its atomic number as 3, regardless of the isotope.

Explanation:

The number and location of protons in a lithium atom is universally three within its nucleus. This constant feature defines the element lithium (Li) and gives it an atomic number of 3. Lithium atoms can, however, have different numbers of neutrons, resulting in isotopes with different mass numbers such as Lithium-6 (three neutrons) and Lithium-7 (four neutrons). Despite these differences, the number of protons remains constant at three, which is a characteristic trait of the lithium element.

The Lewis structure for ethylene, C2H4, is shown. How many valence electrons do the two carbon atoms in the molecule share with each other in the double bond?

Answers

So,

The Lewis structure for ethylene is two carbons double-bonded to each other, and two hydrogens single-bonded to each carbon atom.

Each bond symbolizes two shared valence electrons.  Since the carbon atoms are double-bonded, they share four (4) valence electrons (the other electrons are in lower energy levels and do not appear because they typically don't react when higher energy-level electrons are on top of them).


the correct answer is 2


What is the chemical formula for the ionic compound zinc phosphate ? express your answer as a chemical formula?

Answers

Zn3(PO4)2 or O8P2Zn3

When chromium chloride crcl2 is dissolved in water the temperature of the water decreases answers?

Answers

When the temperature of water decreases by dissolving crcl2, the reaction is endothermic reaction.
The two types of reaction that are opposite to each other are endothermic and exothermic reaction. Endo means inside and Exo means outside and thermic refers to heat.
So, in Exothermic reaction, heat is released and the temperature increases and in endothermic reaction, heat is absorbed and and the temperature decreases. So, this reaction or process is endothermic because by adding CrCl2, the temperature decreases.

Why is having a scientific model of the atom important?
1.the model allows us to predict how atoms will behave in certain situations.
2.the atom is the smallest known particle in the univierse.
3.models are used to prove which scientist is correct in a debate.
4.it is impossible to predict how atoms behave in nature.

Answers

2. I believe it would be two but then again this is an incomplete answer so it is not two. It's probably going to be 3. Or 1. Because I took this test before a while back and I'm almost a 100% sure it's 1 or 3. Hope this helps slightly!

Answer:

The answer is D

Explanation:

What is the difference between a white and red reaction integumentary system?

Answers

In the integumentary system, the white reaction is caused by vasoconstriction, which is the narrowing of blood vessels. The red reaction is caused by vasodilation, which is the widening of blood vessels.

The white reaction and the red reaction are two types of skin reactions that can occur in response to an injury or irritation.

The white reaction is usually a temporary reaction that goes away on its own within a few minutes or hours. The red reaction can last longer, depending on the severity of the injury or irritation. The triple reaction is usually caused by a more severe injury or irritation than the white or red reactions. It can also be a sign of an allergic reaction.

Learn more about integumentary system, here:

https://brainly.com/question/21442141

#SPJ12

Final answer:

The integumentary system undergoes changes as a person ages, resulting in a thinner epidermis and slower wound healing. Both the white and red reactions are affected by these changes.

Explanation:

The integumentary system undergoes changes as a person ages, leading to a thinner epidermis and slower wound healing. These changes are reflected in both the white and red reactions of the integumentary system. The white reaction refers to decreased mitosis in the stratum basale, resulting in a thinner epidermis. The red reaction relates to the reduced ability of the dermis to regenerate, leading to slower wound healing.

Learn more about Difference between white and red reaction in the integumentary system here:

https://brainly.com/question/5812878

#SPJ6

The amount of heat needed to raise one gram of a substance 1° Celsius is called

Answers

Final answer:

The amount of heat needed to raise the temperature of one gram of a substance by 1° Celsius is known as the specific heat. It is measured in joules per gram per degree Celsius and is distinct from the nutritional calorie concept.

Explanation:

The amount of heat needed to raise one gram of a substance by 1° Celsius is called the specific heat of the substance. Specific heat is a property that describes how much energy is needed to increase the temperature of 1 gram of the substance by 1°C. The common unit for specific heat is joules per gram per degree Celsius (J/g°C). When discussing the energy needed to change the temperature of water, we often refer to the calorie, which is the amount of heat required to raise 1 gram of water by 1°C, whereas in nutrition, the term "calorie" usually refers to a kilocalorie (1000 calories) and is the heat needed to raise 1 kilogram of water by 1°C.

Learn more about specific heat here:

https://brainly.com/question/28852989

#SPJ12

Household object that includes metal and why

Answers

Metal objects can be found in a variety of locations throughout the house. A common location would be the garage as it is a common storage location for tools and machinery which are made of metals like steel and aluminum.

Explain why the anion solutions were prepared using sodium salts rather than calcium salts?

Answers

Anion solutions are those which allows dissociations of negatively charged atoms in the water or any liquid. In essence, the sodium salts are used for the preparation due to the higher activity of sodium salts. 

This is because, sodium salts will dissociate into Na⁺ and the counterpart ion while calcium dissociates into Ca²⁺. As it is seen in the charges of the atoms, sodium is more reactive because it is easier for atoms to lose 1 electron than two. 
Final answer:

Anion solutions are typically prepared using sodium salts rather than calcium salts due to their better solubility and formation of inert anions. Sodium salts readily dissociate into ions in water and do not form insoluble compounds with certain anions unlike calcium salts. This ensures a clear anion solution without precipitates.

Explanation:

Anion solutions are typically prepared using sodium salts rather than calcium salts due to differences in solubility and reactivity. Sodium salts readily dissociate into ions when dissolved in water, producing the required anions. For instance, when the ionic compound of sodium chloride (NaCl) is dissolved in water, it dissociates into sodium (Na+) and chloride ions (Cl-). This creates a 1:1 stoichiometry of cations and anions as given by the formula, NaCl.

On the other hand, calcium salts like Ca(NO3)2 can also dissociate into ions in water, producing Ca²+ cations and NO3¯ anions. However, calcium salts often tend to form insoluble compounds with certain anions. This leads to precipitates in the solution, which could affect the outcome of certain experiments or reactions. Therefore, sodium salts, which are generally more soluble, are preferred for preparing anion solutions.

Apart from solubility factor, another reasoning for choosing sodium salts over calcium is that the former leads to inert anions that can better preserve the acidity or alkalinity of the solution. For example, isolating the chloride anion from a sodium salt results in an inert anion that does not engage in further chemical reactions, thereby maintaining the solution's basicity.

Learn more about Anion Solutions here:

https://brainly.com/question/31419759

#SPJ2

why is it important to know a tornados velocity and not just its speed

Answers

So you know how fast it’s going and how fast it will get there.

Do strong acid and strong base have similar effects on protein solubility and denaturation

Answers

Both strong acid and strong base will alter the solubility and the nature of a protein. This is because, adding a strong acid or base to a protein will drastically change the pH of the protein and this will leads to formation of precipitation and denaturation of the protein.

Write the complete electron configuration for the common monatomic ion formed by the element calcium, ca.

Answers

Calcium is the 20th element in the periodic table. If the substance is neutral this means that the number of elements is equal to the number of protons. The assigning of the numbers in the electron configuration can be made using the Aufbau Principle.

The principle states that the electrons occupy the orbitals with lowest energy level. Having said this, the electron configuration therefore of the calcium is,

     Ca(20) = 1s²2s²2p⁶3s²3p⁶4s²
Final answer:

The complete electron configuration for the common monatomic ion formed by calcium (Ca) is [Ar]4s².

Explanation:

Calcium (Ca) is located in the second column of the s block. We would expect its electron configuration to end with 4s². The complete electron configuration for calcium is [Ar]4s². When calcium forms a monatomic ion, it loses its two valence electrons, resulting in a 2+ charge and an electron configuration of 1s²2s²2p⁶3s²3p⁶. The calcium ion (Ca²+) is therefore isoelectronic with the noble gas argon (Ar).

Describe how the size of sediment particles affects their movement during deflation.

Answers

The larger the piece the longer it will take to break down. This is because it has more mass that needs to be broken down.

The movement of sediment particles during deflation varies with size; small particles like clay and silt are suspended and travel far, sand-sized particles undergo saltation staying near the ground, and the largest particles move by traction.

The size of sediment particles greatly affects their movement during deflation, a process where wind removes loose particles from the surface, leading to erosion. Small particles such as clay and silt can be lifted and suspended in the air, potentially traveling great distances and at considerable heights. In contrast, larger particles like sand are prone to saltation, which means they are blown in short hops and remain close to the ground. Finally, the largest particles, which may include gravel and pebbles, are moved by traction, meaning they are rolled or pushed along the surface without being lifted into the air.

Sediment particles' movement is influenced by their fall velocity, which depends on factors like particle size, shape, specific density, water temperature, and sediment concentration. For instance, a silt particle with a diameter of 10 micrometers has a fall velocity of about 0.1 mm/s. Moreover, particle erosion and transport are influenced by the dynamics of the flow, whether it be water or wind. Sediment is moved and sorted based on these conditions, affecting the distribution and composition of the soil or sediment layer.

What are the major species in solution when solid ammonium bromate is dissolved in water?

Answers

The major species in solution when solid ammonium bromate is dissolved in water is shown below

The major species when ammonium bromate is dissolved in water are ammonium ions, bromate ions, hydronium ions, and ammonia.

When solid ammonium bromate is dissolved in water, the major species in solution are ammonium ions (NH₄⁺) and bromate ions (BrO₃⁻). In an aqueous solution, the ammonium ion is a weak acid, which can donate a proton to water, forming hydronium ions (H₃O⁺) and ammonia (NH₃), hence making the solution slightly acidic. The bromate ion is a stable species that does not further react in water. Therefore, the major species in solution are NH₄⁺, BrO₃⁻, H₃O⁺, and some unreacted NH₃.

A neutral atom of potassium (K) has an average mass of 39 amu and 19 electrons. How many neutrons does it have?

10
19
20
58

Answers

Answer is 20. Since potassium has 19 electrons you know that it then has 19 protons because there is no charge change. So to get the number of neutrons, you take the average mass of 39 and subtract the number of protons and that leaves you with 20 neutrons.

A neutral atom of potassium (K) has an average mass of 39 amu and 19 electrons. It has 20 neutrons. Thus, the correct option for this question is C.

What are Electrons?

Electrons may be characterized as the type of subatomic particles which are consistently revolving within the orbitals around the nucleus. These subatomic particles are negatively charged in nature. J.J. Thomson is known as the discoverer of these subatomic particles.

It is clearly mentioned in the question that an atom is neutral which means the number of positively charged particles (protons) is equal to the number of negatively charged particles (electrons). So, the number of protons is also 19.

Now, the number of neutrons is determined by the following formula:

The number of neutrons = Atomic mass - Number of protons.

                                  = 39 - 19 = 20.

Therefore, a neutral atom of potassium (K) has an average mass of 39 amu and 19 electrons. It has 20 neutrons. Thus, the correct option for this question is C.

To learn more about Neutrons, refer to the link:

https://brainly.com/question/26952570

#SPJ5

Which of the following represents a chemical change?

Bending a wire
Freezing of water
Fireworks exploding
Melting of a wax candle

Answers

There are several differences between a physical and chemical change in matter or substances. A physical change in a substance doesn't change what the substance is. In a chemical change where there is a chemical reaction, a new substance is formed and energy is either given off or absorbed. In this question, the right answer would be Fireworks Exploding, because fireworks are completely changing. bending a wire doesnt change the wire, freezing water doesnt change the properties of water, and melting doesnt change the properties either.

Explosion of fireworks represents a chemical change because explosion causes chemical reaction due to which chemical properties change.

How do chemical changes occur?

Chemical changes occur when chemical reactions take place.During chemical reactions, bonds between atoms break due to which properties change.

Bending of wire only causes change in physical property that is shape and there is no change in chemical properties or constituents of wire.Freezing of water changes the state of water to solid but does not change it's properties.

Melting of wax candle  only changes the state of candle from solid to molten form it does not alter its chemical properties.During explosion of fireworks there is chemical change taking place along with which large amount  of energy is released.

Learn more about chemical change ,here:

https://brainly.com/question/23693316

#SPJ6

Isra is analyzing the properties of several samples of elements to find out which sample is a metalloidd. Which set of properties most likely belongs only to metalloidd? A) forms basic compounds and is a solid B) has a high luster and is very brittle C) is a gas and has low electrical conductivity D) is brittle and forms acidic compounds

Answers

Metalloids are all solid at room temperature. Some metalloids, such as silicon and germanium, can act as electrical conductors under the right conditions, thus they are called semi-conductors. Silicon for example appears lustrous, but is not malleable or ductile it is brittle as well.

So B seems to be your answer,

I hope this helps.

Answer:

B.

Explanation:

THERE IS NO EXPLANATION NEEDED BECAUSE REASONS LOL

what is one difference between a cell wall and a cell membrane

Answers

The cell wall is the outer most covering of the cell. The cell wall covers the cell membrane. The cell membrane is also known as the plasma membrane or plasma lemma. There is no other name for the cell wall. The cell membrane is present in almost all types of cells. The cell wall is present in bacteria, fungi, algae and plant cell. It is absent in an animal cell and protozoa. The cell membrane is a biological membrane, which is semi- permeable. It allows the passage of certain substances through them.

1.Cell wall is found in plant cell and cell membrane is found in animal cells

Calculate the formula mass for the compound tin(IV) sulfate.

Answers

The molecular formula for tin(IV)  sulfate is Sn(SO₄)₂.
mass of sulfur S = 32.065
as there is 2 sulfur in tin (IV) sulfate = 32.065 x 2 = 64.13
mass of oxygen = 15.999 and there are 8 oxygen atoms in the formula; 
8 x 15.999 = 127.992
mass of tin = 118.71
now add all the masses = 64.13 + 127.992 + 118.71 = 310.832 
formula mass of tin(IV) sulfate is 310.832

SELECT ALL THAT APPLY. Which of the following statements about Charles's law are true?



A. Real gases may be expected to deviate from Charles's law at high pressures.
B. Ideal gases may be expected to deviate from Charles's law at high pressures.
C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.
D. Ideal gases may be expected to deviate from Charles's law near the liquefaction temperature.

Answers

A. Real gases may be expected to deviate from Charles's law at high pressures.

C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.

Answer is:

A. Real gases may be expected to deviate from Charles's law at high pressures.

C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.

At high pressure gas molecules are close to one another and near the liqueffaction temperature energy is very low.

Charles' Law (The Temperature-Volume Law) - the volume of a given amount of gas held at constant pressure is directly proportional to the Kelvin temperature:  

V₁/T₁ = V₂/T₂.  

When temperature goes down, the volume also goes down.


How much water must be added to 12.0 mL of 1.65 M LiCl to dilute the solution to 0.495 M LiCl?

Answers

To solve this problem, we use the formula:

M1 V1 = M2 V2

To calculate for the total final volume V2:

 

V2 = M1 V1 / M2

V2 = 1.65 M * 12 mL / 0.495 M

V2 = 40 mL

 

Since final volume is 40 mL so water needed is:

water volume = 40 mL – 12 mL

water volume = 28 mL

Which best defines partial pressure in a mixture of gases?
pressure that is exerted by all the gases of a mixture on the container
pressure that is exerted by one gas as if it occupied a container by itself
half of the pressure that is exerted by the gases of a mixture on the container
sum of the individual pressures that are exerted by two or more gases

Answers

Answer;

Pressure that is exerted by one gas as if it occupied a container by itself

Explanation;Partial pressure refers to the pressure exerted by an individual gas in a mixture of gases.According to Dalton's law of partial pressure, the total pressure of a mixture of gases is equivalent to the sum of the partial pressures of the component gases.Therefore; The partial pressure of one gas in a mixture of gases, contained in a given volume, is the pressure that one gas would exert if it occupied the entire volume all by itself.

Considering the Dalton's partial pressure, the correct answer is the second option: "pressure that is exerted by one gas as if it occupied a container by itself" defines partial pressure in a mixture of gases.

Dalton's law

The pressure exerted by a particular gas in a mixture is known as its partial pressure.

So, Dalton's law states that the total pressure of a gas mixture is equal to the sum of the pressures that each gas would exert if it were alone:

[tex]P_{T}=P_{1} +P_{2} +...+P_{n}[/tex]

where n is the amount of gases present in the mixture.

This relationship is due to the assumption that there are no attractive forces between the gases.

Dalton's partial pressure law can also be expressed in terms of the mole fraction of the gas in the mixture. The mole fraction is a dimensionless quantity that expresses the ratio of the number of moles of a component to the number of moles of all the components present.

So in a mixture of two or more gases, the partial pressure of gas A can be expressed as:

[tex]P_{A} =x_{A} P_{T}[/tex]

In summary, the correct answer is the second option: "pressure that is exerted by one gas as if it occupied a container by itself" defines partial pressure in a mixture of gases.

Learn more about Dalton's partial pressure:

brainly.com/question/25181467?referrer=searchResults

brainly.com/question/14119417

Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

Answers

Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O

The dehydration of 2-heptanol would yield 2-heptene as the major product along with 1-heptene as a minor product, while the dehydration of 2-methyl-1-cyclohexanol would yield 1-methyl-1-cyclohexene as the major product along with other isomeric alkenes as minor products.

The products obtained by the dehydration of 2-heptanol and 2-methyl-1-cyclohexanol can be predicted based on the rules of alkene formation during dehydration reactions.

For 2-heptanol, the dehydration follows Zaitsev's rule, which states that the more substituted alkene is the major product. In this case, dehydration of 2-heptanol would yield a mixture of alkenes, with the most substituted alkene, 2-heptene, as the major product, and the less substituted alkene, 1-heptene, as a minor product. The reaction can be represented as follows:

[tex]\[ \text{CH}_3\text{CH}(\text{OH})\text{CH}_2\text{CH}_2\text{CH}_2\text{CH}_3 \rightarrow \text{CH}_3\text{CH}=\text{CHCH}_2\text{CH}_2\text{CH}_3 + \text{CH}_3\text{CH}_2\text{CH}=\text{CHCH}_2\text{CH}_3 \][/tex]

For 2-methyl-1-cyclohexanol, the dehydration would also follow Zaitsev's rule. However, since the hydroxyl group is on a cyclohexane ring, the dehydration would lead to the formation of an alkene within the ring. The most substituted alkene that can be formed is 1-methyl-1-cyclohexene. The reaction can be represented as follows:

[tex]\[ \text{C}_6\text{H}_{11}\text{CH}(\text{OH})\text{CH}_3 \rightarrow \text{C}_6\text{H}_{11}\text{C}(\text{CH}_3)=\text{CH}_2 + \text{isomeric alkenes} \][/tex]

In summary, the dehydration of 2-heptanol would yield 2-heptene as the major product along with 1-heptene as a minor product, while the dehydration of 2-methyl-1-cyclohexanol would yield 1-methyl-1-cyclohexene as the major product along with other isomeric alkenes as minor products.

Other Questions
Describe the route of Magellan and Elcano. please show me how to solve ... -5x-10=10 When evaluating data, why is it better to make a graph instead of just looking at the raw data in a table? help me with this please Which theory of motivation hypothesized that within every human being there exists a set of needs that resembles a pyramid? Why do you feel hot and cold at the same time when you're sick? One evening, 2/3 of the students in Rick's class watched television. Line s is the perpendicular bisector of JK. If line s intersects JK at point L, which of the following statements must be true? Check all that apply. A. Line s is perpendicular to JK B. JL = KL C.Line s is parallel to JK D. Point L is the midpoint of JK E. Line s intersects JK at a 180 angle After nuclear explosions animals and humans can continue to die due to ingestion of radioactive particles and nuclear ______________. Complete this sentence fragment with a subordinate clause to make a complex sentence. the police officer was very concerned about... Firms are likely to prefer selective distribution when intermediaries Fourteen of the kids in a class are girls. Eight of the kids wear blue shirts. Two of the kids are neither girls nor wear a blue shirt. If five of the kids are girls who wear blue shirts, how many kids are there in the class? Members of the upper social classes tend to engage in _______ sports more frequently than members of the lower classes. Anti-federalist timothy bloodworth of north carolina feared that the national government described in the proposed constitution would: Most gui classes use the principle of _____ by extending the jframe class. The first industrial revolution caused which of the following?a.death rates to rise in East Africab. birth rates to fall in East Asiac. death rates to fall in South Americad. death rates to fall in Western Europe e. birth rates to rise in South Asia Find the ending balance: Principal: $600Interest Rate:5%Time: 6 Years Plot the line for the equation on the graph. y4=14(x5) Which sentence BEST expresses the main idea of the story? A)People who are rich often get preferential treatment because of their money. B)Mr. Bullfrog thinks he may be a bachelor all of his life, but he has a plan for how he can trick a woman into marrying him. C)People are foolish in trying to choose a wife who is perfect, instead of finding a good match and accepting the imperfections. D)Mrs. Bullfrog and Mr. Bullfrog are really just old friends who took a long time to get to know each other, and even longer to get married. Characters in a magical realistic story usually stay stuck in the troubling part of human existence. In a magical realistic story, how would a character most likely behave if she discovered a frog that could sing and dance? A. Charge people money to see the frog B. Study the frog to find out how it learned to sing and dance C. Let the frog live peacefully in its swamp D. Donate the frog to a university to study Steam Workshop Downloader