It would take 120 minutes to fill a swimming pool using water from 5 taps. How many minutes will it take to fill the pool if only 3 taps are used?

Answers

Answer 1
200 minutes.

First, multiply 120 by 5 to find how much time it would take for one tap. You get 600 minutes. Now, divide by 3 to find how much time it would take 3 taps. You get 200 minutes.
Answer 2

Final answer:

It will take 72 minutes to fill the pool using only 3 taps.

Explanation:

To find out how many minutes it will take to fill the pool using only 3 taps, we can set up a proportion.

If it takes 120 minutes to fill the pool using 5 taps, then the rate at which water flows from the taps is 1 pool/120 minutes/tap.

Using this rate, we can set up the proportion:

5 taps / 3 taps = 120 minutes / x minutes

Cross-multiplying and solving for x gives us:

x = (3 taps * 120 minutes) / 5 taps = 72 minutes

So, it will take 72 minutes to fill the pool using only 3 taps.


Related Questions

Which method is the most efficient method to use to solve x^2+4x+3=0

Answers

Answer:

Factoring

Step-by-step explanation:

To solve the equation [tex]x ^ 2 + 4x + 3 = 0[/tex], you must apply the factoring method.

You must find two real numbers b and c such that:

[tex]b + c = 4[/tex]

and

[tex]b(c) = 3[/tex]

Then the expression:

[tex]x ^ 2 + 4x + 3 = 0 = (x + b)(x + c)[/tex]

You can prove that:

[tex]b = 3\\c = 1[/tex]

So

[tex]x ^ 2 + 4x + 3 = 0 = (x + 3)(x + 1)[/tex]

[tex](x + 3)(x + 1) = 0[/tex]

[tex]x +3 = 0[/tex] or [tex]x + 1 = 0[/tex]

[tex]x = -3[/tex] or [tex]x = -1[/tex]

X will be -1 and -3!

Identify the vertex of the graph. Tell whether it is a minimum or maximum.
(-2,-3); maximum
(-2,-3); minimum
(-3,-2); maximum
(-3,-2); minimum

Answers

ANSWER

(-2,-3); minimum

EXPLANATION

The vertex is the minimum or maximum point on a parabola.

The graph of the function opens upwards.

Therefore the vertex will be the minimum point on the graph.

From the graph, the minimum point is (-2,-3).

Therefore the vertex is (-2,-3).

The second choice is correct.

in the equation y=4x-7, what is the value of y when x=2?​

Answers

Answer:

-56

Step-by-step explanation:

y=4x-7= x=2

y=4(2)-7

y=(4)(2)(−7)

Answer:

y=−56

Value of y when x = 2 is 1.

What is an equation?

An equation is a mathematical statement with an 'equal to' symbol between two expressions that have equal values.

Given equation

y = 4x-7

Value of y when x = 2

Substitute x = 2 in above equation

[tex]y = 4 \times 2 -7[/tex]

[tex]y=8-7[/tex]

y = 1

Value of y when x = 2 is 1.

Find out more information about equation here

brainly.com/question/2263981

#SPJ2

what is 3 1/8 - 1/2

Answers

Answer:

[tex]\frac{21}{8}[/tex]

Step-by-step explanation:

Given: [tex]3\frac{1}{8} - \frac{1}{2}[/tex]

Let's changed that mixed number to an improper fraction. Now we get:

[tex]\frac{25}{8} - \frac{1}{2}[/tex]

Let's find out least common denominator. This one is easy, the LCD is 8. Now that we know the LCD, let's convert both our fractions:

[tex]\frac{25}{8} - \frac{4}{8}[/tex]

We can use [tex]\frac{4}{8}[/tex] because it is equal to [tex]\frac{1}{2}[/tex]. Now, all we need to do is subtract the numerators:

[tex]\frac{25}{8} - \frac{4}{8}=\frac{21}{8}[/tex]

Answer:

[tex]\frac{21}{8}[/tex]

Step-by-step explanation:

Which expression is equivalent to (3^2)^-2

Answers

Answer: 1/81

First you simplify it to 3^-4

Then express it with a positive exponent which goes to 1/3^4

Then evaluate it to 1/81

Answer:  

The expression which is equivalent to the given expression is given by :

[tex]\bf\frac{1}{81}[/tex]

Step-by-step explanation:

The expression is given to be :

[tex](3^{2})^{-2}[/tex]

Now, we need to find a expression which is equivalent to this given expression.

[tex](3^{2})^{-2}\\\\\implies (3\times 3)^{-2}\\\\\implies (9)^{-2}\\\\\implies\frac{1}{(9)^2}\\\\ \implies \frac{1}{81}[/tex]

Hence, The expression which is equivalent to the given expression is given by :

[tex]\bf\frac{1}{81}[/tex]

nine stores is 3% put of 100. of how many stores are a hundred percent ? use proportions or multiplication please!!​

Answers

Answer:

30,000 stores

Step-by-step explanation:

setting up a proportion is proably the easiest way to solve this equation..

9/ x = 3%/100%

0.03x = 9(100)

0.03x = 900

/0.03     /0.03

x = 30,000 stores

hope this helps!!

Mark launches a toy rocket with an initial vertical velocity of 25ft/s from a platform that is at ground level. how long will the toy rocket be in the air?

Answers

Answer:

A

Step-by-step explanation:

First: C is incorrect. It is using the value of acceleration due to gravity in the metric system.

Second: the 16 must be opposite in sign from the 25. That makes B and D incorrect.

Answer: A

Emma’s total bill for dinner was $20. The cost of her dessert was 30% of the total bill. What was the cost of her dessert?

Answers

$6 was her dessert. you do 20x0.3=6

Find the value of y.
Answer options: 62, 66, 70, 74

Answers

Answer:

The value of y = 70°

Step-by-step explanation:

∵ The measure of the major arc = 160 + 60 = 220°

∵ The measure of the circle is 360°

∴ The measure of the minor arc = 360 - 220 = 140°

∵ y is the angle between a chord and a tangent

∵ The chord subtended by the arc of measure 140°

∵ y is subtended by the arc of measure 140°

∵ Angle of tangent subtended by an arc,

  its measure = half the measure of the subtended arc

∴ The measure of y = 1/2 the measure of the subtended arc

∴ y = 1/2 × 140 = 70°

Answer:

70

Step-by-step explanation:

9.
The original cost of a lamp is $18.95. The lamp is on sale for 25% off. How much will you pay

Answers

Answer:

$14.21

Step-by-step explanation:

To find 25% of 18.95, you can multiply 18.95×0.25, which approximately equals $4.74. Then subtract $4.74 from $18.95 to get $14.21

Answer:

$14.2125

Step-by-step explanation:

We have been given that the original cost of a lamp is $18.95. The lamp is on sale for 25% off.

Since the lamp is on a 25% sale, then the cost of the lamp would be 75% (100%-25%) of the original price.

[tex]\text{Cost of lamp after sale}=\$18.95\times \frac{75}{100}[/tex]

[tex]\text{Cost of lamp after sale}=\$18.95\times 0.75[/tex]

[tex]\text{Cost of lamp after sale}=\$14.2125[/tex]

Therefore, you will have to pay $14.2125 for the lamp.

A simple random sample of ten people is taken from the set of all registered voters in a given district to determine their average age. Which of the following is a reason why you can not make a statistical inference on the population?

Answers

Answer:

The sample size is not appropriate.

The population isn’t given to be approximately normal.  And for the following question, "A convenience sample of forty people is taken from a population. Which of the following is a reason why you can not make a statistical inference on the population?" The answer is The wrong sampling method was used.

Answer:

Answers are : (1st & 2nd choices)

• The sample size is not appropriate.

• The population isn't given to be approximately normal.

10.5 Tangents. Hw 20

Answers

Answer:

Refer to step-by-step.

Step-by-step explanation:

1. x = 4

x + 3 = 7

x = 7-3

x = 4

2.  x = 25

We need to use the Pythagorean theorem to find x.

a² + b² = c²

15² + 20² = x²

225 + 400 = x²

652 = x²

√652 = √x²

x = 25

3. x = 12

Line NP and Line QP will have the same measurement.

x = 12

4. x = 29.41

We need to use the Pythagorean theorem to find x.

a² + b² = c²

24² + 17² = x²

576 + 289 = x²

865 = x²

√865 = √x²

x = 29.41

5. NO

We apply the Pythagorean theorem to find if they are tangent.

a² + b² = c²

9² + 40² = 41²

81 + 1600 = 2500

1681 = 2500 NO

6. NO

a² + b² = c²

4² + 12² = 13²

16 + 144 = 169

160 = 169 NO

7. NO

a² + b² = c²

20² + 21² = 28²

400 + 441 = 784

841 = 784 NO

8. YES

a² + b² = c²

14² + 48² = 50²

196 + 2304 = 2500

2500 = 2500 YES

Determine the factors of 3x2 + 10x − 8. (Which is the right answer?)

A. (3x − 8)(x + 1)
B. (3x − 1)(x + 8)
C. (3x − 4)(x + 2)
D. (3x − 2)(x + 4)

Answers

ANSWER

[tex](3x - 2)(x + 4)[/tex]

EXPLANATION

The given quadratic trinomial is

[tex]3 {x}^{2} + 10x - 8[/tex]

Comparing to the general quadratic trinomial:

[tex]a{x}^{2} + bx + c[/tex]

We have a=1, b=10 and c=-8

[tex]ac = 3 \times - 8 = - 24[/tex]

The factors of -24 that adds up to 10 are -2 and 12.

We split the middle term to obtain;

[tex]3 {x}^{2} + 12x - 2x- 8[/tex]

Factor;

[tex]3x(x+ 4) - 2(x + 4)[/tex]

Factor further;

[tex](3x - 2)(x + 4)[/tex]

The last option is correct.

Which phrase could the expression x-4 represent? a number less than 4 the difference of a number and 4 the sum of a number and 4 four less a number

Answers

Answer:

Four less a number

Step-by-step explanation:

x-4 is literally subtracting 4 and 4 less a number is basically also subtracting 4 from an equation.

Answer:

The difference of a number and 4.

Step-by-step explanation:

The sentence that represents better the given expression is "The difference of a number and 4".

Mainly because states the difference in the right order, first the unknown number, which is called "a number", and in second place the number 4, referring to the difference is the subtract of 4 units from the number, not in the opposite way.

On the other hand, "a number less than 4" specifies that the unknown number is minor than 4, which is not true. "the sum of a number and 4" is completely wrong, because there's no sum at all. "Four less a number" refers to a difference but in the opposite way 4-x.

Therefore, the right answer is

The difference of a number and 4.

EMERGENCY




The graph represents function 1, and the equation represents function 2.

Function:

y = 8x + 12

How much more is the rate of change of function 2 than the rate of change of function 1?

Answers

Answer:

The rate of change is 8 more for function 2 than it is for function 1.

Step-by-step explanation:

Function 1 is a horizontal line, which has a slope of 0. Slope is the same as rate of change.

Function 2 has a slope of 8 (since it is the coefficient of x.

As a result, we know that function 2's rate of change is 8 higher than that of function 1.

Lisa’s test grades are 79, 89, and 90.

What is Lisa’s test average?

Answers

Answer: 86

Step-by-step explanation: You would add up all the numbers, then divide by the amount of numbers there are.

For example

79+89+90=258

Since there are three numbers(79,89,90) you would divide 258 by 3 and would get 86.

Hopes this helps

The answer is 86!

Add the numbers together. 79 + 89 + 90

Then divided by 3.

86.

If the endpoints of the diameter of a circle are (−8, −6) and (−4, −14), what is the standard form equation of the circle? A) (x + 6)2 + (y + 10)2 = 20 B) (x − 6)2 + (y − 10)2 = 20 C) (x + 6)2 + (y + 10)2 = 2 5 D) (x − 6)2 + (y − 10)2 = 2 5

Answers

Answer:

[tex]\large\boxed{A.\ (x+6)^2+(y+10)^2=20}[/tex]

Step-by-step explanation:

The standard form of an equation of a circle:

[tex](x-h)^2+(y-k)^2=r^2[/tex]

(h, k) - center

r - radius

We have the endpoints of the diameter of a circle (-8, -6) and (-4, -14).

The midpoint of a diameter is a center of a circle.

The formula of a midpoint:

[tex]\left(\dfrac{x_1+x_2}{2},\ \dfrac{y_1+y_2}{2}\right)[/tex]

Substitute:

[tex]x=\dfrac{-8+(-4)}{2}=\dfrac{-12}{2}=-6\\\\y=\dfrac{-6+(-14)}{2}=\dfrac{-20}{2}=-10[/tex]

We have h = -6 and k = -10.

The radius is the distance between a center and the point on a circumference of a circle.

The formula of a distance between two points:

[tex]d=\sqrt{(x_2-x_1)^2+(y_2-y_1)^2}[/tex]

Substitute (-6, -10) and (-8, -6):

[tex]r=\sqrt{(-8-(-6))^2+(-6-(-10))^2}=\sqrt{(-2)^2+4^2}=\sqrt{4+16}=\sqrt{20}[/tex]

Finally we have

[tex](x-(-6))^2+(y-(-10))^2=(\sqrt{20})^2\\\\(x+6)^2+(y+10)^2=20[/tex]

Answer:

It's A...Just had it but i Chose B but it's A

Step-by-step explanation:

All perfect squares are divisible by two​

Answers

Answer:

No

Step-by-step explanation:

No, because think of 9, its not divisible by two and for the second one yes, a perfect square always has a positive and negative

HELP ASAP PLS!!

Which triangle is a translation of triangle ABC?

A) DEF

B) GHI

C) JKL

D) MNO

Answers

Answer:

the answer would be JKL

Step-by-step explanation:

Data was collected of students’ hair color and gender. The results are in the table below.

Answers

Answer:

Step-by-step explanation:

Part One

Number of girls with blonde hair = 6

Total number of students = 40

% = 6/40 * 100% = 15%

Part Two

Number of Red Headed boys = 2

Just read the chart.

Part Three

The Chance that black hair is 4/40 = 0.1 or 1 in 10

A concession stand sells apple cider for $3.35 a cup and donuts for $2.45 each, on Saturday the stand sold 126 items and made $362.70 how many cups of apple cider did the stand sell

Answers

52 cups.

3.35 times 52 equals 174.20

2.45 times 77 equals 188.60

So 52 cups of apple cider were sold in total.

Answer:

 The number of cups of apple cider sold was 60 cups

Step-by-step explanation:

We will develop equations to solve this problem.

Let a= price for a cup of apple cider in dollars

Let b= price for a donut in dollars

Let x = number for cups of apple cider sold

Let y= number of donuts sold

Let z = number of items sold on the day = 126 items

Let v = total money made = $362.70

Lets write two equations. One in terms of the amount of items sold of cups of apple cider and donuts, and one in terms of how much money was made for selling cups of apple cider and donuts.

z = x + y

x = z- y (1)

v = ax + by (2)

we substitute equation 1 in to equation 2

v = a(z-y) +by = az -ay +by = az +y(b-a)

solve for y

y = (v-az)/(b-a) = (362.70 - 3.35×126)/(2.45-3.35) = 66 donuts were sold

therefore x = z-y = 126-66 = 60 cups of apple cider were sold

Solve the exponential equation. Write the exact answer with natural logarithms and then approximate the result correct to three decimal places.

[tex]5^{1-x} =2^{x}[/tex]

I was able to start it, but I somehow got [tex]log_{5}2=0[/tex], and I don't think that's right.

Answers

Answer:

Fraction form: x = ln(5)/ln(10)

Decimal form: 0.69897000

please mark brainliest

A kayak rental company charges a $15 fee to rent a kayak plus $3.50 per hour. Which equation represents the function for the total cost, c, to rent a kayak for h hours?

A. c=3.5x+15

B. c=3.5x-15

C. c=-3.5x+15

D. c=-3.5x-15

Answers

Final answer:

The correct equation is c=3.5h+15, where c is the total rental cost and h is the number of hours the kayak is rented. The equation includes a fixed fee of $15 and a variable hourly rate of $3.50. The correct answer is option (A).

Explanation:

The equation representing the function for the total cost c, to rent a kayak for h hours, is A. c=3.5h+15. This equation consists of a fixed cost and a variable cost.

The fixed cost, or y-intercept, is the initial $15 fee required to rent the kayak, which is represented when h=0. The variable cost, or slope, is $3.50 per hour of rental, indicating that for each additional hour h, the cost increases by this amount.

Identify if each of triangles below is congruent or not. Remember that the diagram may not be drawn to scale. Justify your conclusion.

Answers

Answer: ¨A¨ is congruent due to SSS. ¨B¨ is not because corresponding sides are not congruent. ¨D¨ is congruent due to AA. Can´t see all of ¨C¨

Step-by-step explanation:

(2x+3y)+(4x+9y) how do I simplify it​

Answers

Answer: the answer is 6x + 12y

Step-by-step explanation:

6x+12y will be the answer for this!

Plz help me!!!!!!!!!!

Answers

Answer:

a = ( 5 +/- sqrt(57) )/2

Step-by-step explanation:

Uh...well just multiply by a and move the 4, setting the equation to 0.

a, b, and c are 2, -5, -4

Plug that into the QuadF.

Answer:  [tex]\bold{\dfrac{5\pm \sqrt{57}}{4}}[/tex]

Step-by-step explanation:[tex]2a-5=\dfrac{4}{a}\\\\\text{Multiply by the LCD (a) to clear the denominator:}\\\\\\2a(a)-5(a)=\dfrac{4}{a}(a)\\\\2a^2-5a=4\\\\2a^2-5a-4=0\quad \rightarrow \quad a=2,\ b=-5,\ c=-4\\\\\\\text{Quadratic formula is: }x=\dfrac{-b\pm \sqrt{b^2-4ac}}{2a}\\\\\\x=\dfrac{-(-5)\pm \sqrt{(-5)^2-4(2)(-4)}}{2(2)}\\\\\\.\ =\dfrac{5\pm \sqrt{25+32}}{4}\\\\\\.\ =\dfrac{5\pm \sqrt{57}}{4}[/tex]

fine the value of m-8 when m=15

Answers

Answer:

23

Step-by-step explanation:

15+8=23

Answer:

7

Step-by-step explanation:

um thats just 15-8

Check my answers please thank you

Answers

16-20 are correct. Remember to mark the first #20 as A

The last #20 is wrong. The answer is B. 95 minutes.

10:55 - 11:00 =  5 minutes

11:00 - 12:00 = 60 minutes

12:00 - 12:30 = 30 minutes

            Total = 95 minutes

The height of one right circular cylinder is 7 centimeters and it’s radius is 2 centimeters. The height of the second right circular cylinder is 28 centimeters and it’s radius is also 2 centimeters. What is the ratio of the volume of the larger cylinder to the volume of the smaller cylinder? Please Explain!!

Answers

Volume of a cylinder

[tex]\pi \times {r}^{2} \times h[/tex]

larger cylinder: r=2, h=28

volume of larger cylinder lets say (V) :

[tex]\pi \times {2}^{2} \times28 \\ = 4 \times 28\pi =112\pi[/tex]

vokume of smaller cylinder lets say (v): r=2, h=7

[tex]\pi \times {2}^{2} \times 7 \\ = 4 \times 7\pi = 28\pi[/tex]

so the ratio= volume of largercylinder/ volume of smaller

[tex]ratio = \frac{112\pi}{28\pi} \\ = \frac{4}{1} [/tex]

so in ratio terms the

Ans: 4:1

The ratio of the volume of the larger cylinder to the smaller cylinder is 4:1, calculated using the volume formula for cylinders, V = πr²h.

To calculate the ratio of the volumes of two cylinders, we need to use the formula for the volume of a cylinder, V = (πh), where r is the radius and h is the height.

For the first cylinder with a height of 7 cm and a radius of 2 cm, the volume is V₁ = 3.14 (2 cm) (7 cm) = 88.36 cm³.

For the second cylinder with a height of 28 cm and the same radius, the volume is V₂ = 3.14 (2 cm) (28 cm) = 353.44 cm³.

The ratio of V2 to V1 is then 353.44 cm³ / 88.36 cm³, which simplifies to 4:1.

18% of 120 to 12% of 120

Answers

Answer: 18% of 120 is 21.6

And, 12% of 120 is 14.4

* Both of their work is below:)

* Hopefully this helps:)!! Mark me the brainliest:)!!

∞ 234483279c20∞

Answer:

18% of 120 to 12% of 12021.6 to 14.4

Step-by-step explanation:

18% of 120

Convert 18% to a decimal by dividing by 100:

18 / 100 = 0.18

120 * 0.18 = 21.6

12% of 120

Convert 12% to a decimal by dividing by 100:

18 / 100 = 0.12

120 * 0.12 = 14.4

18% of 120 to 12% of 12021.6 to 14.4
Other Questions
What is the ocean found on the east coast of the United States and the west coast of some European and African countries. Phosphatases are a family of enzymes that remove phosphate groups from specific proteins; these phosphate groups had been added to the proteins by protein kinases. Vanadate is an inhibitor of phosphatases in eukaryotic cells. What effect would vanadate have on the response of cells to signals received by receptor kinases? The response of the cell would be shorter than it normally would. The response of the cell would last longer than it normally would. The signal would still bind the receptor, so there would be no effect. Which of the following is not a main priority of the U.S. government?subsidizing businesses to keep product prices lowproviding education for all childrencreating laws that protect property rights and enforce contractsproviding for national defense How do I find and what is the x? TRUE OR FALSE? earth revolves around the sun tilted on its axis Bonita said that the product of 5/6 1 2/3 is 7/ 3. How can you tell that her answer is wrong? During the 1945 conference in Potsdam,Question 14 options:Churchill replaced Clement Atlee as prime minister of Britain.the Big Three decided that Poland, Bulgaria, and Romania would be independent.Stalin reneged on his pledge to enter the war against Japan in the Pacific.the Big Three formalized the plan to divide Germany into four zones of occupation. Disuss the difference between fixed expenses and variable expenses as they relate to a budget? in the figure PQ is parallel to RS. the length of RP is 6 cm; the length of PT is 18 cm; the length of QT is 21 cm; what is the length of SQ? what is the definition of positive effect 535 invenstment compounded continuosly for 10 years at 6 percent A candle is placed 40cm in front of a convex mirror with a focal length of 20cm, as shown on the diagram. What is the distance from the lens to the image? X-10 explain why mental disorders should be viewed like any other physical illness.why it important not to stigmatize someone with a mental disorders . the point slope form of the equation of a line that passes through (8,4) and (0,2) is y-4=1/4(-8) what is the slope intercept form of the equation for this line. After the gaps between the firm's labor supply and labor demand are identified, a firm should ________. develop and implement action plans conduct a workforce analysis identify its business strategy articulate its talent philosophy and strategic staffing decisions The primary advantage quick-service restaurants have over other restaurant types is URGENT! Which of the following correctly expresses sin(2)sin(6) as a product?Select the correct answer below:2sin(4)cos(2)2sin(2)cos(4)2sin(2)cos(4)2sin(2)sin(4) What are some ideas that i would put for a visual project (power point) on NRA civil rights issues. please idc if you guys get political as long as i can put them in the power point. Identify Cause and Effect How did World War I affect the role of women in society? Steam Workshop Downloader