Please help me out with this

Please Help Me Out With This

Answers

Answer 1

Answer:

81.75 ft²

Step-by-step explanation:

The area (A) of a trapezoid is calculated using the formula

A = [tex]\frac{1}{2}[/tex] h (a + b)

where a, b are the parallel bases and h is the perpendicular height

Calculate h using the right triangle and the sine ratio

sin30° = [tex]\frac{opposite }{hypotenuse}[/tex] = [tex]\frac{h}{10}[/tex]

Multiply both sides by 10

10 × sin30° = h, thus

h = 5

a = 12 and b = 8.7 + 12 = 20.7, hence

A = [tex]\frac{1}{2}[/tex] × 5 × (12 + 20.7)

   = 0.5 × 5 ×32.7

   = 81.75 ft²


Related Questions

SOMEONE
HELP PLEASE!!

Answers

Answer:

it is the third one (from left to right)

Step-by-step explanation:

no explation

The residuals for data set X and data set Y were calculated and plotted on separate residual plots. If the residuals for data set X do not form a pattern and the residuals for data set Y form a pattern, what can be concluded?

A. Data set X is not linear, and data set Y is not linear.
B. Data set X is not linear, and data set Y is linear.
C. Data set X is linear, and data set Y is linear.
D. Data set X is linear, and data set Y is not linear.

Answers

Answer:

B. Data set X is not linear, and data set Y is linear.

Step-by-step explanation:

We assume here that "form a pattern" means "roughly forms a line"... because a pattern doesn't necessarily equal a line, it would be a curve that would easily be interpreted too, but it wouldn't be linear.

Since you cannot form a pattern, and based on your choices for answer, we have have to say that data set X is NOT linear.

On the opposite, since the data set Y produces a pattern, it has to be linear.

So, X = NOT linear, Y = linear.

Answer:

(Data set x is linear, and data set y is not linear.) This is the correct answer 100%...

When i put the answer in from the other person which was (x is not linear, and y is linear) it said incorrect and gave me this answer x is linear, and y is not linear. So be careful what you put down.

Step-by-step explanation:

Please help me out with this

Answers

Answer:

11.6 cm²

Step-by-step explanation:

The area (A) of the shaded region is

A = area of sector - area of triangle

area of sector = area of circle × fraction of circle

                       = π × 9.28² ×[tex]\frac{68.9}{360}[/tex] ≈ 51.78 cm²

area of triangle = [tex]\frac{1}{2}[/tex] × 9.28 × 9.28 × sin68.9°

                         = 0.5 × 9.28² × sin68.9 ≈ 40.17 cm²

Area of shaded region = 51.78 - 40.17 ≈ 11.6 cm²

An online service charges $3 for each downloaded movie, plus a monthly fee of $6.50. Which function represents this situation?

y = 3x - 6.50
y = 6.50x - 3
y = 3x + 6.50
y = 6.50x + 3

Answers

ANSWER

y = 3x + 6.50

EXPLANATION

The $3 for each downloaded movie is the unit rate of change.

This is represent the slope of the linear function that models this situation.

The monthly fee of monthly fee of $6.50 the constant rate.

It represents the y-intercept of the function.

The linear function is given by

[tex]y = mx + b[/tex]

The correct choice is y = 3x + 6.50

the answer would be C. y = 3x + 6.50, for every movie you buy (which is x), they would be 3$. therefore it would be 3x, and the monthly fee would just be added with that. :P

write an equation in slope-intercept form for the line with slope -2 and y-intercept 5. then graph the line.
equation: y = ?

Answers

Answer:

y = -2x + 5.

Step-by-step explanation:

The general form is y = mx + b where m = the slope and b = the y-intercept.

So here m = -2 and b = 5 so our equation is:

y = -2x + 5.

Use the function below to find F(4)

[tex]F(x) = 5 *(\frac{1}{2})^x[/tex]

Answers

[tex]

f(4)=5\times(\frac{1}{2})^4 \\

f(4)=\frac{5\times1^4}{2^4} \\

f(4)=\boxed{\frac{5}{16}}

[/tex]

Hope this helps.

Brainliest would be great.

For this case we have a function of the form[tex]y = f (x)[/tex]

Where:

[tex]f (x) = 5 * (\frac {1} {2}) ^ x[/tex]

We must find the value of the function when x = 4, that is, f (4):

Substituting we have:

[tex]f (x) = 5 * (\frac {1} {2}) ^ 4\\f (x) = 5 * \frac {1} {2} * \frac {1} {2} * \frac {1} {2} * \frac {1} {2}\\f (x) = 5 * \frac {1} {16}\\f (x) = \frac {5} {16}\\f (x) = 0.3125[/tex]

ANswer:

[tex]f (x) = \frac {5} {16}\\f (x) = 0.3125[/tex]

In an election, 54% of the voters voted for a new school tax. What is the probability that a randomly selected voter did not vote for the tax? Express your answer as a percentage.

a. 46%
b. 17%
c. 15%
d. 54%

Answers

The correct answer is A. 46%

Majel is making batches of trail mix. Each batch uses 3/4 cup of granola. How many batches of trail mix can Majel make from 6 1/2 cups of granola

Answers

Answer: 8 2/3

Step-by-step explanation:

The area of a regular heptagon can be found by breaking the heptagon into seven congruent triangles and then taking the sum of their areas. True or false

Answers

Answer:

True

Step-by-step explanation:

The area of a regular polygon is found by multiplying 1/2 times the apothem times the perimeter.  The area for a single triangle is 1/2 times the height (which is the same as the apothem of a regular polygon) times the base (which is one of the sides of the regular polygon which you are multiplying by  to find the perimeter of the polygon).

Answer:

The given statement is true.

Step-by-step explanation:

The area of a regular heptagon can be found by breaking the heptagon into seven congruent triangles and then taking the sum of their areas.

This is true.

Breaking down in 7 triangles and adding separately the areas of these triangles, will give the complete area of the heptagon. We can also find the area of one triangle and multiply that by 7 to get the same result.

Given the force field F, find the work required to move an object on the given orientated curve. F=<y,x> on the parabola y=7x^2 from (0,0) to (4,112)
[tex]y = 7 {x}^{2}[/tex]

Answers

The work done by the force field  on the object moving on the parabola y=7x^2 from (0,0) to (4,112) is calculated by integrating the force along the path. The total work done is found to be 224 units of work.

To find the work done by a variable force on an object moving along a given curve, we utilize the concept of a line integral in vector calculus. Given the force field F =  and the parabolic path described by y = 7x2, from point (0,0) to (4,112), we want to integrate the force field along the curve. To calculate this line integral, we parameterize the curve using x as the parameter, since y is already expressed as a function of x. We then express the force field in terms of x, evaluate the dot product of the force field and the differential of the position vector, and integrate from the start to the end of the curve.

The work, W, is found by integrating the dot product of F and dx from the initial to the final position:
W = \\int (F . dx).

In our case, the force field becomes F(x, y(x)) = F<7x2, x> = <7x2, x>. The differential displacement along the parabola, expressed in vector form, is dx = <1, 14x>dx because dy/dx = d(7x2)/dx = 14x. Thus, the infinitesimal work is dW = F .dx = 7x2 * 1dx + x * 14xdx = 21x2dx. Finally, we integrate from x = 0 to x = 4 to find the total work:

W = \\int_{0}^{4} 21x2dx = 7x3\\right]_{0}^{4 = 7 * 43 = 224.

Therefore, the work done by the force field along the parabolic path from (0,0) to (4,112) is 224 units of work.

The work required to move an object along the parabola y = 7x^2 from (0,0) to (4,112) under the force field F = <y, x> is approximately 149.33 units.

To find the work required to move an object along a curve under the influence of a force field, we can use the line integral of the force field along the curve. The line integral is given by the formula:

∫ F · dr = ∫ (F1 dx + F2 dy)

Given the force field F = <y, x> and the parabola y = 7x^2, we need to parameterize the curve to express it in terms of a single variable.

Let's parameterize the curve using x as the parameter:

x(t) = t

y(t) = 7t^2

Now, we can calculate the differential elements dx and dy:

dx = x'(t) dt = dt

dy = y'(t) dt = 14t dt

Substitute the expressions for F, dx, and dy into the line integral formula:

∫ F · dr = ∫ (y dx + x dy)

            = ∫ (7t^2 dt + t * 14t dt)

            = ∫ (7t^2 + 14t^2) dt

            = ∫ 21t^2 dt

            = 7t^3 / 3 + C

Evaluate the integral from t = 0 to t = 4:

Work = [7(4)^3 / 3] - [7(0)^3 / 3]

    = (7 * 64 / 3) - 0

    = 448 / 3

    ≈ 149.33

Therefore, the work required to move an object along the parabola y = 7x^2 from (0,0) to (4,112) under the force field F = <y, x> is approximately 149.33 units.

Help, with this multiple choice question?

Phillip is looking at two different jobs. One has a higher hourly pay rate, while the other
offers benefits. The first job pays $25 an hour, while the second job pays $20 an hour.
Benefits from the second job are equivalent to $100 per pay period. How many hours per
pay period will Phillip have to work in the first job to make the same as the second job,
including benefits?
a. 10
b. 14
c. 20
d. 16

Answers

he would hove to work 20 hours to meet the second job I think

Final answer:

To make the same total earnings at the first job as the second job (including benefits), Phillip would have to work an additional 4 hours (to account for the $100 benefits). If the workdays are 8 hours each, then for every two days (which is 16 hours) worked at job 2, Phillip would need to work an additional 4 hours at job 1, summing up to 20 hours.

Explanation:

This problem is about comparing the earnings from the two jobs. For the second job, Phillip earns $20 per hour and also gets benefits equivalent to $100 per pay period.

If Phillip wants to earn the same amount in the first job (which does not offer any benefits), we calculate how many hours he would need to work to earn an additional $100 (the value of the benefits).

To do this, we divide $100 (benefits of the second job) by the first job's hourly pay rate ($25) which results in 4 hours.

So, Phillip must work an additional 4 hours to make up for the benefits. Meaning, for any given number of hours he would work at the second job, he would need to work an extra 4 hours at the first job to get the same total earnings.

Therefore, the right answer is not among the choices given because we have an extra step to add to each option. If we consider a standard 8-hour workday, working at the second job for two days gives 16 hours with an additional $100 for benefits. To make the same in the first job, Phillip would need to work, 16 hours (from the second job) + 4 hours (to compensate for the $100 benefits) = 20 hours.

Learn more about hourly pay rate comparison here:

https://brainly.com/question/35418513

#SPJ3




Jacob will pay a monthly payment of $650.12 on a fixed rate mortgage over 20 years. What is the total principal and interest for the life of this mortgage rounded to the nearest dollar? I think maybe D.



A. $234,043


B. $13,002


C. $195,036


D. $156,029

Answers

I believe the answer is d. 156,029

I think the answer is D

You were recently hired by a company and will recieve a starting salary of $45,000 per year. You will receive a $2,500 raise each year you are with the company. What will your salary be in your 8th year with the company?

Answers

Answer:

Your salary will be $62,500.

Step-by-step explanation:

This is an arithmetic sequence with first term $45,000 and common difference $2,500.

The appropriate formula is a(n) = a(1) + (n-1)d, where a(1) is the first term, n is a counter and d is the common difference.

In this particular case, a(8) = $45,000 + (8-1)($2,500) = $62,500

Your salary will be $62,500.

A function assigns the values. Your salary after completing the 8th year within the company will be $62,500.

What is a Function?

A function assigns the value of each element of one set to the other specific element of another set.

Given that the starting salary will be $45,000 while the salary will increase every year by $2,500. Therefore, the function that can represent the salary after (n-1) years can be written as,

y = $45,000 + $2,500(n-1)

Now, the salary after 8th year will be,

y = $45,000 + $2,500(n-1)

y = $45,000 + $2,500(8-1)

y = $62,500

Learn more about Function:

https://brainly.com/question/5245372

#SPJ2

Adult tickets for the game cost $4 each and student tickets cost $3 each. A total of 105 tickets worth $380 were sold. How many student tickets were sold?

Answers

Answer:

There were 40 student tickets sold.

Step-by-step explanation:

First I set up equations to represent this situation.

4x+3y=380

x+y=105

x represents the adult tickets and y represents the student tickets.

I can solve this with the elimination method. I want to cancel out the x so I will multiply every term in equation 2 by -4.

4x+3y=380

-4x-4y=-420

Now I combine like terms.

-y=-40

I can divide the negative one from both sides.

y=40

40 Tickets sold.

Thank me later.

A woman invests $5800 in an account that pays 6% interest per year, compounded continuously.

a) What is the amount after 2 years? (Round your answer to the nearest cent.)
b) How long will it take for the amount to be $8000? (Round your answer to two decimal places.)

Answers

a) The amount after 2 years with continuous compounding is approximately $6539.48.

b) It will take approximately 2.32 years for the amount to reach $8000 with continuous compounding.

a) To calculate the amount after 2 years with continuous compounding, you can use the formula:

[tex]A = P \times e^{rt}[/tex]

Where:

A = the amount after time 't'

P = the principal amount (initial investment)

e = Euler's number (approximately 2.71828)

r = the interest rate (as a decimal)

t = the time in years

Given that P = $5800, r = 6% (0.06 as a decimal), and t = 2 years, we can now calculate the amount (A):

[tex]A = 5800 \times e^{0.06 \times 2}[/tex]

[tex]A=5800 \times e^{0.12}[/tex]

[tex]A=5800 \times 1.1275[/tex]

A=6539.48

Hence,  the amount after 2 years is approximately $6539.48.

b) To find how long it takes for the amount to be $8000, we need to solve for 't' in the formula:

[tex]A = P \times e^{rt}[/tex]

Given that A = $8000 and P = $5800, we can rearrange the formula:

[tex]e^{rt}=\frac{A}{P}[/tex]

[tex]e^{0.06t}=\frac{8000}{5800}[/tex]

Take logarithms on both sides:

[tex]0.006t=log(\frac{8000}{5800})[/tex]

[tex]0.006t=0.139[/tex]

t=0.139/0.06

t=2.327

Hence, it takes 2.32 years for the amount to be $8000.

To learn more on Compound interest click here:

https://brainly.com/question/14295570

#SPJ4

Final answer:

After 2 years, the investment grows to approximately $6498.78. It will take around 5.37 years for the investment to grow to $8000.

Explanation:

We can use the formula for continuously compounded interest, which is A = Pe^(rt), where P is the principal amount ($5800), r is the interest rate (6% or 0.06), t is the time, and e is the mathematical constant approximated as 2.71828.

a) To find the amount after 2 years, sub in $5800 for P, 0.06 for r, and 2 for t to get: A = $5800 * e^(0.06*2). Evaluating this gives approximately $6498.78.

b) To find out when the amount will be $8000, we set A to $8000 and solve for t, getting: t = ln($8000 / $5800) / 0.06. Evaluating this gives approximately 5.37 years.

Learn more about Compound Interest here:

https://brainly.com/question/14295570

#SPJ11

calculate the value of A

Answers

Answer:

Second Option

[tex]a=1.46[/tex]

Step-by-step explanation:

The triangle of the figure is a straight triangle.

We know the length of the hypotenuse, h = 2, and we know the angle A = 43°. We need to find the length a. Side a is the side adjacent to the 43° angle

By definition we know that

[tex]cosx = \frac{adjacent}{hypotenuse}[/tex]

Then

adjacent = a

hypotenuse  =2

x =43°

[tex]cos(43\°) = \frac{a}{2}[/tex]

[tex]a= 2cos(43\°)[/tex]

[tex]a= 1.46[/tex]

50 POINTS PLEASE HELP!!
Which values of a, b, and c represent the answer in simplest form?
5/8 divided by 3/8= a b/c
a. a=1, b=3, c=2
b. a=1, b=40, c=24
c. a=1, b= 16, c=24
d. a=1. b=2, c=3

Answers

Answer:

d. a=1. b=2, c=3

multiply by the Reciprocal.

Answer:

D

Step-by-step explanation:

(5/8) / (3/8)

(5/8) * (8/3)

5/3

1 ⅔

a = 1, b = 2, c = 3

Answer D.

A cylinder has a diameter of 22 cm and a height of 9 cm. Identify the volume of the cylinder to the nearest tenth. HELP PLEASE!!

Answers

Answer: 3421.19

Step-by-step explanation:

look up cylinder formula and r= radius which is just the diameter cut in half

A cylinder is a three-dimensional structure formed by two parallel circular bases connected by a curving surface. The volume of the cylinder is 3421.1944 cm³.

What is a cylinder?

A cylinder is a three-dimensional structure formed by two parallel circular bases connected by a curving surface. The circular bases' centers overlap each other to form a right cylinder.

Given the diameter of the cylinder is 22 cm, therefore, the radius of the cylinder is 11cm, Also, given the height of the cylinder is 9 cm.

The volume of the cylinder = πR² × H

                                             = π × (11cm)² × 9cm

                                             = 1089π cm³

                                             = 3421.1944 cm³

Hence, the volume of the cylinder is 3421.1944 cm³.

Learn more about Cylinder:

https://brainly.com/question/12248187

#SPJ2

Name the quadrant in which tanθ and secθ are positive.

Answers

ANSWER

Quadrant I

EXPLANATION

In the first quadrant all the trigonometric ratios are positive.

This implies that,both tanθ and secθ are positive in the first quadrant.

No two trigonometric ratios are positive in any other quadrant apart from the first quadrant.

Answer:

qaud I

Step-by-step explanation:

Miguel has started training for a race. The first time he trains, he runs 0.5 mile. Each subsequent time he trains, he runs 0.2 mile farther than he did the previous time. What arithmetic series represents the total distance Miguel has run after he has trained n times?

Answers

Answer:

[tex]0.4n+0.1n^2\ miles[/tex]

Step-by-step explanation:

The first time he trains, he runs 0.5 mile, then the first term of the arithmetic sequence is [tex]a_1=0.5.[/tex]

Each subsequent time he trains, he runs 0.2 mile farther than he did the previous time, then the difference of the arithmetic sequence is [tex]d=0.2.[/tex]

The nth term of the arithmetic sequence can be found using formula

[tex]a_n=a_1+(n-1)d,[/tex]

hence

[tex]a_n=0.5+0.2(n-1)\\ \\a_n=0.5+0.2n-0.2\\ \\a_n=0.3+0.2n.[/tex]

The total distance after Miguel has trained n times can be found using formula

[tex]S_n=\dfrac{a_1+a_n}{2}\cdot n,[/tex]

thus, the total distance is

[tex]S_n=\dfrac{0.5+0.3+0.2n}{2}\cdot n=\dfrac{0.8+0.2n}{2}\cdot n=(0.4+0.1n)n=0.4n+0.1n^2.[/tex]

Answer:

First answer is C. (0.3+0.2K)

Second one is 15 Times

Step-by-step explanation:

Answer on EDG hope it helps :)

Three consecutive integers have a sum of 42. Find the integers.
100
Clear
Und
<< Prev. Question
Next Questi

Answers

Answer:

The three integers are 13,14,15

Step-by-step explanation:

Let x be the first integer

x+1 be the second integer

x+2 be the third integer

The sum of the three integers is 42

x+ (x+1) + (x+2) = 42

Combine like terms

3x+3 = 42

Subtract 3 from each side

3x+3-3 = 42-3

3x= 39

Divide by 3

3x/3 = 39/3

x = 13

x+1 = 14

x+2 = 15

The three integers are 13,14,15

What is the surface area of a cube with a side length of 4 inches?

12 in2
48 in2
64 in2
96 in2

Answers

Answer:

96in^2

Step-by-step explanation:

because first find the area of two sides (Length*Height)*2 sides.

Find the area of adjacent sides (Width*Height)*2 sides.

Find the area of ends (Length*Width)*2 ends.

Add the three areas together to find the surface area.

Example: The surface area of a rectangular prism 5 cm long, 3 cm.

Answer:

96

Step-by-step explanation:

Did quiz

What is the volume of the cone below?

Answers

ANSWER

B.

[tex]112\pi \: {units}^{3} [/tex]

EXPLANATION

The volume of a cone is calculated using the formula:

[tex]Volume = \frac{1}{3} \pi {r}^{2}h[/tex]

where r=4 units is the base radius of the cone.

and h=21 units is the vertical height of the cone.

We plug in the values to get;

[tex]Volume = \frac{1}{3} \times \pi \times {4}^{2} \times 21[/tex]

[tex]Volume = 112\pi \: {units}^{3} [/tex]

Answer:

The correct answer is option B.  112π units ³

Step-by-step explanation:

Formula

Volume of cone = (πr²h)/3

Where r - Radius of cone and

h - Height of cone

To find the volume of cone

Here radius r = 4 units

Height h = 21 units

Volume = (πr²h)/3

= (π * 4² * 21)/3

= 112π units ²

Therefore the correct answer is option B.  112π units ³

Can someone explain this?

Answers

Hello!

The answer is:

The missing step is the step shown in the last option:

D. [tex]324=0.042x+16[/tex]

Why?

To find which is the missing step, we need to remember that to cancel a square root, we need to elevate it, so:

Starting from the last step before the missing step, we have:

[tex]-18=-\sqrt{0.042x+16}[/tex]

In order to calculate the value of the variable (x) we need to square both sides of the equation, since squaring a root will cancel the root.

We must remember the following properties:

[tex]\sqrt{a^{m} }=a^{\frac{m}{2}}\\\\(a^{b})^{c}=a^{b*c}[/tex]

Now, finding the missing step, we need to find what to do in order to get the expression of the following step.

So, squaring both sides of the equation in order to cancel the square root and isolate the variable, we have:

[tex]-18=-\sqrt{0.042x+16}\\\\(-18)^{2} =(-\sqrt{0.042x+16})^{2} \\324=0.042x+16\\324-16=0.042x\\\\x=\frac{304}{0.042}=7333[/tex]

Hence, we found the the missing step is:

D. [tex]324=0.042x+16[/tex]

Have a nice day!

Tina bought a t shirt and sandals the total cost was 41.50. The t shirt cost 8.95. The equation 8.95 + c = 41.50 can be used to find the cost c in dollars of the sandals how much did the sandals cost

Answers

Answer:

sandals costed $32.55

Step-by-step explanation:

Final answer:

To find the cost of the sandals, subtract the cost of the T-shirt from the total cost. The equation 8.95 + c = 41.50 leads to c = 32.55, meaning the sandals cost $32.55.

Explanation:

The question asks us to find the cost of sandals that Tina bought, given the total cost of a T-shirt and the sandals combined, and the cost of the T-shirt alone. To solve for the cost c of the sandals, we start with the equation 8.95 + c = 41.50. We then isolate c by subtracting 8.95 from both sides of the equation:

c = 41.50 - 8.95

c = 32.55

Therefore, the cost of the sandals was $32.55.

At a competition with 5 runners, 5 medals are awarded for first place through
fifth place. Each medal is different. How many ways are there to award the
medals?
Decide if the situation involves a permutation or a combination, and then find
the number of ways to award the medals.

Answers

Answer: Permutation; number of ways = 120

Step-by-step explanation:

Answer with explanation:

Number of runner= 5

Number of Distinct Medal = 5

First Medal can be Awarded in 5 ways, second Medal can be awarded in 4 ways and third Medal can be awarded in 3 ways , fourth medal can be awarded in 2 ways and fifth Medal can be awarded in one way.

So, total number of ways =5 × 4×3×2×1=120 way

⇒We will use the concept of Permutation as there are five distinct medal and five different runners

So, Five distinct places can be filled in 5! or [tex]_{5}^{5}\textrm{P}[/tex] ways as order of arrangement is Important because any of the five candidates can win first second, third , fourth or fifth Prize.  

= 5!=5×4×3×2×1=120 ways

Because, n!=n×(n-1)×(n-2)×........1.

math help !! will mark brainliest

Answers

Answer:

y = 2 x - 1

Hope this helps :)

Have a great day !

5INGH

Step-by-step explanation:

When x = 1 , y= 1

x = 2 , y=3

Please help with question 5!

Answers

Answer:

  68

Step-by-step explanation:

[tex]a_2=2a_1+4=2\cdot 5+4=14\\\\a_3=2a_2+4=2\cdot 14+4=32\\\\a_4=2\cdot 32+4=68[/tex]

  a₄ = 68

_____

The explicit formula is

  an = 9·2^(n-1) -4

A flat circular plate has the shape of the region x 2 + y 2 ≤ 1. points on the plate have temperature t(x, y) = x 2 + 2y 2 − x. find the temperatures of the hottest and coldest points of the plate

Answers

A flat circular plate has the shape of the region x 2 + y 2 ≤ 1. points on the plate have temperature t(x, y) = x 2 + 2y 2 − x. find the temperatures of the hottest and coldest points of the plate

Use substitution to solve the system of equations. 2x+4y=8 3x-5y=1

Answers

ANSWER

The solution is (2,1)

EXPLANATION

The given equations are:

2x+4y=8...(1)

3x-5y=1...(2)

We make x the subject in the first equation to get:

2x=8-4y

This means that,

x=4-2y...(3)

Put equation (3) into equation (2)

3(4-2y)-5y=1

Expand:

12-6y-5y=1

-6y-5y=1-12

-11y=-11

y=1

Put y=1 into equation (3).

x=4-2(1)=2

The solution is (2,1)

Other Questions
Pablo y Elena ___ el mes pasado. La boda fue fabulosa a. Se casaron b. Se rieron c . Hicieron un picnic d. Se saludaron. find the product and simplify your answer. -n(-2n4+9n-5) How do electric and magnetic fields interact in an electromagnetic wave? Elena makes a table to organize the functions of electric motor components.Which functions belong in the cells marked X and Y?component functionbrush Xcommutator YA. X: Conducts current to the armature and reverses direction of currentY: Rotates as a result of changing magnetic forcesB. X: Rotates as a result of changing magnetic forcesY: Conducts current to the armature and reverses direction of currentC. X: Allows current to flow into the commutatorY: Conducts current to the armature and reverses direction of currentD. X: Allows current to flow into the commutatorY: Rotates as a result of changing magnetic forces What method did the united states use in nicaragua, guatemala, and chile to prevent them from becoming communist states? Find the measure of x for this shape.A. 36b.28c.32d.22 After the program was completed, the coach monitored each of the 30 athletes for five athletic events. At the end of this process, he reported that the average number of muscular injuries for athletes enrolled in the strength training program is equal to the average number of muscular injuries for athletes not enrolled in the strength training program. What can be concluded from the coach's report? The giver and Jonas come up with a plan that would allow Jonas to escape. what does the givers refusal to accompany Jonas tell you about the givers character? What is the first step that should be taken when a caustic chemical gets into a person's eye? My little cousin keeps taking my phone and my mom thinks it's my fault. I don't know what to do about it. HELP PLEASE! Also I don't know why she takes it, or what she does with it. What should I do? If cos(x)cos(/7)+sin(x)sin(/7)= - (2)/2, then x can equal:(Check all that apply)A. (/4)+(/7)+2nB. (5/4)+(/7)+2nC. (7/4)+(/7)+2nD. (3/4)+(/7)+2n What are the ratios for sin A and cos A? The triangle is not drawn to scale. 12 pounds of beans are distributed equally into 8 bags to give out at a food bank how many pounds of beans are in each bag 43. Difference between a landfill and dump is (5 points) There is no difference-they both involve burying trashWealthy countries do not have dumpsLandfills take precautions to separate their waste from ground water and airDumps are more expensive to operate and maintain Which is the correct order of events related to the history of Australia and New Zealand? Place the earliest event at the top and the last event at the bottom.Australia and New Zealand become dominions.World War I occurs.Australia and New Zealand become independent countries.British recognizes Australia and New Zealand as equals to Britain under the British Crown. Read the excerpt below and answer the question. HEDDA: No matterI could not bear the idea that any one should throw you into the shade. TESMAN. [In an outburst of mingled doubt and joy.] Hedda! Oh, is this true? ButbutI never knew you show your love like that before. Fancy that! (Hedda Gabler; act 4, p. 129) To what does Hedda compare Lovborg with the metaphor in her dialogue with Tesman? Solve the system using substitution Help please with 2,3,4 A boy blows up a balloon and knots the end. He leaves it on the kitchen counter. His little sister finds it and takes it outside in the sunshine.According to Charles's law, which of the answer choices best predicts what will happen to the balloon? Its pressure will increase. Its temperature will decrease. Its volume will increase. Its volume will decrease. Which of the following represent(s) an equation of the line passing through the points A(5, 6) and B(4, 8). Select all that apply. Steam Workshop Downloader