The sales tax rate in jans town is 7.5.if she buys 3 lamps for $23.59 each and a sofa for $769.99 , how much sales tax does she own ?

Answers

Answer 1
I believe that tax rate are in percent, so tax rate = 7.5%

Now, lets we total the money that she must pay without tax ( just for 3 lamps and 1 sofa ) :
3 lamps = 3 . $23.59 = $70.77
1 sofa = $ 769.99
Total amount = $769.99 + $70.77 = $840.76

We have to find tax amount, the tax amount of the total amount is about 7.5% of the price. Then we have to adding the tax amount into the total amount. So that we have the Total amount including the tax.

tax amount = 7.5% . 840.76 = $63.057
Total amount (inc. tax amount) =
$840.76 + $63.057 = $903.817

Therefore, she must pay those sofa and lamps about $903.817. So expensive huh? =))

Related Questions

mr. and mrs. boyce bought a house for 96000 in 1995. real estate values in their area increase approximately 4% each year. what was the value of the house in 2007?

Answers

Use this formula:
[tex]P(t) = P_0 (1 + r)^t[/tex]
[tex]P(12 years) = (96000) \cdot (1.04)^{12}[/tex]
[tex]P(12) = 153699[/tex]
Final answer:

The Boyce's house bought for $96,000 in 1995, increased approximately 4% yearly. By applying the compound interest formula, the house's value in 2007 would be approximately $139,254.09.

Explanation:

We need to use the compound interest formula to calculate the value of Boyce's house in 2007 because the house price increase is compounded annually. The formula is P(1 + r/n)^(nt). Here, P is the initial amount (i.e., the original house price), r is the annual interest rate (the rate of increase in house value), and n is the number of times interest is compounded yearly. T is the number of years the money is invested.

However, as we deal with annual compounding, the formula simplifies to P(1 + r)^t. In this case, P = $96,000, r = 4% or 0.04, and t = 2007 -1995 = 12 years.

Inserting these values, we get 96000(1 + 0.04)^12 = $139,254.09 (rounded to the nearest cent).

So, according to the 4% annual increase rate, Boyce's house would be worth approximately $139,254.09 in 2007.

Learn more about Compound Interest here:

https://brainly.com/question/14295570

#SPJ2

A triangle has side lengths of 12 cm, 35 cm, and 37 cm. Classify it as acute, obtuse, or right.
acute
obtuse
right

Answers

when you draw triangle
the answer is so easy
it is acute
If a triangle has the side lengths of 12cm, 35cm, and 37cm then the triangle will be acute!

What is the solution to the following bernoulli de?
\[t^2 dy/dx+y^2=ty\]

Answers

So, from your equation t^2 dy/dx+y^2=ty

Dividing boths side by t^2 we get
dy/dx+y^2/t^2=y/t
After re arranging 

dy/dx−y/t=−y^2/t^2

after substituting we get
w=−y^−3

Which of the binomial is a factor of this trinomial x2-7x-44?

Answers

I hope this helps you



x^2-7x-44

x -11



x +4



(x-11)(x+4)

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

Vanessa deposited money into a bank account that earned 1.25% simple interest each year. After 1/2 year, she had earned $5.00 in interest on the account. If no other money was deposited into or withdrawn from the account, how much was her initial deposit? Uhh... I was just testing...oops

Answers

so the answer is 800. I guarantee you this will be the answer I promise

Final answer:

Vanessa's initial deposit in the bank, earning 1.25% simple interest per year, was $800. This is calculated using the simple interest formula, rearranged to solve for the principal based on the $5 interest earned in half a year.

Explanation:

To find Vanessa's initial deposit, we use the simple interest formula, which is Interest = Principal × Rate × Time. Given Vanessa earned $5.00 in interest in half a year (0.5 years) at a rate of 1.25% per annum, we can rearrange the formula to solve for the principal (initial deposit).

Using the given information: $5 = Principal × 0.0125 × 0.5, we can solve for the Principal as follows:

$5 = Principal × 0.00625
Principal = $5 ÷ 0.00625
Principal = $800

Therefore, Vanessa's initial deposit was $800.

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

Tyrone’s hourly wage is $18 and his net pay is 72% of his earnings. Tyrone spends about $1,800 on his monthly expenses. If Tyrone works 40 hours per week and has no other sources of income, what is his total monthly cash inflow? (Hint: Assume that there are 4 pay periods per month.)

Answers

$2073.60 per month

===================

To calculate Tyrone's total monthly cash inflow, we need to determine his weekly and then monthly earnings.

Calculate weekly gross income:

$18/hour * 40 hours/week = $720/week

Calculate net pay per week:

$720/week * 72% = $518.40/week

Calculate monthly cash inflow:

$518.40/week * 4 weeks/month = $2073.60/month

Tyrone's total monthly cash inflow is $2073.60.

Factor -9x^2-36x-36 please.

Answers

Tricky Trinomial
-9x^2-36x-36
(-9x^2-18x)(-18x-36)
-9x(x+2)-18(x+2)
=(-9x-18)(x+2)
factor out -9
-9(x^2+4x+4)
what 2 numbers multiply to 4 and add to 4
 2 and 2

-9(x+2)(x+2)

what does the 2 represent in 12.789

Answers

(Tens digit)(Ones digit) . (tenths digit)(hundredths digit)(thousandths digit)
12.789
2 = (ones digit)

Hope this helps!
It is a whole number in the one digits place
:)

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

Paul plans to put concrete on a rectangular portion of his driveway. The portion is 12 feet long and 6 inches high. The price of concrete is $98 per cubic yard. The total cost of the concrete Paul needs is $108.89. Which of the following is closest to the width of the portion of the driveway on which Paul plans to put concrete?

[1 foot = 12inches; 1 yard = 3 feet]

3 feet

5 feet

8 feet

10 feet

Answers

The width needed is 5 feet.

Answer:

The answer is b. 5 feet

Step-by-step explanation:


HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

You invest $2000 in a bank account that has 5% annual interest rate, compound ed continously. how much will you have in 5 years?

Answers

total = $2000(1.05)^5
money = $2552.56

Is 89 prime or composite

Answers

it is a prime number. 89=1×89 hope it helps

Answer:

Prime

Step-by-step explanation:

A prime number is a number that has only one factor. A composite number is a number that has more than one factor.

-kiniwih426

A new law requires that 12% of an individual's income be invested in the stock market. Your accounts show that you need to put $420 in the stock market this year. How much did you earn this year.
A $5,040 B $350 C $504** D $3,500

Answers

Final answer:

The problem can be solved by setting up the equation 0.12x = $420, where 'x' stands for your total income. Dividing both sides of the equation by 0.12 gives x = $3500 which is the total annual income. Thus, you earned $3,500 this year.

Explanation:

To solve this mathematical problem, you can set up an equation that represents the problem context. You know that 12% of your whole year's income equals $420. So if 'x' represents your total income, the equation becomes 0.12x = $420. To solve for 'x' (your total income), you would divide both sides of the equation by 0.12.

So, x = $420 ÷ 0.12. When you perform this calculation, you'll find that 'x' equals $3,500. Therefore, you earned $3,500 this year.

The answer to the problem is D. $3,500.

Learn more about Percentage here:

https://brainly.com/question/35647344

#SPJ12

Which of the following statements is true of chords?

A chord is a line segments.A chord connects two points on a circle.A chord can be a radius of a circle.A chord can be a diameter of a circle.A chord divides a circle into two regions

Answers

All of those are true, except the one about the radius.  Because alternate definition of diameter uses the idea of chord. So, both ends of a chord have to be on the circle, but one end of a radius is at the center, so a radius can't be a chord.

There are 132 people seated in the school auditorium for an assembly.  There are 6 rows in the auditorium, each with the same number of seats.  If the auditorium is completely filled, how many seats are there in each row?

Answers

You do 132 ÷ 6 which is 22, so that is the answer. This is because if you the auditorium is filled, then there are a total of 132 seats. If there are 6 rows, then there have to be 22 seats each row to make 132 seats. I hope this helps!
The answer is 22 seats in each row.

Explanation:
132÷6=22

Hope it helps!

70 is 25% of what number

Answers

I hope this helps you



70=?.25%


70=?.25/100


70=?.1/4


?=280

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

Suppose f(π/3) = 3 and f '(π/3) = −7,
and let
g(x) = f(x) sin x
and
h(x) = (cos x)/f(x).
Find the h'(x)

Answers

Final answer:

To find h'(x), differentiate the function h(x) = (cos x)/f(x) using the product rule.

Explanation:

To find h'(x), we need to differentiate the function h(x) = (cos x)/f(x).

First, let's find the derivative of cos x, which is -sin x.

Next, we need to find the derivative of f(x). Since f(π/3) = 3 and f '(π/3) = −7, we know the slope of the tangent line at x = π/3 is -7.

Using the product rule, we can now differentiate h(x) = (cos x)/f(x) as follows:

h'(x) = [f(x)(-sin x) - cos x(f '(x))]/[f(x)]^2

A square sheet of art paper has an area of 625 square inches. what is the minimum side length of an easel that supports the whole sheet of paper?
a.-25
b.25
c.15
d.35(-25 or 25?)

Answers

the of the question the letter B

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area. Show that under these circumstances the drop's radius increases at a constant rate. ...?

Answers

the statement tells you:

dm/dt = k A = 4 pi k r^2 where k is a constant, and r is the radius of the raindrop

use the chain rule to write:

dm/dt = dm/dr x dr/dt

since the raindrop is a sphere (of presumably uniform density), its mass is

m= density x volume = rho x 4 pi r^3/3 where rho is the density of water

so, we have that dm/dr = 4 rho pi r^2, subbing this back we get

dm/dt = 4 pi k r^2 = 4 rho pi r^2 dr/dt

the r^2 on both sides cancel, leaving dr/dt, the rate at which the radius increases, to be constant

From the given condition, the rate of change of radius is constant.

What is rate of change?

How quickly something evolves over time is referred to as its rate of change (ROC).

Given:

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area.

Let V be the volume of the sphere & S be the surface area.

According to the question,

dV/dt = kS

Since,

V = 4/3πr³

dV/dt = 4πr²dr/dt

S = 4πr²

Putting these values to the above expression,

4πr²dr/dt = k4πr²

dr/dt = k

Therefore, the rate of change of radius is constant.

To learn more about the rate of change;

https://brainly.com/question/29518179

#SPJ2

At 9:00 on Saturday morning, two bicyclists heading in opposite directions pass each other on a bicycle path.The bicyclist heading north is riding 4 km/hour faster than the bicyclist heading south. At 10:15, they are 40 km apart. Find the two bicyclists’ rates.

Answers

let x be the speed of bicyclist A (heading north)
     
y be the speed of bicyclist B (heading south)
 
since A is 5km/hr faster than B
 
x = y + 5 -----equation 1

time = 9 to 10:45 = 1.75hours since the distance is 47.25km then,
 
x(1.75) + y(1.75) = 47.25 ---equation 2

substitute equation 1 to 2 (y+5)(1.75) + 1.75y
 
= 47.25 1.75y +8.75 + 1.75y
 
= 47.25 3.5y
 
= 47.25 - 8.75 3.5y

= 38.5

y = 11km/hr
 
substitute to equation 1
 
x = y + 5 x

= 11 + 5 x

= 16km/hr

The speed of Bicyclist A (heading north) is 16 km/h.

The speed of Bicyclist B (heading south) is 11 km/h.

Given:

- Let x be the speed of bicyclist A (heading north).

- Let y be the speed of bicyclist B (heading south).

- Bicyclist A is 5 km/h faster than Bicyclist B, so [tex]\(x = y + 5\)[/tex] (Equation 1).

- Time from 9:00 to 10:45 is 1.75 hours.

- The total distance covered by both bicyclists during this time is 47.25 km.

From the equation for time and distance, we have:

[tex]\[ x \times 1.75 + y \times 1.75 = 47.25 \][/tex]

Substituting Equation 1 into this equation:

[tex]\[ (y + 5) \times 1.75 + y \times 1.75 = 47.25 \]\[ 1.75y + 8.75 + 1.75y = 47.25 \]\[ 3.5y + 8.75 = 47.25 \]\[ 3.5y = 38.5 \]\[ y = \frac{38.5}{3.5} \]\[ y = 11 \text{ km/h} \][/tex]

Substituting the value of y back into Equation 1:

[tex]\[ x = 11 + 5 \]\[ x = 16 \text{ km/h} \][/tex]

Thus, the correct answer is:

- The speed of Bicyclist A (heading north) is 16 km/h.

- The speed of Bicyclist B (heading south) is 11 km/h.

Question :

At 9:00 on Saturday morning, two bicyclists heading in opposite directions pass each other on a bicycle path.The bicyclist heading north is riding 4 km/hour faster than the bicyclist heading south. At 10:15, they are 40 km apart. Find the two bicyclists’ rates.

What are odd numbers 1-35?

Answers

1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35
Is that what you meant.
Odd numbers between 1 and 35 are: 1, 3, 5, 7, 9, 11, 13, 15, 17, 19, 21, 23, 25, 27, 29, 31, 33, 35. So, you count every second number, because the remaining numbers are even numbers.

If the sum of a number and 6 is multiplied by 5, the result is same as 9 times the number decreased by 2. find the number.

Answers

Let's do an equation. 5(x+6)=9x-2. Now distribute into parentheses. 5x + 30=9x-2. Now -5x on both sides. New equation is 4x-2=30. Add 2 on both sides. 4x=28. Now divide by 4. X=8. Your number is 8

Simplify each given equation and show your work. Tell whether it has one solution, an infinite number of solutions, or no solutions, and identify each equation as an identity, a contradiction, or neither. Explain your answers.
(a)6x + 2(2x – 3) = 24 + 9x
(b)25 – 4x = 3(5 – x) + 10 – x
(c)4(x + 2) = 2x + 7 + 2(x – 10)

Answers

a) The answer is one solution, neither

6x + 2(2x - 3) = 24 + 9x
6x + 2 * 2x + 2 * (-3) = 24 + 9x
6x + 4x - 6 = 24 + 9x
10x - 6 = 24 + 9x
10x - 9x = 24 + 6
x = 30

b) The answer is infinity solutions, identity
25 – 4x = 3(5 – x) + 10 – x
25 - 4x = 3 * 5 - 3 * x + 10 - x
25 - 4x = 15 - 3x + 10 - x
25 - 4x = 25 - 4x
4x - 4x = 25 - 25
0x = 0

x can be any number, so an infinite number of solution

c) The answer is no solution, contradiction

4(x + 2) = 2x + 7 + 2(x – 10)
4 * x + 4 * 2 = 2x + 7 + 2 * x - 2 * 10
4x + 8 = 2x + 7 + 2x - 20
4x + 8 = 4x - 13
4x - 4x = - 8 - 13
0 = -13

this is contradiction

A basketball team averages 98 points in its first three games.How many points must it score in the next game in order to have 100 point average overall?

Answers

The basketball team must score 106 points in the next game to have a 100-point average overall.

To determine how many points the basketball team must score in the next game to have a 100-point average overall, we need to consider the total points scored in the first three games and the desired average.

The team has already played three games and has an average of 98 points. To find the total points scored in these three games, we multiply the average by the number of games:

Total points in the first three games = 98 points/game * 3 games = 294 points.

To have a 100-point average overall, the team needs to score a total of 100 points per game multiplied by the total number of games played, including the next game.

Let's represent the number of points needed in the next game as "x."

(294 points + x points) / (3 games + 1 game) = 100 points/game.

Simplifying the equation:

(294 + x) / 4 = 100.

Cross-multiplying and solving for "x":

294 + x = 400.

x = 400 - 294.

x = 106.

To learn more about average click on,

https://brainly.com/question/31340101

#SPJ2

Other Questions
Where on earth are single-celled organisms generally found? Does mutations occur in both dna and rna Which variable expression represents the word phrase? the sum of 12 and the quotient of 9 and a number Which event resolves the confusion over the identities of Prince Edward and Tom Canty? A. Prince Edward accepts his new position as a pauper. B. Tom Canty is made the King of England. C. Prince Edward tells where the Great Seal is hidden. D. Tom Canty finds Prince Edward at Offal Court.15 PTS what is f (x)=2x^2+5 multiplied by g (x)=2xA) 7x+2xB) 4x+10xC)4x^2+10xD)4x^3+10x A breakage in the asthenosphere is called a fault. False or true A passive continental margin has areas were mountains are currently being built.True or false When a hanging wall moved down with respect to the football A. Reverse fault B. Normal fault C. Trust fault D. Strike-slip All rocks react to stress the same False or trueThe Andes were an example of an active continental margin False or true This occurs when a hanging wall moves up with respect to the football A. Normal fault B. Thrust fault C. Reverse fault D. Strike-slip fault Which of the following is not an example of organizational features used within this curriculum?a.indexesb.vocabulary wordsc.headingsd.bullet points its not D btw XD rawr choose the most logical answer for this question ?donde esta la computadora? A.La computadora esta en el reloj. B.La computadora en La papelera. C.La computadora en el escritorio. D. La computadora esta encima de la ventana Use the periodic table to answer this question. Decomposing calcium carbonate yields calcium oxide and carbon dioxide. What information is needed to calculate the mass of calcium oxide that can be produced from 4.7 kg of calcium carbonate? If you wanted to increase the gravitational force between two objects what would you do 15 POINTS!Which political party advocated states rights over federal authority?-Republican Party-Democratic-Republican Party-Democratic Party-Federalist Party What would happen to the rabbit population if houses were built in the fields where the rabbits lived? A.The rabbit population would decrease due to the destruction of their shelter and food source. B.The rabbit population would increase due to more food and shelter. C.The population of rabbits would not change because they would find something else to eat and somewhere to live. why do you think it is important to plan expenditures carefully? Which position did franklin roosevelt serve two terms? what is the solution to this system of equations? 5X + 2y =29 X + 4y=13 Ionic Bonds are formed when oppositely charged ions attract; electrons are transferred. True or False ? Which word below is a synonym of imprudent?A. safeB. not prunedC. unwise 3 is 1 percent of what amount please help with exercise 10,11,12 asap What was one reason the plantation did not really feel like a home to Douglass? A.Because his father was rarely home B.Because he was an only child C.Because his master whipped him often D.Because his mother was dead Steam Workshop Downloader