True or false: Driving a motor vehicle after taking substances which alter The central nervous system can have side effects which include impaired attention reaction time and vision

Answers

Answer 1
True, because the substance basically reacts to the nervous system just like the anesthetic. Which can affect your decision making, and you might experience drowsiness, slow reaction time which is very risky for the driver and his/her surroundings.

Hope this helps :)

Related Questions

Which of the following is the correct formula for barium (II) sulfate?

Answers

BaSO4 is the correct formula for barium (ll) sulfate
BaSO4 is the correct formula for barium (ll) sulfate

If 50% of radioactive element remains after 4000 years what what is the half life

Answers

4,000 years is the half life of that element. Nope 8,000 years, there will be 25% remaining

Which of these statements about enzymes is true?
a.) enzymes increase the rate of a reaction by decreasing the gibbs free energy change of the reaction.
b.) enzymes decrease the rate of a reaction by increasing the gibbs free energy change of the reaction.
c.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction.
d.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction and the gibbs free energy change of the reaction.
e.) enzymes do not change the rate of a reaction?

Answers

enzymes are organic catalysts
and catalysts generally increase rate of reaction by lowering activation energy
C is the answer

Enzymes increase the rate of a reaction by decreasing the activation energy required for the reaction but do not change the Gibbs free energy change of the reaction. Option C is correct.

Among the statements about enzymes, the true one is that enzymes increase the rate of a reaction by decreasing the activation energy of the reaction. Enzymes are biological catalysts that specifically bind to substrates and help convert them to products more efficiently by lowering the energetic barrier, which is the activation energy required for the reaction to proceed.

However, it is important to note that while enzymes do lower the activation energy, they do not alter the Gibbs free energy change (AG) of the reaction. The Gibbs free energy change is a thermodynamic property that determines the spontaneity of a reaction and remains unchanged regardless of whether enzymes are present.

Hence, C. is the correct option.

If a feather and an iron bar is released from a same height in a room without any air resistance, which one(s) will impact the ground first.
A) neither one, because without air resistance gravity is absent
B) iron bar
C) both
D) feather

Answers

Final answer:

Both a feather and an iron bar will impact the ground at the same time if released from the same height in a room without air resistance, demonstrating that gravity causes all objects to fall with the same acceleration, disregarding their mass.

Explanation:

If a feather and an iron bar are released from the same height in a room without any air resistance, both the feather and the iron bar will impact the ground at the same time. The correct answer is C) both. This outcome occurs because in the absence of air resistance, all objects fall at the same rate due to gravity. This phenomenon was famously demonstrated on the Moon by astronaut David R. Scott in 1971, where, despite the Moon's lower gravitational acceleration of 1.67 m/s² compared to Earth's 9.81 m/s², both a hammer and a feather were shown to fall at the same rate when dropped from the same height. This validates that acceleration due to gravity is constant and does not depend on the mass of the objects involved.

Learn more about Free-fall in a vacuum here:

https://brainly.com/question/28228808

#SPJ3

A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?

Answers

I need to know the answer of the above question.

4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place

Answers

To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.

In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.

Is the tetrapeptide ala-glu-gly-lys a good buffer at ph 7.0? will it move in an electric field at ph 7.0?

Answers

 pH is a measure of the effective concentration of H+ ions a solution. So, an electric field applied to a solution will create a pH gradient.

If pH is 7, means it is neutral. so it will not move in an electric field

what is the definition of tributary

Answers

umm a tributary a stream of water that flows into another stream or a large body of water such as a river or lake 
Final answer:

A tributary is a smaller stream or river that flows into a larger one, contributing to its volume and influencing its navigability, ecosystem, and flooding potential.

Explanation:

The definition of a tributary is a stream or river that flows into a larger stream, river, or lake. These smaller watercourses contribute to the flow of the larger one, which is often referred to as the mainstem or parent river. Tributaries do not flow directly into the sea. They provide additional water volume to their parent river, which can then affect the river's ability to navigate, its ecosystem, and potential for flooding. For example, the Missouri River is a tributary of the Mississippi River because it flows into it.

How many grams of CO2 are used when 7.0 g of O2 are produced?

Answers

Final answer:

The question cannot be answered as posed because a specific chemical reaction and balanced equation are needed to relate the masses of O2 and CO2.

Explanation:

To answer how many grams of CO2 are used when 7.0 g of O2 are produced, we assume the process is a typical combustion or respiration reaction, where CO2 is generated from O2, or vice versa. The balanced chemical equation for the combustion of carbon would typically be C + O2 → CO2. However, since we are given the mass of O2 produced, and not the mass of a carbon-containing fuel that reacts, we cannot proceed to calculate the mass of CO2 without additional information on the specific reaction involved, including the stoichiometry that defines the mass relationship between O2 and CO2. Therefore, we must have a balanced equation or a known reaction to relate the masses of O2 and CO2 produced in order to provide a specific answer.

Learn more about Chemical Reaction Stoichiometry here:

https://brainly.com/question/30415532

#SPJ12

9.62 grams of [tex]\( \text{CO}_2 \)[/tex] are used when 7.0 grams of [tex]\( \text{O}_2 \)[/tex] are produced.

One common reaction where [tex]\( \text{O}_2 \)[/tex] is produced and [tex]\( \text{CO}_2 \)[/tex] is consumed is photosynthesis:

[tex]\[ 6 \text{CO}_2 + 6 \text{H}_2\text{O} \rightarrow \text{C}_6\text{H}_{12}\text{O}_6 + 6 \text{O}_2 \][/tex]

From this balanced equation, we see that 6 moles of [tex]\( \text{CO}_2 \)[/tex] produce 6 moles of [tex]\( \text{O}_2 \)[/tex]. This means that 1 mole of [tex]\( \text{CO}_2 \)[/tex] produces 1 mole of[tex]\( \text{O}_2 \).[/tex]

Step-by-Step Solution:

1. Determine the molar mass of [tex]\( \text{O}_2 \)[/tex]:

[tex]\[ \text{Molar mass of O}_2 = 2 \times 16.00 \text{ g/mol} = 32.00 \text{ g/mol} \][/tex]

2. Calculate the moles of \( \text{O}_2 \) produced:

[tex]\[ \text{Moles of O}_2 = \frac{7.0 \text{ g}}{32.00 \text{ g/mol}} = 0.21875 \text{ moles} \][/tex]

3. Use the stoichiometry from the balanced equation:

  From the balanced equation, the mole ratio between[tex]\( \text{CO}_2 \) and \( \text{O}_2 \) is 1:1.[/tex]

 Therefore, the moles of [tex]\( \text{CO}_2 \)[/tex] used is the same as the moles of [tex]\( \text{O}_2 \)[/tex]produced:

[tex]\[ \text{Moles of CO}_2 = 0.21875 \text{ moles} \][/tex]

4. Determine the molar mass of [tex]\( \text{CO}_2 \)[/tex] :

[tex]\[ \text{Molar mass of CO}_2 = 12.01 \text{ g/mol} + 2 \times 16.00 \text{ g/mol} = 44.01 \text{ g/mol} \][/tex]

5. Calculate the grams of \( \text{CO}_2 \) used:

[tex]\[ \text{Grams of CO}_2 = \text{Moles of CO}_2 \times \text{Molar mass of CO}_2 \][/tex]

[tex]\[ \text{Grams of CO}_2 = 0.21875 \text{ moles} \times 44.01 \text{ g/mol} = 9.62 \text{ g} \][/tex]

The oceanic crust is made primarily from this type of rock.

Answers

Im pretty sure its basalt

Answer:

Igneous rock basalt.

Explanation:

The ocean crust is made mostly of igneous rock basalt, which comes from lava and the movement of tectonic plates.

There are three common functional groups in organic chemistry that are readily ionized by adjusting the ph of the aqueous solution during an extraction. name and write the chemical structure of these three functional groups and show each

Answers

The three functional groups are carboxylic acids, amines and phenols. These functional groups can be turn to ions by adjusting their pH during extraction.
Their chemical strictures are as follows:
Carboxylic acid: RCOOH
Amines: RNH2
Phenols: C6H6O.

Suggest a reason for why the phosphorus-containing side product from the horner-emmons wittig reaction is more water-soluble than the triphenylphosphine oxide side product obtained from the standard wittig reaction.

Answers

Co-product (rather than side product) of Horner-Emmons Wittig reaction is alpha-hydroxy phosphonate which by definition is hydrophilic as opposed to triphenylphosphine oxide. In addition, the side groups in Horner-Wittig reagents are typically Me or Et which are less bulky than phenyls are more compatible with hydrophilicity.

At which stage does a gas form in a gas formation reaction?

the reactants stage
the product stage
the liquid stage
the solid stage

Answers

B, the product stage. I just took this test and got this answer right. Happy to help!

Answer: b

Explanation:

If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.

Answers

Ethanoic (Acetic) acid is a weak acid and do not dissociate fully. Therefore its equilibrium state has to be considered here.

[tex]CH_{3}COOH \ \textless \ ---\ \textgreater \ H^{+} + CH_{3}COO^{-} [/tex]

In this case pH value of the solution is necessary to calculate the concentration but it's not given here so pH = 2.88 (looked it up)

pH = 2.88 ==> [tex][H^{+}][/tex]  = [tex]10^{-2.88}[/tex] =  0.001 [tex]moldm^{-3}[/tex]

The change in Concentration Δ [tex][CH_{3}COOH][/tex]= 0.001 [tex]moldm^{-3}[/tex]


                                  CH3COOH          H+           CH3COOH    
Initial  [tex]moldm^{-3}[/tex]                      [tex]x[/tex]           0                     0
                                                                                                                       
Change [tex]moldm^{-3}[/tex]        -0.001            +0.001           +0.001
                                                                                                       
Equilibrium [tex]moldm^{-3}[/tex]      [tex]x[/tex]- 0.001      0.001             0.001
                                                                              

Since the [tex] k_{a} [/tex] value is so small, the assumption 
[tex][CH_{3}COOH]_{initial} = [CH_{3}COOH]_{equilibrium}[/tex] can be made.

[tex] k_{a} = [tex]= 1.8*10^{-5} = \frac{[H^{+}][CH_{3}COO^{-}]}{[CH_{3}COOH]} = \frac{0.001^{2}}{x} [/tex]

Solve for x to get the required concentration.

note: 1.)Since you need the answer in 2SF don&t round up values in the middle of the calculation like I've done here.

         2.) The ICE (Initial, Change, Equilibrium) table may come in handy if you are new to problems of this kind

Hope this helps! 



A concentrated solution in water will always contain a strong or weak electrolyte true or false

Answers

This is a false statement. While a solution in water might have a strong or weak electrolyte, there are also occasions where it might contain a non-electrolyte. Two examples of these types of solutions that will not be electrolytic would be a sugar solution or ethanol.

Why does ferrocene undergo the acylation reaction more readily than benzene?

Answers

A combination of Pd-catalyzed arene–alkynyl couplings and Cu(OAc)2-promoted internal alkyne dimerization furnishes novel ferrocene-based dehydroannulenes in high yield.

what location on earth experiences the least change in the number of daylight hours throughout the year?

Answers

The areas around the equator. The equator is an invisible line going around the middle of the earth. Because of our tilted axis we get more light in some parts of the year, and less in others. But because the equator is right in the middle, the sun goes from east to west in the middle of the sky every day, meaning they get the same amount of daylight all year.

Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.

Answers

The (s) in the chemical name of (s)-3-iodo-2-methylnonane indicates an S-configuration using the Cahn-Ingold-Prelog system of stereochemical nomenclature. The S-configuration means that an "imaginary" rotation from the highest priority substituent group to the lowest priority substituent group of the chiral center moves counterclockwise (to the left), provided that the lowest priority group is oriented "towards the back" (symbolized by dashed lines). 

The highest priority group (iodine in this case) is the one with the highest atomic number and the lowest priority (hydrogen in this case) is one with the lowest atomic number.

If the atoms directly beside the chiral center have the same atomic number (Carbon-2 and Carbon-4 in this case), the atoms next to them will be evaluated until a point of difference is found. Carbon-2 is connected to 2 other carbon atoms and 1 hydrogen atom, while Carbon-4 is connected to only 1 carbon atom and 2 hydrogen atoms. Thus, Carbon-2 has a higher priority, with the point of difference being the carbon atom of the methyl group attached to Carbon-2. Both Carbon-2 and Carbon-4 are connected to one carbon atom from the main nonane chain, but the other atoms connected to Carbon-4 are hydrogen atoms only. Carbon-2 has an extra carbon connected to it and carbon has a higher atomic number than hydrogen.

If there is no point of difference, the central atom is not chiral and cannot be named using the Cahn-Ingold-Prelog system. 

Thus, the structure of (s)-3-iodo-2-methylnonane is


Final answer:

The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.

Explanation:

The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.

Learn more about Organic Compound Structure here:

https://brainly.com/question/35316125

#SPJ3

Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.

Answers

Ans. : Volatile liquids with lower boiling points often gives better result than those with higher boiling points because for the liquid for the higher boiling might evaporate before it boils because of its volatility. For the one with higher boiling point it would take longer to boil than the one with a lower boiling point therefore it has a longer time for the liquid to evaporate before it boils.

What role does the oxidation agent play in a redox reaction

Answers

The oxidizing agent receives electrons from the reducing agent.  Keep in mind that the reducing agent is the element in an oxidation-reduction reaction that gives an electron to another species. And since the reducing agent always loses its electrons, it is considered to call its condition 'oxidized'.

A gas mixture is made by combining 8.2 g each of ar, ne, and an unknown diatomic gas. at stp, the mixture occupies a volume of 19.44 l.what is the molar mass of the unknown gas

Answers

34 g/mol if using the post 1981 definition of STP 32 g/mol if using the pre 1982 definition of STP One minor complication is that the definition of STP changed in 1982 and some text books still use the old definition. So for this problem, I'll be giving two answers, but showing the work for only one of the results. Pre 1982, STP was defined as 273.15 K at exactly 1 atmosphere (101325. Pascals) Post 1981, STP was defined as 273.15 K at exactly 100 kPa (100000 Pascals) The result of this difference is that the volume of 1 mole of a gas at STP differs. Pre 1982, 1 mole of gas at STP has a volume of 22.414 liters. Post 1981, 1 mole of gas at STP has a volume of 22.71098 liters. First, determine the number of moles of gas molecules we have. 19.44 l / 22.71098 l/mol = 0.85597363 mol Now determine how many moles of Ar, and Ne we have. Look up the atomic weights. Atomic weight Argon = 39.948 Atomic weight Neon = 20.1797 Moles Argon = 8.2 / 39.948 = 0.205266847 mol Moles Neon = 8.2 / 20.1797 = 0.406348955 mol Calculate the number of moles of unknown gas by subtracting the number of moles of argon and neon we have from the number of moles of gas in total. So 0.85597363 mol - 0.205266847 mol - 0.406348955 mol = 0.244357829 mol Now that we know how many moles of the unknown gas we have, we can simply divide the mass by the number of moles, so 8.2 g / 0.244357829 mol = 33.55734514 g/mol Rounding to 2 significant figures gives a molar mass of 34 g/mol and since there isn't any element with a atomic weight of 17, I suspect that the textbook you're using is using the pre-1982 definition of STP. So repeating the calculations above with a volume of 22.414 liters per mole (pre-1982 definition of STP), the newly calculated molar mass becomes 32 g/mol which is a nice match for the unknown gas being oxygen. The differences using the older standard are: 19.44 l / 22.414 l/mol = 0.867315071 mol ; Number of moles in the volume of 19.44 l 0.867315071 mol - 0.205266847 mol - 0.406348955 mol = 0.255699269 mol ; moles of unknown gas. 8.2 g / 0.255699269 mol = 32.06892229 g/mol ; Molar mass of unknown gas.

How many liters of water are required to dissolve 1.00 g of barium sulfate?

Answers

Final answer:

To dissolve 1.00 g of barium sulfate, we would need 1 L of water.

Explanation:

In order to calculate the amount of water needed to dissolve 1.00 g of barium sulfate, we need to use the molar mass of barium sulfate and the concept of molarity.

The molar mass of barium sulfate (BaSO4) is 233.43 g/mol. We can use this to convert the mass of barium sulfate to moles.

Once we know the number of moles of barium sulfate, we can use the molar ratio between barium sulfate and water to calculate the volume of water needed. The balanced equation for the dissolution of barium sulfate in water is:

BaSO4 (s) + H2O (l) → Ba2+ (aq) + SO42- (aq)

Based on this equation, 1 mole of barium sulfate dissolves to give 1 mole of water. Therefore, to dissolve 1.00 g of barium sulfate, we would need 1 L of water.

Learn more about dissolving barium sulfate in water here:

https://brainly.com/question/5383482

#SPJ12

moles of hydrogen in 9.15×10−2 mol C4H10

Answers

From the given formula, one mole of C4H10 contains 10 moles of hydrogen.

To know the number of moles of hydrogen in 9.15x10^-2, we will just do a cross multiplication as follows:
number of moles of hydrogen = (9.15 x 10^-2 x 10) / 1 = 0.915 moles

One radioactive isotope of calcium has an atomic mass number of 47. How many neutrons are in the calcium-47 nucleus?

Answers

isotope means having the same number of protons but different number of neutrons.
Thus, by looking at the periodic table the prton number is 20.
no. of neutrons in the isotope of Ca=47-20
Therefore the number of neutrons in calcium-47 is 27 neutrons.

Answer: The number of neutrons in the given isotope are 27.

Explanation:

Atomic number is defined as the number of electrons or number of protons that are present in a neutral atom. It is represented as Z.

Z = Atomic number = Number of electrons = Number of protons

Mass number is defined as the sum of number of protons and number of neutrons present in an atom. It is represented as A.

A = Mass number = Number of protons + Number of neutrons

Number of neutrons = Mass number - Atomic number

We are given an isotope having representation:  [tex]_{20}^{47}\textrm{Ca}[/tex]

Atomic number or number of protons = 20

Mass number = 47

So, number of neutrons = 47 - 20 = 27

Hence, the number of neutrons in the given isotope are 27.

For each reaction, identify the precipitate or lack thereof bacl2 naoh

Answers

The precipitate formed from the reaction of BaCl2 and NaOH is Barium Hydroxide. Barium Hydroxide is a white precipitate. The reaction that proceeds is a double replacement reaction. This means that the anions and the cations of the two different molecules switch places, forming entirely new compounds.

The essential oil found in cloves, eugenol, can be isolated by steam distillation because it is insoluble in water and has a measurable vapor pressure at 100 °c even though it has a much higher boiling point than water. use data from the table to calculate the volume of eugenol in 30 ml of distillate.

Answers

Molar Mass of Water: 18 g/mol
Molar Mass of Eugenol: 164 g/mol
Boiling point of water: 100 degrees C
Boiling point of eugenol: 254 degrees C
Vapor pressure of Water at 100 degrees C: 760 mmHG
Vapor pressure of Eugenol at 100 degrees C: 4.0 mmHG


HINT: Steam distillation is particularly useful for purifying materials that decompose before reaching their normal boiling point. Steam causes high-boiling components that are immiscible in water to boil at significantly lower temperatures than their normal boiling point. Because the mole fraction of the components only depends on the vapor pressure of the components:

I have attempted this problem numerous times here is what i am doing what am i doing wrong?

Xorg = 4.0/4.0+760 = 0.0053
1-0.0053=0.9947 = XH20

mH2O = 0.9947 * 18 = 17.9046
morg = 0.0053 * 164 = 0.8692

m%org = [0.8692/ (0.8692 + 17.9046)] * 100 = 4.62%
Rounded to 5%

Find the current through the 30.0 ω resistor.

Answers

Final answer:

Without the total voltage or detailed circuit configuration, it's not possible to determine the current through the 30.0 ω resistor. An example using Ohm's law has been provided for a hypothetical scenario.

Explanation:

To find the current through the 30.0 ω resistor, we would need to apply Ohm's law, which states that I = V/R, where I is the current, V is the voltage, and R is the resistance. However, the provided information is insufficient to determine the current, as we are not given the total voltage across the resistor or the configuration of the circuit (whether it is series, parallel, or a combination).

If the 30.0 ω resistor were the only resistance in the circuit and the voltage across it was provided, we could directly use Ohm's law to calculate the current. For example, if the voltage was 10 V, the current would simply be I = 10V / 30.0ω = 0.333 A.

Without additional information, such as the configuration of the circuit and the total voltage, we cannot accurately calculate the current. The problem might be missing details or might require knowledge about the rest of the circuit to solve.

Learn more about current through a resistor here:

https://brainly.com/question/30905506

#SPJ3

which state of matter undergoes changes in volume most easily?

Answers

The state of matter that undergoes changes in volume most easily is gas.
Final answer:

Gas is the state of matter that can most easily undergo changes in volume. The freely moving particles of gas adapt to take up the entire volume and shape of any container it is kept in.

Explanation:

The state of matter that undergoes changes in volume most easily is gas. This is because gaseous substances have the most dispersed particles among the three fundamental states of matter (solids, liquids, and gases). These particles move freely, occupying the complete shape and volume of the container in which they are kept. Thus, any change in the container's size will in-turn affect the volume of the gas. For instance, if we inflate a balloon with gas and then deflate it, the gas volume adjusts in line with the balloon's volume changes.

Learn more about State of Matter

https://brainly.com/question/31659891

#SPJ6

Determine the density of a 23.4g block that when placed in 25.00mL of water causes the water to rise to a level of 28.70mL?

Answers

The Density will be 3.7 mL

Which of the following represents a compound?
A) H
B) H-3
C)H2O
D) O-16

Answers

C, H2O represents the compound responsible for constituting water.
The answer is C. H2

To be considered as a compound, it need to contain two on more elements.
From the option above, only H2O contains 2 elements, H is for Hydrogen and O is for oxygen. This compound formed a substance that we most commonly know as water.
Other Questions
The body's rate of kilocalorie consumption needed to fuel all ongoing activities is called the __________. the body's rate of kilocalorie consumption needed to fuel all ongoing activities is called the __________. food-induced thermogenesis chemical thermogenesis total metabolic rate basal metabolic rate Why does Shakespeare include servants in scenes throughout the play? Select all that apply. describe 3 ways that alcoholism affects the family1.2. 3. Husker corporation reports current e&p of negative $200,000 in 20x3 and accumulated e&p at the beginning of the year of $300,000. husker distributed $200,000 to its sole shareholder on december 31, 20x3. the shareholder's tax basis in her stock in husker is $50,000. how is the distribution treated by the shareholder in 20x3? The training of animals to work for humans or to serve as pets is called ______. A. Unification B. Incorporation C. DomesticationD. Transformation In a 3-digit number, the hundreds digit is three more than the units digit, and the tens digit is twice the hundreds digit. If the sum of the digits is 13, find the three digits. Find the number. A submarine cruised below the surface of the water. During training exercise, it made 4 dives, each time descending 45 feet more. Then it rose 112 feet. What is the change in the submarine's position? How old was george washington when he was chosen as president on april 30, 1789? The medical record serves as a legal document A researcher conducting behavioral research collects individually identifiable sensitive information about illicit drug use and other illegal behaviors by surveying college students. the data are stored on a laptop computer without encryption, and the laptop computer is stolen from the researchers car on the way home from work. this is an unanticipated problem that must be reported because the incident was (a) unexpected (i.e., the researchers did not anticipate the theft); (b) related to participation in the research; and (c) placed the subjects at a greater risk of psychological and social harm from the breach in confidentiality of the study data than was previously known or recognized. according to ohrp, this unanticipated problem must be reported to the irb in which timeframe the volume is 1.5 cm^3 and the mass is 7.5g. what is the density? They say the health care is excellent in canada? well, it isn't. my new neighbor moved here from toronto, and she says the health care up there is terrible. she says everyone in canada comes to the united states for any serious medical condition." the speaker commits which of these fallacies What is the tone of the following excerpt from Edgar Allan Poes "The Masque of the Red Death"? There was a sharp cryand the dagger dropped gleaming upon the sable carpet, upon which, instantly afterwards, fell prostrate in death the Prince Prospero. Then, summoning the wild courage of despair, a throng of the revellers at once threw themselves into the black apartment, and, seizing the mummer, whose tall figure stood erect and motionless within the shadow of the ebony clock, gasped in unutterable horror at finding the grave cerements and corpse-like mask, which they handled with so violent a rudeness, untenanted by any tangible form. And now was acknowledged the presence of the Red Death. He had come like a thief in the night. And one by one dropped the revellers in the blood-bedewed halls of their revel, and died each in the despairing posture of his fall. And the life of the ebony clock went out with that of the last of the gay. And the flames of the tripods expired. And Darkness and Decay and the Red Death held illimitable dominion over all. 1. eager and enthusiastic 2.mournful and timid 3. macabre and suspenseful 4. hopeful and reassuring In order to gain the maximum benefits from an exercise program, you should include both cardiovascular training and weight training. The elements on the right side of the stair steps of the periodic table are classified as Which character wears pajamas to the King's court? A. the Pirate Don Durk of Dowdee B. Jimmy Jet C. the speaker of "Thoughts on Talkers" D. Jonathan Bing what is the difference between demand for vegetables and tobacco products? Evaluate 11p 2 for p = 5. Which state ment is not true of athe function?A. The independent variable is x.B. the dependent variable is yC. Whent he input is 1 the output is -2D. When the input is 8 the output is 32 The silk Roads were build by the Chinese government to export silk. True or False. Steam Workshop Downloader