Two straight lengths of wire are placed on the ground, forming vertical angles. If the measure of one of these angles is 72 degrees, what are the measures of the other three angles. Explain your answer

Answers

Answer 1

they need to equal 180 degrees

180-72 = 108 degrees


Answer 2

Answer: 108, 108, and 72 degrees

Step-by-step explanation:

Angle A = 72

Angle B = Angle D

Angle C = 72 (Since it is congruent to Angle A)

Angle D = Angle B

Since Angle A and C are congruent, so are angles B and D. Now you would have to subtract 72 from 180.

180 - 72 = 108

Angle A = 72

Angle B = 108

Angle C = 72

Angle D = 108


Related Questions

Write the next three terms and write a rule to describe the number pattern. 0.57, 0.66, 0.75, 0.84, . . .

Answers

add 0.09 each time

0.75, 0.84, 0.93, 1.02, 1.11, 1.20, 1.29, 1.38, 1.47, 1.56, 1.65, etc

hope this helps
Final answer:

The next three terms in the number pattern 0.57, 0.66, 0.75, 0.84 are 0.93, 1.02, and 1.11. The rule for the pattern is that each term increases by 0.09 from the previous term.

Explanation:

The given sequence is: 0.57, 0.66, 0.75, 0.84, ... The step or difference between each consecutive term is 0.09. Therefore, the next three numbers in the sequence would be: 0.84 + 0.09 = 0.93, 0.93 + 0.09 = 1.02, 1.02 + 0.09 = 1.11. So the answer is 0.93, 1.02, 1.11.

The generalized rule for this series is that each term increases by 0.09 from the previous term. In mathematical terms, if we denote the nth term as Tn, then Tn+1 = Tn + 0.09. This rule tells us that the number pattern involves adding 0.09 for each subsequent term in the sequence.

Learn more about Number Pattern here:

https://brainly.com/question/27644447

#SPJ11

7 divided by something = 1204

Answers

something = x
7/x = 1204
1204x = 7
x = 0.005813953488
in fraction form: 7/1204

hope it helps

brainliest pls

Find the value of x. If necessary, round to the nearest tenth.

A. 11.7 in.

B. 9.7 in.

C. 13.7 in.

D. 6.9 in.

Answers

area of a triangle = 1/2 x base x height
47 = 1/2(x)(x)
1/2x² = 47
x² = 94
x = √94
= 9.7 (to the nearest tenth)

The value of x is 9.7 inches, rounded to the nearest tenth.

Answer:

B. 9.7 in.

Step-by-step explanation:

We have been given an image of a triangle. We are asked to find the value of x.

We will use area of triangle formula to solve our given problem.  

[tex]\text{Area of triangle}=\frac{1}{2}\times \text{Base*Height}[/tex]

[tex]47\text{ in}^2=\frac{1}{2}\times x*x[/tex]

[tex]2*47\text{ in}^2=\frac{1}{2}*2\times x^2[/tex]

[tex]94\text{ in}^2=x^2[/tex]

Taking square root of both sides we will get,

[tex]x=\sqrt{94\text{ in}^2}[/tex]

[tex]x=9.6953597\text{ in}\approx 9.7\text{ in}[/tex]

Therefore, the value of x is 9.7 inches and option B is the correct choice.

the sum of three consecutive integers is 105 which equation could you use to find the three integers?

Answers

Equation: n + (n +1) + (n+2) = 105

solution:

n + (n +1) + (n+2) = 105

3n +3 = 105

3n = 102

n = 102/3

n = 34

34 +1 = 35

34+2 = 36

34 +35 +36 = 105

What is the value of 5^3?  A.125  B.25  C.15  D.8

Answers

5^3 means 5*5*5.
5*5*5 = 125
So 5^3 = A. 125

What's is the radius of a circle with a circumference of 56.5?

Answers

Divide 56.5 by 2 and c what u get
circumference of a circle= 2 'pii' r
value of pii= 3.14
let radius be = r
56.5= 2×3.14×r
56.5=6.28×r
r=56.5/6.28
r=8.99

A giraffe can run 32 miles per hour. What is this speed in feet per second? Round your answer to the nearest tent.

Answers

ANSWER: 46.9 feet per second

32 miles per hour
5280 feet in 1 mile
32 x 5280 = 168,960 feet per hour
3600 seconds per hour

168,960 divided by 3600 = 46.9333 (continuous)
rounded to the nearest tenth is 46.9 feet per second.

Speed is the rate of change of distance over time.

The speed in feet per seconds is 46.9

The speed of the giraffe is given as:

[tex]\mathbf{Speed = 32 miles/hour}[/tex]

Start by converting miles to feet

To do this, we multiply 32 by 5280.

So, we have:

[tex]\mathbf{Speed = 32 \times 5280feet/hour}[/tex]

[tex]\mathbf{Speed = 168960feet/hour}[/tex]

Next, convert hour to seconds

To do this, we divide by 36000.

So, we have:

[tex]\mathbf{Speed = \frac{168960}{3600} feet/seconds}[/tex]

[tex]\mathbf{Speed = 46.9 feet/seconds}[/tex]

Hence, the speed in feet per seconds is 46.9

Read more about speed at:

https://brainly.com/question/22610586

Find x if:

64x^3=a^6

Answers

64x^3=a^6
x^3=a^6/64
x=cuberoot(a^6/64)=a^2/4

The answer will be (a/2) to the power of 2.

Write (9 + 6i) − (1 + 3i) as a complex number in standard form.

Answers

[tex](9+6i)-(1+3i)[/tex]

[tex](8+6i)-(3i)[/tex]

[tex]8+3i[/tex]

Answer

8+3i

Step-by-step explanation:

(9 + 6i) − (1 + 3i)

(8+6i)-(3i)

8+3i

A valid opinion poll requires random sampling which means

Answers

Random sampling is when everybody in a group is taken into consideration for polling, and everybody has an equal opportunity of being polled. An example of this would be putting all names of team members into a hat and pulling a few out.

A rectangular playground is to be fenced off and divided in two by another fence parallel to one side of the playground. 648 feet of fencing is used. find the dimensions of the playground that maximize the total enclosed area.

Answers

A rectangular playground of sides a and b would have an area of a*b. The perimeter of the fence plus one side is 648ft; this can be written as 3a+2b. We can write b in the expression for the area as (648-3a)/2. The area is equal to (648a-3a^2)/2; the maximum value can be found by deriving the area expression and equate it to 0. The derivative is 324-3a; the value of the area is maximum when a=108ft. The dimensions that maximize the playground are a=108ft and b=162ft.

The design on Santana’s wall includes 16 pink stripes and 20 green stripes. Find the ratio of pink stripes to green stripes.

Answers

The ratio is 4:5
Divide both terms by 4
16/4 =4
20/4=5

The ratio of pink stripes to green stripes on Santana's wall is 4:5.

To find the ratio of pink stripes to green stripes on Santana's wall, we need to compare the two quantities. Santana has 16 pink stripes and 20 green stripes. The ratio can be simplified by finding the greatest common divisor of the two numbers and then dividing both by that number to find the simplest form.

In this case, the greatest common divisor of 16 and 20 is 4. We divide both numbers by 4 to simplify the ratio:

16 / 4 = 4

20 / 4 = 5

Therefore, the simplified ratio of pink stripes to green stripes is 4:5.

In a salsa recipe, the number of tomatoes added is proportional to the amount of salt added. This graph shows the relationship.

What is the unit rate for the number of tomatoes to the tsp of salt?

Answers

 y=3x, y being the number of tomato and x, the number of tbs, then:

1 tbs correspond to 3 tomatoes

Answer:

The unit rate for the number of tomatoes to the tsp of salt is 3.

Step-by-step explanation:

Consider the provided graph.

The equation of the line is [tex]y=3x[/tex]

A unit rate is a rate with 1 in the denominator.

Here, the meaning of unit rate is how much tomatoes to the tsp of salt.

As we know the slope intercept form is:

[tex]y = mx + b[/tex]

Where,  m is the slope of the line or rate and b is y intercept.

By the comparison we can say that the slope of the line is 3. Here, the denominator is 1.

This shows that 3 tomatoes are added for each teaspoon of salt.

Hence, the unit rate is 3.

1. algebraic expression
2. coefficient
3. constant
4. expression
5. variable

A. the constant preceding the variables in a product
B. a letter or symbol used to represent an unknown
C. a mathematical expression containing one or more variables
D. a numerical value
E. a mathematical phrase that cannot be determined true or false

Answers

3. constant - D. a numerical value
2. coefficient - A. the constant preceding the variables in a product
4. expression -E. a mathematical phrase....
5. variable - B. a letter... representing an unkown
1. algebraic expression - C. a mathematical expression...

hope this helps

Answer:3. constant - D. a numerical value

2. coefficient - A. the constant preceding the variables in a product

4. expression -E. a mathematical phrase....

5. variable - B. a letter... representing an unkown

1. algebraic expression - C. a mathematical expression...

hope this helps

Step-by-step explanation:

What are the slope and the y-intercept of the linear function that is represented by the equation y=9x-2?

1.)The slope is –2, and the y-intercept is 9.
2.)The slope is 2, and they y-intercept is 9.
3.)The slope is 9, and the y-intercept is –2.
4.)The slope is 9, and the y-intercept is 2.

Answers

Number 3. The slope is 9, and the y-intercept is -2. Remember, equation of a line: y = mx + b. The mx is the slope and the b is the y-intercept

Answer with explanation:

The equation of line in slope intercept form is :

   y= m x +c

Where,m =Slope

c=Y intercept =Distance between origin and point where the line cuts the Y axis

The equation of line is

y= 9 x-2

Comparing with the above equation of line in slope intercept form

Slope =9

Y intercept =2

Option 4

The slope is 9, and the y-intercept is 2.

0.71428571428 as a fraction in simplest form

Answers

Final answer:

To express 0.71428571428 as a fraction, we use a geometric series and find that the simplest form is 713/999.

Explanation:

To express 0.71428571428 as a fraction in simplest form, we first note that the fractional part of the decimal is 0.71428571428. Since the decimal has a repeating pattern, we can represent it as a fraction using a geometric series. Let x equal the fraction, then we have:

x = 0.71428571428

Multiplying both sides by 10 gives:

10x = 7.1428571428

Subtracting the original equation from the new equation eliminates the repeating part:

10x - x = 7.1428571428 - 0.71428571428

Simplifying, we get:

9x = 6.42857142852

Dividing both sides by 9, we find:

x = 0.71428571428 = 6.42857142852/9 = 713/999

Therefore, 0.71428571428 as a fraction in simplest form is 713/999.

Learn more about Expressing decimal as a fraction here:

https://brainly.com/question/29986720

#SPJ12

I REALLY NEED HELP 100 POINTS PLEASE ANSWER HONESTLY!!!
9. Is the statement a good definition? If not, find a counterexample. "An airplane is a vehicle that flies."
1 point
10. Write the converse of the following statement. "If you live in the capital of Georgia, then you live in Atlanta."
1 point
11. Write the TWO conditional (if-then) statements that make up the biconditional. "A parallelogram is a figure with two pairs of parallel sides."
2 points

Answers

I could be wrong on this..

9) yes

10) If you live in Georgia, then you live in Atlanta

11) If three points are collinear, then they are coplanar. 
if three points are coplanar, the they are collinear.

sorry if im wrong


9) yes


10) If you live in Georgia, then you live in Atlanta


11) If three points are collinear, then they are coplanar.

if three points are coplanar, the they are collinear.

In order from smallest to largest 0.9,75%,4/5

Answers

You get 75% which is .75, then you get 4/5 which is .80, and then .90
Greetings! 

In order to compare these number, they all must all be represented in the same form:

1) 0.9 0.9
2) 75% = 0.75
3) 4/5 0.8

0.75<0.8<0.9

Therefore, the order from smallest to largest is:
75%,4/5,0.9

Hope this helps.
-Benjamin


A=11+4b-4c. Solve for C.
Answee Choices:
A. C=a-4b-11/-4
B. C=a+b-11/-4
C. C=a+4b+11/-4
D. C=a-b+11/-4
Can someone please explain this with steps? I don't understand this problem. Thanks!

Answers

Hey Joshua!

The correct answer is option A

a= 11 + 4b - 4c
-4c = a + 11 + 4b
Divide both sides by -4
-4c/-4 = (a + 11 + 4b)/-4
c = a -4b - 11/-4


I hope I helped!

Two expressions with equal sign is equation. C=a-4b-11/-4 is the solution for c when given equation is A=11+4b-4c. Option A is correct.

What is equation?

Two expressions with equal sign is called as equation.

Given equation,

a= 11 + 4b - 4c

We need to separate c from equation,

-4c = a - 11 - 4b

Divide both sides by -4

c=(a-11-4b)/-4

Therefore option A is correct for equation A=11+4b-4c.

To learn more on Equations click : https://brainly.com/question/21105092

#SPJ2

Find the value of ‘x' and the length of segment ab. if b is between a and c, and ab = 3x – 3 and bc = 4x + 8, and ac = 75, then find the value of ‘x' and ab. answer

Answers

Final answer:

To solve for 'x' and the length of segment AB, we use the equation AB + BC = AC, which simplifies to (3x - 3) + (4x + 8) = 75, revealing that 'x' = 10 and the length of AB is 27 units.

Explanation:

The question requires us to find the value of 'x' and the length of segment AB given that B is between A and C, with AB = 3x – 3, BC = 4x + 8, and the total length AC = 75. To solve this, we set up an equation using the given lengths of segments AB and BC to equal the total length AC. This gives us the equation AB + BC = AC, which simplifies to (3x – 3) + (4x + 8) = 75.

First, we simplify the equation: 3x + 4x – 3 + 8 = 75, which reduces to 7x + 5 = 75. Subtracting 5 from both sides gives us 7x = 70. Dividing both sides by 7, we find that x = 10. With the value of x, we can find AB by substituting x back into its equation: AB = 3(10) – 3 = 30 – 3 = 27.

Therefore, the value of 'x' is 10 and the length of segment AB is 27 units.

Equation for (1, -6) and (0,3)

Answers

y = -9x + 3 because the slope of the line is -9 and the y intercept is 3
See the picture for what you are looking for.

Which graph represents a function?

Answers

Answer:

1st and last one

Step-by-step explanation:

the first and the last one are the only ones that represent a function because for each value of x there is only one corresponding value of y.

Final answer:

A graph represents a function if each value of x corresponds uniquely to a value of y. These graphs, often called line graphs, can depict various types of functions like linear, quadratic, etc. The slope and position of the line will vary depending on the function's formula.

Explanation:

In the subject of Mathematics, specifically when dealing with functions and graphs, a graph represents a function if each value of x corresponds to a unique value of y. This means that different values of x will produce different values of y. Graphs can be produced using specific pairs of (x,y) data points.

These graphs may be named line graphs as they showcase the relationship between two variables: one measured on the horizontal axis (x) and the other on the vertical axis (y). An example could be a function where y = a + bx. If b > 0, the line of the graph slopes upward to the right. If b = 0, the line is horizontal. If b < 0, the line slopes downward to the right.

Graphs may also represent other types of functions like linear, quadratic, inverse, or exponential, depending on the equation of the relation between x and y. It's also important to note that there can be other types of graphs, such as a specific type of line graph shown, where the x-axis consists of data values and the y-axis consists of frequency points.

Learn more about Function Graphs here:

https://brainly.com/question/27757761

#SPJ2

2/3 x 5/7 =? A. 7/10 B. 14/15 C. 10/21 D. 7/21


HELP ME

Answers

2/3 * 5/7 =

 multiply the 2 top numbers and then the 2 bottom numbers

2*5 =10

3*7 = 21

so you get 10/21

 answer is C


Jonathon created a graph that shows the number of exercises he completes in his workout routine



Which statement summarizes his exercise routine?Jonathon does 3 crunches for every 2 push-ups.Jonathon does 2 push-ups for every 3 crunches.Jonathon does 2 push-ups for every 15 crunches.Jonathon does 15 push-ups for every 2 crunches.






Answers

Answer: Hello mate!

in the graph you can see that:

Jonathon does 2 pushups when he does 15 crunches.

then he does 4 = ( 2+ 2) pushups when he does 30 = (15 + 15) crunches

this means that he does 2 pushups more than before, and 15 crunches more than before.

and 6= (2 + 2 +2) pushups when he does 35 =(15 + 15 + 15) crunches.

this, again, means that he does 2 pushups more than before, and 15 crunches more than before.

then you can see that he does 2 pushups for every 15 crunches.

How many possible solutions are there to a linear equation in one variable?

Answers

Depending on the equation there can be three possible cases: 1- There can be 1 specific solution for the variable: 2x+4= 3 where x= -1/2 2- there can be an infinite amount of solutions: 2x+x-2=3x-3+1 where x=x 3- there can be no answer: 3+2x-x=5-3x+4x where the solution doesn't exist

what is 8.525 rounded to 2 decimal place????

Answers

8.53, two decimal places would be two numbers after the period. if the third number is 5 or above you round the second number up one. if the third number if 4 or below, you keep the second number the same
8.53

When you got a number which is 5 or above, you round it to 10, therefore adding one to the number on the left

Identify the relative minimum point of the graph. Select all that apply.

Answers

it looks Like it would be B & D because they are the lowest values
b and d bc they are the lowest values

Which set represents a pythagorean triple (1 point)?

Answers

A pythagorean triple is A squared + B squared = C squared. A and B being the smaller numbers (side lengths) whilst C is the larger number (diagonal). Any two numbers (sides) that added together after each being squared equals the bigger number (diagonal) squared is a pythagorean triple.

Decide which of the two points lies on the graph of the line
X= -3
A. 2,-3
B. -3,2

Answers

umm, since x is -3 (given), your answer should be B, since B is the only one with -3 as an x

hope this helps

Explain the axis of symmetry for f(x)=-2(x-4)^2+2

Answers

X=4 
i double checked my work it should be right you can also put it in the calculater
Let x = -b/2a Expand f(x). f(x) = -2(x-4)^2+2 f(x) = -2(x^2 - 8x + 16) + 2 f(x) = -2x^2 + 16x - 32 + 2 f(x) = -2x^2 + 16x - 30 Let a = - 2 and b = 16 Plug into x = -b/2a to find your axis of symmetry. x = -(16)/2(-2) x = -16/-4 x = 4 The axis of symmetry is x = 4.
Other Questions
Which is a characteristics of an autobiography? What do you think tom and daisy were saying in the kitchen? a population that increases 5 percent every year is said to be experiencing What is the equation of the quadratic function with roots -3 and 1 and a vertex a (-1, -8)? Unlike the kings and queens of England, monarchs in France Explain how a story about a dog might be an ideal way to explore the theme of how laws work. Include specific examples of dogs' traits and behaviors. Your answer should be at least one hundred and fifty words.What does it by saying the theme of laws? I need to understand that is all. Round 977.259856871 to 3 decimal places Amongst the Mayan peoples, painters were a part of the ____________.a.working classc.ruling classb.slave classd.lower classPlease select the best answer from the choices providedABCD Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Inner-city schools in american continue to have tremendous problems. approximately _____ of the high schools in the united states produce _____ of the country's dropouts. For 15 points The region or area you live today looks nothing like it did when first created. For years man has built new structures or modified the world around us in some way. Choose something around you or somewhere in the world and describe what man has done to modify the area and the change it has brought. (PLEASE HELP!!!)(47 POINTS!!!!!)in one to three paragraphs, compare and contrast the Amy Tan story, Two Kinds and Collier's "Marigolds". Discuss two differences and two similarities. Support your analysis with text evidence and MLA formatting for in text citations. Make one text to self connection about either story. Discuss the major functions of the lymphatic system City of pasadena in california in known for? A train leaves little rock, arkansas, and travels north at 70 kilometers per hour. another train leaves at the same time and travels south at 55 kilometers per hour. how long will it take before they are 375 kilometers apart? Identify the participle in the sentence.The idling engine sound fine to me now._______Is there a business future in manufactured houses, Dad?A: FutureB: IsC: housesD: DadPaying for the flute, Tammy smiled happily and skipped all the way home.A: none of the above B: smiled happilyC: all the way home D: Paying for the flute What specific nutrition guidelines has your school district put in place?Name at least three. Select the correct statement to describe when a sample of liquid water vaporizes into water vapor.A. Temperature decreases and molecular motion increases while shape becomes less defined.B. Temperature decreases and molecular motion decreases while shape becomes more defined.C. Temperature increases and molecular motion decreases while shape becomes more defined.D. Temperature increases and molecular motion increases while shape becomes less defined. Write an equation to represent: four-fifths of z added to six equals eightA) 4/5 z + 6 = 8 B) 4/5 + 6z = 8 C) 4/5 (6)(z) = 8 D) 4/5 (6) + z = 8 A fruit juice container holds 16 servings. If the servings size in 6 ounces, how many ounces does the container hold in all? Steam Workshop Downloader