What is the name of this alkane?
A) 1-methylbutane
B) 2-methylbutane
C) 1,2-triethylethane
D) 1-dimethylpropane

In a financial plan, cash inflows represent the sources of revenue or capital coming into the business. This could be from sale of products or services, investment income, funds raised from investors or loans, or reinvested profits.

In a financial plan, cash inflows represent the sources of revenue earned by the business. Such cash inflows could be listed as follows:

Under cash flows, we focus primarily on the channels that bring cash into the organization.

https://brainly.com/question/10714011

#SPJ2

the answer is  1.24  mol Mg(OH)2

The required moles of Mg(OH)₂ that are needed to completely neutralize 2.48 mol of HNO₃ is 1.24 moles.

Stoichiometry of the reaction gives idea about the relative amount of moles of reactants and products present in the given chemical reaction.

Given chemical reaction is:

Mg(OH)₂ + 2HNO₃ → Mg(NO₃)₂ + 2H₂O

From the stoichiometry of the reaction, it is clear that:

2 moles of HNO₃ = reacts with 1 moles of Mg(OH)₂

2.48 moles of HNO₃ = reacts with (1/2)(2.48)=1.24 moles of Mg(OH)₂

Hence required moles of Mg(OH)₂ is 1.24mol.

To know more about stoichiometry, visit the below link:

https://brainly.com/question/14935523

#SPJ2

freezing. Think of what happens when you put water in the freezer

Answer:

sample response:  Prairie dogs create a safe home for their young by creating underground burrows, which protect them from hailstorms, blizzards, floods, droughts, and fires. The burrow contains many different chambers, including a nursery that is very deep underground. This protects the young from predators as well as changes in the temperature outside. The burrows even include observation posts where they can watch for predators.

Explanation:

The valence electrons are transferred from the potassium atom to the fluorine atom, resulting in the formation of an ionic bond in potassium fluoride (KF), with potassium becoming a cation and fluorine becoming an anion.

When one atom of potassium (K) combines with one atom of fluorine (F), an ionic bond forms, resulting in potassium fluoride (KF). In this process, the valence electrons are not shared equally between K and F, nor do they spend more time around the atom of K. Instead, the valence electrons are transferred from the potassium atom to the fluorine atom, due to the difference in electronegativity between the two elements. Potassium, which has just one electron in its valence shell, easily donates this electron, becoming a positively charged ion, or cation. Fluorine, which has seven electrons in its valence shell, gladly accepts this electron to complete its octet, becoming a negatively charged ion, or anion, as a result.

Sawdust burns more quickly than a block of wood because it has a higher surface area, which allows more oxygen to come into contact with the wood particles and accelerate the combustion reaction. Larger blocks have less surface area exposed to oxygen, so they burn more slowly. High surface area is also the reason why powdered substances, like flour in mills, can be hazardous.

The reason why sawdust burns more quickly than a block of wood of equal mass under the same conditions can be attributed to the difference in surface area. Sawdust consists of tiny particles, each with its own surface exposed to the oxygen in the air. This increased surface area allows for more oxygen molecules to come in contact with the wood particles simultaneously, thus speeding up the combustion reaction.

Larger pieces of wood, such as blocks, have a lower surface area relative to their mass because much of the wood's material is inside the block, where oxygen cannot easily reach. As a result, the reaction takes place more slowly. When more surface is exposed, as with sawdust, there is a greater likelihood for the wood particles to come in contact with the oxygen required for burning, leading to a faster reaction rate.

Examples of this can be seen when starting a fire; kindling with a high surface area is used to initiate the fire due to its ability to burn more rapidly. Additionally, this principle demonstrates why powdered substances can be more hazardous, as seen in the explosion risk in flour mills, where flour particles have a high surface area.

Answer : The correct name for the compound [tex]MgBr_2[/tex] is, Magnesium bromide.

Explanation :

Ionic compound : It is defined as the compound which is formed when electron gets transferred from one atom to another atom.

Ionic compound are usually formed when a metal reacts with a non-metal.

The rules for naming the ionic compounds is given as :

Hence, the correct name for the compound [tex]MgBr_2[/tex] is, Magnesium bromide.

Answer : The correct option is, 4.81 g

Explanation : Given,

Mass of aluminium = 2.70 g

Molar mass of aluminium = 26.98 g/mole

Molar mass of sulfur = 32.07 g/mole

First we have to calculate the moles of aluminium.

[tex]\text{Moles of Al}=\frac{\text{Mass of Al}}{\text{Molar mass of Al}}=\frac{2.7g}{26.98g/mole}=0.1mole[/tex]

Now we have to calculate the moles of sulfur.

According to the question,

As, 2 moles of aluminium react with 3 moles of sulfur

So, 0.1 mole of aluminium react with [tex]\frac{3}{2}\times 0.1=0.15mole[/tex] of sulfur

Now we have to calculate the mass of sulfur.

[tex]\text{Mass of sulfur}=\text{Moles of sulfur}\times \text{Molar mass of sulfur}[/tex]

[tex]\text{Mass of sulfur}=0.15mole\times 32.07g/mole=4.81g[/tex]

Therefore, the mass of sulfur he take must be, 4.81 g

Answer:

c

Explanation:

Answer:

70%

Explanation:

105 divided by 150 equal to 0.7.  then u multiply 0.7 by 100. equal 70.  so its C because efficiency = (effective work)/(executed work) * 100%

hope it helped :3

Answer:

70%

Explanation:

105 divided by 150 equal to 0.7.  then u multiply 0.7 by 100. equal 70.  so its C because efficiency = (effective work)/(executed work) * 100%

Answer:

A chemical change.

Explanation:

I just took the test and got it right.

Since there are no given data for us to solve this problem, I will explain what a Standard Reduction Potential is. For example, if a student had an experiment and he wanted to know what is the most efficient and powerful redox reaction involving an uncommon combination of chemicals. The student would most likely record information in the Standard Reduction Potential that showed the voltage generated by the reaction in Aqueous Solution at 25 degrees Celsius and 1 atmosphere. This is a list of half reaction of ions in the solution at standard temperature and pressure.

Final answer:

The Law of Conservation of Energy highlights the transformation, not the depletion, of energy. In homes, heat transfers via conduction, convection, and radiation. Solar energy is advised for Energyville for its renewable qualities, while swapping to LED lights at home conserves energy.

Explanation:

The Law of Conservation of Energy teaches us that energy cannot be created or destroyed, only transformed from one form to another. This principle is fundamental in understanding how energy interacts and transforms in the universe.

Conduction: Heat moving through the walls of your house.

Convection: Warm air circulating inside a room.

Radiation: Heat from the sun warming your home's surfaces.

Renewable vs Nonrenewable Resources: Renewable resources, such as solar and wind, can be replenished over time and have lower environmental impacts, whereas nonrenewable resources, like coal and oil, are finite and typically more polluting.

For Energyville, I recommend solar energy as a renewable source due to its accessibility, decreasing cost, and low environmental impact compared to other energy sources.

One way to conserve energy at home is to replace incandescent bulbs with LED lights, which use less energy and last longer, significantly reducing energy consumption and costs.

Answer:

No, because the different properties are physical while the chemical properties remain the same.

Explanation:

Answer:

They have the same number of electron shells, and they transition from a metal to nonmetal to inert gas from left to right.

Answer: The correct answer is all of these.

Explanation:

Organic compounds are defined as the chemical compounds where one or more carbon atoms are covalently bonded to other atoms of hydrogen, oxygen or nitrogen.

They occur naturally in nature and the main sources of these organic compounds are petroleum, coal and natural gases.

Petroleum are the naturally occurring substances which contain organic compounds in the form of gases, liquid or semi-solid. Thus, they are a major source of organic compound.

Coal is also a form of fossil fuel which are the major source of organic compound.

Natural gas contains hydrocarbons and also is the major source of organic compounds.

Thus, the correct answer is all of these.

Because they move in a horizontal path

Answer:

Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances.

Explanation:

Applied research refers to research targeted at solving a specific problem in the society. Simply put, it is a research that focuses on bringing solution to practical problems in the society.

Chloroflourocarbons(CFCs) are known to cause damage to the ozone layer. Hence any research aimed at its substitution is targeted at solving a practical problem in the society hence it is an applied research.

Answer:

1. Ernerst Rutherford =====> Discovery of Atomic Nucleus

2. James Chadwick =====> Discovery of Neutron

3. Henri Becquerel =====> Discovery of Radioactivity

4. J.J. Thomson =====> Discovery of Electron

Explanation:

The answer is A. Hydrogen bond

Molecules that have nonpolar covalent bonds donot form hydrogen bonds. Strenght. Hydrogen bonds are classified as weak bonds because they are easily and rapidly formed and broken under normal biological conditions.

Hope I helped :)

-Bucky

Answer:

2.48

Explanation:

i am not explaining step by step so the answer is straight to the point. sorry i fyou wanted if an explanation.

THE ANSWER IS:    A.) CHEMICAL CHANGE

When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. Its a type of chemical change.

Chemical synthesis, and, alternatively, chemical breakdown into two or more separate molecules, occurs when one material reacts with another to create a new substance. These processes have been referred to as chemical change, and they are typically irreversible barring additional chemical reactions.

The organic compounds sodium bicarbonate, also referred to as baking soda and bicarbonate of soda, have the formula [tex]NaHCO_{3}[/tex] . That is a salt made up of the cation sodium and the anion bicarbonate. Sodium bicarbonate ( [tex]NaHCO_{3}[/tex] ) would be a white, crystalline substance that frequently takes the form of a fine powder.

Now, it is found that when Gerald mixes baking soda and vinegar, the materials combine to turn into a gas is a kind of chemical change.

To know more about chemical change and baking soda

https://brainly.com/question/23693316

#SPJ2

Answer: Option (d) is the correct answer.

Explanation:

In the given reaction, [tex]C_{2}H_{4}(g) + H_{2}(g) \rightarrow C_{2}H_{6}(g)[/tex] greatest increase in rate of reaction only occur when we increase the temperature and also increase the pressure.

This is because increase in pressure will bring the molecules closer to each other whereas increase in temperature will help in more number of collisions between reactant molecules.

Thus, this will lead to increase in formation of products. Hence, we can conclude that rate of reaction will increase with increase in temperature and increase in pressure.