Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

Answers

Answer 1
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer 2

The dehydration of 2-heptanol would yield 2-heptene as the major product along with 1-heptene as a minor product, while the dehydration of 2-methyl-1-cyclohexanol would yield 1-methyl-1-cyclohexene as the major product along with other isomeric alkenes as minor products.

The products obtained by the dehydration of 2-heptanol and 2-methyl-1-cyclohexanol can be predicted based on the rules of alkene formation during dehydration reactions.

For 2-heptanol, the dehydration follows Zaitsev's rule, which states that the more substituted alkene is the major product. In this case, dehydration of 2-heptanol would yield a mixture of alkenes, with the most substituted alkene, 2-heptene, as the major product, and the less substituted alkene, 1-heptene, as a minor product. The reaction can be represented as follows:

[tex]\[ \text{CH}_3\text{CH}(\text{OH})\text{CH}_2\text{CH}_2\text{CH}_2\text{CH}_3 \rightarrow \text{CH}_3\text{CH}=\text{CHCH}_2\text{CH}_2\text{CH}_3 + \text{CH}_3\text{CH}_2\text{CH}=\text{CHCH}_2\text{CH}_3 \][/tex]

For 2-methyl-1-cyclohexanol, the dehydration would also follow Zaitsev's rule. However, since the hydroxyl group is on a cyclohexane ring, the dehydration would lead to the formation of an alkene within the ring. The most substituted alkene that can be formed is 1-methyl-1-cyclohexene. The reaction can be represented as follows:

[tex]\[ \text{C}_6\text{H}_{11}\text{CH}(\text{OH})\text{CH}_3 \rightarrow \text{C}_6\text{H}_{11}\text{C}(\text{CH}_3)=\text{CH}_2 + \text{isomeric alkenes} \][/tex]

In summary, the dehydration of 2-heptanol would yield 2-heptene as the major product along with 1-heptene as a minor product, while the dehydration of 2-methyl-1-cyclohexanol would yield 1-methyl-1-cyclohexene as the major product along with other isomeric alkenes as minor products.


Related Questions

The instrument that is commonly used to measure the intensity of radioactivity is called a _____.

Answers

Geiger counter, hope this helps food luck
Geiger Counter is the answer

If 32.0 g of MgSO4⋅7H2O is thoroughly heated, what mass of anhydrous magnesium sulfate will remain?

Answers

find moles of MgSO4.7H2O

molar mass = 246
so moles  = 32 / 246  = 0.13 moles.

When heated, all 7 H2O from 1 molecule will be gone. 
total moles of H2O present = 7 x 0.13 = 0.91
mass of those H2O = 0.91 x 18  = 16.38g

so mass of anyhydrous MgSO4 remain = 32 - 16.38 = 15.62 g

After heating, approximately 15.65 g of anhydrous magnesium sulfate will remain from the original 32.0 g of magnesium sulfate heptahydrate.

Identify the Molar Masses:

Molar mass of MgSO₄ = 24.31 (Mg) + 32.07 (S) + 4 × 16.00 (O) = 120.37 g/molMolar mass of 7H₂O = 7 × 18.02 (H₂O) = 126.14 g/molTherefore, the molar mass of MgSO₄·7H₂O = 120.37 g/mol + 126.14 g/mol = 246.51 g/mol

Calculate the Moles of MgSO₄·7H₂O:

Moles of MgSO₄·7H₂O =
246.51 g/mol32.0 g​≈0.129 mol

Determine the Moles of Anhydrous MgSO₄:

Upon heating, all the water is removed, leaving anhydrous MgSO₄.The moles of anhydrous MgSO₄ are equal to the moles of MgSO₄·7H₂O because heating just removes water.

Calculate the Mass of Anhydrous MgSO₄:

Mass of MgSO₄ = Moles × Molar Mass
=0.129 mol × 120.37 g/mol ≈ 15.65 g

A sample of a chromium-containing alloy weighing 3.450 g was dissolved in acid, and all the chromium in the sample was oxidized to 2cro42–. it was then found that 3.18 g of na2so3 was required to reduce the 2cro42– to cro2– in a basic solution, with the so32– being oxidized to so42–. write a balanced equation for the reaction of 2cro42– with so32- in a basic solution.

Answers

Final answer:

The balanced equation for the reaction of chromate ion (CrO4^2-) with sulfite ion (SO3^2-) in a basic solution where the sulfite is oxidized to sulfate and the chromate is reduced to chromite is 3SO3^2-(aq) + 2CrO4^2-(aq) + 2OH^-(aq) → 3SO4^2-(aq) + 2CrO2^-(aq) + H2O(l).

Explanation:

The question asks for a balanced chemical reaction between chromate ion (CrO42-) and sulfite ion (SO32-) in basic solution. To balance this redox reaction, we must consider both the oxidation and reduction half-reactions and ensure that the number of electrons lost in oxidation equals the number gained in reduction, also making sure to balance other elements and charges, particularly in a basic solution.

In the basic solution, hydroxide ions (OH-) will participate in the balancing process. The sulfite ion (SO32-) is oxidized to sulfate ion (SO42-), and the chromate ion (CrO42-) is reduced to chromite ion (CrO2-).

The balanced equation for the reaction is:

3SO32-(aq) + 2CrO42-(aq) + 2OH-(aq) → 3SO42-(aq) + 2CrO2-(aq) + H2O(l).

The light emitted by an incandescent element produces:
~a unique continuous spectrum
~an emission line spectrum
~a spectrum identical to the hydrogen atom
~a spectrum of one unique wavelength

Answers

It produces a line emission spectrum. I hope that helps.

Answer:  an emission line spectrum

Explanation:  An emission line spectrum is produced form the light emitted by the incandescent lamp.

Line Spectrum is produced when the electron that has been excited to the higher energy state levels moves between the molecular energy levels while returning to the ground state.

Incandescent lamp is the lam that generates electricity when electrical current runs through it.

What is the de Broglie wavelength (in meters) of a 45-g golf ball traveling at 72 m/s?

Answers

Data:

mass = 45 g = 0.045 kg

velocity = 72 m/s

Formula:

wavelength = Planck constant / (mass * velocity)

Solution:

Planck constant is 6.63 * 10^ -34 J*s

=> wavelength = 6.63 * 10 ^ -34 J*s / (0.045 kg * 72 m/s)

wavelength = 2.05 * 10^ - 34 m

Answer: 2.05 * 10 ^  -34 m

A sample of br2(g) takes 48.0 min to effuse through a membrane. how long would it take the same number of moles of ar(g) to effuse through the same membrane?

Answers

From the periodic table:
mass of Br = 79.9 grams
mass of Ar = 39.9 grams
Therefore,
molar mass of Ar = 39.9 grams
molar mass of Br2 = 2(79.9) = 159.8 grams

Now,
time for Ar / time for Br2 = sqrt(molar mass of Ar / molar mass of Br2)
time for Ar = 48 * sqrt(39.9 / 158.9)
time for Ar = 24.0528 minutes
Final answer:

Using Graham's law of effusion, it can be calculated that it would take 24.0 minutes for the same number of moles of Argon gas to effuse through the same membrane as compared to Bromine gas.

Explanation:

The question is asking how long it would take for an equal amount of argon gas to effuse compared to bromine gas. This is related to Graham's law of effusion, which says that the rate of effusion of a gas is inversely proportional to the square root of its molar mass.

Thus, in accordance with this law, the effusion rate of a gas is given by the formula: Rate = √(M2/M1), where M1 and M2 are the molar masses of the two gases involved. For Argon (Ar) and Bromine (Br2), their molar masses are 39.95 g/mol and approximately 159.8 g/mol respectively. Plugging these values into Graham's equation, the rate at which Argon effuses as compared to Bromine would be √(159.8 g/mol / 39.95 g/mol) = √(4) = 2. Given that Bromine takes 48.0 minutes to effuse, Argon, effusing at twice the rate, would take half the time - 48.0 minutes / 2 = 24.0 minutes to effuse through the same membrane.

Learn more about Graham's Law of Effusion here:

https://brainly.com/question/34146005

#SPJ11

What is the process that changes the composition of rocks by dissolving them called?

Answers

Weathering & Erosion

which has prokaryotic cells

Answers

An organism is said to have a prokaryotic cell if its cell is a very simple one that does not contain any true nucleus and which do not have membrane bound organelles. Prokaryotes are usually unicellular organisms, examples are bacteria. One key feature of prokaryotic cell is a piece of circular, double stranded DNA which is usually found in the cell.

Prokaryotic cells are found in bacteria and archaea.

What is Prokaryotic cells

Prokaryotic cells are a type of cell that lacks a nucleus and other membrane-bound organelles. They are found in bacteria and archaea, which are two domains of microorganisms.

Prokaryotic cells are structurally simpler compared to eukaryotic cells, which are found in plants, animals, fungi, and protists.

Learn more about prokaryotic cells at

https://brainly.com/question/25774476

#SPJ6

What are the benefits of stationary weather collection

Answers

accuracy i think but i may be wrong

Identify the statement that correctly describes light and how it travels? (2 points)
Select one:
a. Light waves can travel in a vacuum and travel at a constant speed even if the light source is moving.
b. Light waves can travel in a vacuum and will travel faster if the light source is moving forward.
c. Light waves need a medium to travel, and they travel faster if the light source is moving forward.
d. Light waves need a medium to travel, and they travel at the same speed even if the light source is moving.

Answers


Light does not travel at a constant speed in a vacuum, compared to in air, because the light is being absorbed by atoms and molecules in the air. But light does travel at a constant speed in a vacuum.
So I agree with A
All that talk about moving forward is irrelevant (I think)
A vacuum implies an absence of any material, not just air. Light has a fixed speed in a vacuum of about 300,000km per second. There is no medium for electromagnetic radiation and the speed is unaffected by a moving source. The notion of the ether as a medium for light was found to be false by experiment. Answer a applies.

Assuming ideal gas behavior, what is the pressure in atm exerted by 1.57 mol Cl2(g) confined to a volume of 1.50 L at 273K?

Answers

The formula for ideal gas law is:

P V = n R T

where

P is pressure = ?

V is volume = 1.50 L

n is number of moles = 1.57 mol

R is gas constant = 0.08205746 L atm / mol K

T is temperature = 273 K

 

P = 1.57 mol * 0.08205746 L atm / mol K * 273 K / 1.50 L

P = 23.45 atm

What is the molecular formula of a compound with the empirical formula C13H19O2 and molar mass of 414.64 g?

Answers

Final answer:

The molecular formula of a compound with the empirical formula C13H19O2 and molar mass of 414.64 g/mol is C26H38O4.

Explanation:

To find the molecular formula of a compound with the empirical formula C13H19O2 and a molar mass of 414.64 g/mol, we first need to calculate the empirical formula mass. The empirical formula mass of C13H19O2 is (13 × 12.01 g/mol for carbon) + (19 × 1.01 g/mol for hydrogen) + (2 × 16.00 g/mol for oxygen), which equals 205.32 g/mol. Then, we divide the given molar mass by the empirical formula mass to determine how many times the empirical formula fits into the molar mass.

414.64 g/mol ÷ 205.32 g/mol ≈ 2

Since the result is approximately 2, we multiply the subscripts in the empirical formula by 2 to obtain the molecular formula, resulting in C26H38O4 as the molecular formula of the compound.

Which forces involve nonpolar molecules?
hydrogen bonds and London dispersion forces
London dispersion forces and dipole-induced dipole forces
dipole-dipole forces and hydrogen bonds
dipole-induced dipole forces and dipole-dipole forces

Answers

The answer is London dispersin forces and dipole-induced dipole forces.

The London dispersion force is a temporary attractive force that results when the electrons in two adjacent atoms occupy positions that make the atoms form temporary dipoles. This force is sometimes called an induced dipole-induced dipole attraction. This force is found in any compound and is the weakest atraction force between atoms or molecules.

Those temporay dipoles are not like the dipoles that form the polar molecules, because the polar molecules are the result of permanent dipoles.

Calculate the formula mass for the compound tin(IV) sulfate.

Answers

The molecular formula for tin(IV)  sulfate is Sn(SO₄)₂.
mass of sulfur S = 32.065
as there is 2 sulfur in tin (IV) sulfate = 32.065 x 2 = 64.13
mass of oxygen = 15.999 and there are 8 oxygen atoms in the formula; 
8 x 15.999 = 127.992
mass of tin = 118.71
now add all the masses = 64.13 + 127.992 + 118.71 = 310.832 
formula mass of tin(IV) sulfate is 310.832

The Lewis structure for ethylene, C2H4, is shown. How many valence electrons do the two carbon atoms in the molecule share with each other in the double bond?

Answers

So,

The Lewis structure for ethylene is two carbons double-bonded to each other, and two hydrogens single-bonded to each carbon atom.

Each bond symbolizes two shared valence electrons.  Since the carbon atoms are double-bonded, they share four (4) valence electrons (the other electrons are in lower energy levels and do not appear because they typically don't react when higher energy-level electrons are on top of them).


the correct answer is 2


You have a stock solution of 15.8 m nh3. how many milliliters of this solution should you dilute to make 1000.0 ml of 0.250 m nh3?

Answers

The rule that will be used to solve this types of questions is:
M1 * V1 = M2 * V2

From the givens we have:
M1 = 15.8 m
V1 is unknown
M2 = 0.25 m
V2 = 1000 ml

Substitute with these givens in the above equation to get V1 as follows:
15.8*V1 = 0.25*1000
V1 = 15.82278 ml

Charcoal is primarily carbon. what mass of co2 is produced if you burn enough carbon (in the form of charcoal) to produce 4.60kj×102kj of heat? the balanced chemical equation is as follows:c(s)+o2(g)→co2(g),δh∘rxn=−393.5kj

Answers

1) Balanced chemical equation:

C(s)+O2(g)→CO2(g), δh∘rxn=−393.5kj

2) Meaning: When burned 1 mol of C(s), this is solid pure charcoal, produces 1 mol of CO2 and liberates 393.5 kJ of heat

Ratio: 1 mol CO2 : 393.5 kJ

3) Proportion:

1 mol CO2               x
--------------- = -------------------
393.5 kJ          4.6 * 10^2 kJ


4) Solve for x:

x = 460 kJ * 1 mol CO2 / 393.5 kJ = 1.1690 mol CO2

5) convert moles to grams

mass in grams = number of moles * molar mass

mass in grams = 1.1690 mol * 44.01 g / mol = 51.4 g

Answer: 51.4 g
Final answer:

The combustion of carbon in forms like charcoal to release a specific amount of heat, based on the chemical reaction and heat change, allows us to calculate the resulting mass of carbon dioxide. To produce 4.60x102 kJ heat, approximately 51.4 g of carbon dioxide would be generated.

Explanation:

In the provided chemical reaction, C(s) + O₂(g)  CO₂(g), with the heat change (ΔH°) being -393.5 kJ, we interpret that the combustion of one mole of carbon (charcoal form) releases 393.5 kJ of heat. We know that the heat release comes from the formation of carbon dioxide (CO2). So, for 4.60x102 kJ, the moles of CO2 produced can be calculated by using the ratio rule for mole and energy. So, the number of moles of CO2 produced = 4.60x102 kJ * (1 mole CO2/-393.5kJ) = 1.17 moles. The

mass of CO2

is the number of moles * molecular weight of CO2 = 1.17 mol * 44 g/mol = 51.4 g. Hence, the combustion of sufficient carbon (charcoal form) to produce 4.60x102 kJ of heat generates 51.4 g of carbon dioxide.

Learn more about Chemical Reaction here:

https://brainly.com/question/34137415

#SPJ3

When a soda is poured into a glass and the soda bubbles, is it the result of a chemical change? explain your answer?

Answers

Yes, It is the result of the chemical change when a soda is poured into a glass and the soda bubbles, as the bubbles are Co2 escaping from a liquid. We can say that it is a chemical change because it change to another material with different properties so we can conclude that it is a result of a chemical change.

How much water must be added to 12.0 mL of 1.65 M LiCl to dilute the solution to 0.495 M LiCl?

Answers

To solve this problem, we use the formula:

M1 V1 = M2 V2

To calculate for the total final volume V2:

 

V2 = M1 V1 / M2

V2 = 1.65 M * 12 mL / 0.495 M

V2 = 40 mL

 

Since final volume is 40 mL so water needed is:

water volume = 40 mL – 12 mL

water volume = 28 mL

Solid potassium hydroxide koh decomposes into gaseous water and solid potassium oxide . write a balanced chemical equation for this reaction.

Answers

Answer:

2KOH(s) ---> K2O(s) + H2O(g)

Explanation:

potassium hydroxide = KOH

water = H2O

potassium oxide = K2O

since KOH decomposes into H2O and K2O there is an arrow after KOH then after that you balance it. Without doing anything, KOH ----> H2O + K2O on the left side of the arrow there is only one K, one O, and one H atoms while on the other side there are 2 H, 2O, and 2K which means we have to put the two in front of the KOH. so then you will have 2K, 2O, 2H on the left-handed side which will equal the number of atoms there are on the right-handed side.

Also dont forget to put whether it is g, s, or aq.

In the instructions it tells you which one is s , g, or aq.

Final answer:

The balanced chemical equation for the decomposition of solid potassium hydroxide (KOH) into solid potassium oxide (K2O) and gaseous water (H2O) is: 4 KOH(s) → 2 K2O(s) + 2 H2O(g).

Explanation:

The balanced chemical equation for the decomposition of solid potassium hydroxide (KOH) into gaseous water (H2O) and solid potassium oxide (K2O) is:

4 KOH(s) → 2 K2O(s) + 2 H2O(g)

This reaction showcases the breakdown of potassium hydroxide into simpler substances when it decomposes. Notice that the total number of atoms for each element is conserved on both sides of the equation, fulfilling the Law of Conservation of Mass.

Write orbital diagrams (boxes with arrows in them) to represent the electron configurations of carbon before and after sp hybridization.

Answers

Carbon has an electron configuration of 1s^2 2s^2 2p^2. During sp hybridization, one s and one p orbital of carbon combine to form two sp hybrid orbitals.


Final answer:

The electron configuration of carbon atom in its ground state is 1s² 2s² 2p². After sp hybridization, one 2s electron gets excited to the 2p orbital forming four unpaired electrons ready for bonding. These form two sp hybrid orbitals, leaving the remaining two 2p orbitals with single electrons.

Explanation:

The electron configuration for a carbon atom (C) in its ground state is 1s² 2s² 2p², represented by an orbital diagram with two arrows in the 1s box, two in the 2s, and two single arrows in two of the three 2p boxes, indicating paired and unpaired electrons respectively.

During sp hybridization, one of the 2s electrons gets excited and moves to the 2p orbital, leading to four unpaired electrons ready for bonding. These mix to form two sp orbitals. In the electron configuration diagram, the two sp hybrid orbitals would have a single electron each, leaving the remain two 2p orbitals also with single electrons. Remember, these are depicted as boxes, each with a single upward arrow.

The distinction between the carbon atom's electron configurations before and after sp hybridization is essential in understanding its bonding behaviour and the formation of diverse organic compounds.

Learn more about sp Hybridization here:

https://brainly.com/question/30198266

#SPJ12

Household object that includes metal and why

Answers

Metal objects can be found in a variety of locations throughout the house. A common location would be the garage as it is a common storage location for tools and machinery which are made of metals like steel and aluminum.

Describe the preparation of 40 liters of 0.02 m phosphate buffer, ph 6.9

Answers

By following these steps, you can prepare 40 liters of 0.02 M phosphate buffer with a pH of 6.9 using solid Na3PO4 and 1M HCl:

Step 1: Calculate the amount of Na3PO4 required

Step 2: Prepare the Na3PO4 solution

Step 3: Calculate the amount of HCl required

Step 4: Adjust the pH

To prepare 40 liters of 0.02 M phosphate buffer solution with a pH of 6.9, starting from solid Na3PO4 and 1M HCl, we can follow these steps:

Step 1: Calculate the amount of Na3PO4 required

The phosphate buffer will be prepared using the following equilibrium reaction:

Na3PO4 + 3HCl → 3NaCl + H3PO4

We need to calculate the amount of Na3PO4 required to make a 0.02 M solution in 40 liters.

First, calculate the moles of phosphate ions required:

Moles of phosphate ions = Molarity × Volume

Moles of phosphate ions = 0.02 mol/L × 40 L = 0.8 moles

Since Na3PO4 dissociates into three moles of phosphate ions, the moles of Na3PO4 needed will be one-third of the moles of phosphate ions:

Moles of Na3PO4 = 0.8 moles / 3 = 0.2667 moles

Step 2: Prepare the Na3PO4 solution

Weigh out the calculated amount of Na3PO4 and dissolve it in water to make up the 40 liters of solution.

Step 3: Calculate the amount of HCl required

The pH of the buffer is adjusted using HCl. To achieve a pH of 6.9, we need to calculate the amount of 1M HCl needed.

Step 4: Adjust the pH

Add the calculated amount of 1M HCl to the Na3PO4 solution while monitoring the pH using a pH meter or pH paper. The pH should be adjusted to 6.9 by adding small amounts of HCl at a time and then checking the pH until the desired pH is reached.

By following these steps, you can prepare 40 liters of 0.02 M phosphate buffer with a pH of 6.9 using solid Na3PO4 and 1M HCl.

The probable question may be:

Describe the preparation of 40 liters of 0.02 M phosphate buffer, pH 6.9, starting from solid Na3PO4 and 1M HCl.

The following chemical reaction takes place in aqueous solution: 2FeBr3 (aq) + 3Na2S (aq) → Fe2S3 (s) + 6NaBr (aq) Write the net ionic equation for this reaction.

Answers

net ionic equation simply means to cancel out any ions which appear on both sides of the chemical equation that are not involved in the reaction - they're called spectator ions
We'll first write out the full ionic equation, showing all ions and compounds formed, then rewrite and not include spectator ions.

2FeBr3(aq) + 3Na2S(Aq) --> Fe2S3(s) + 6NaBr(aq)   [original eqation]

2Fe3+(aq) + 6Br-(aq) + 3Na+(aq) + 3S2-(aq)--> Fe2S3(s)+6Na+(aq) + 6Br-(aq)
[full ionic equation]

2Fe3+(aq) + 3S2-(aq)--> Fe2S3(s)   [net ionic equation]

notice that Br- and Na+ appear unreacted on both sides of the full ionic equation, so they cancel out and do not appear in the net ionic.

*Please give me a 'brainliest' if you can! Thanks!


Final answer:

In the reaction given, the net ionic equation is derived by removing the spectator ions, resulting in the net ionic equation: 2Fe3+ (aq) + 3S2- (aq) → Fe2S3 (s).

Explanation:

The net ionic equation is derived by eliminating the spectator ions from the total ionic equation. The first step is to break all the strong electrolytes into their ions. In the reaction 2FeBr3 (aq) + 3Na2S (aq) → Fe2S3 (s) + 6NaBr (aq), we have the following ions:

2Fe3+ (aq) + 6Br- (aq)6Na+ (aq) + 3S2- (aq)

These combine to form Fe2S3 (s) and 6Na+ (aq) + 6Br- (aq). The ions that appear on both sides of the equation are the spectator ions (Na+ and Br-), and we can remove them to get the net ionic equation:

2Fe3+ (aq) + 3S2- (aq) → Fe2S3 (s)

Learn more about net ionic equation here:

https://brainly.com/question/36522237

#SPJ6

SELECT ALL THAT APPLY. Which of the following statements about Charles's law are true?



A. Real gases may be expected to deviate from Charles's law at high pressures.
B. Ideal gases may be expected to deviate from Charles's law at high pressures.
C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.
D. Ideal gases may be expected to deviate from Charles's law near the liquefaction temperature.

Answers

A. Real gases may be expected to deviate from Charles's law at high pressures.

C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.

Answer is:

A. Real gases may be expected to deviate from Charles's law at high pressures.

C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.

At high pressure gas molecules are close to one another and near the liqueffaction temperature energy is very low.

Charles' Law (The Temperature-Volume Law) - the volume of a given amount of gas held at constant pressure is directly proportional to the Kelvin temperature:  

V₁/T₁ = V₂/T₂.  

When temperature goes down, the volume also goes down.


If 78.5 mol of an ideal gas occupies 40.5 l at 83.00 °c, what is the pressure of the gas?

Answers

sorry i couldnt help

Classify these atomic orbitals as sp, or d according to their shape.

Answers

Generally these atomic orbitals assume the shapes of their letters. S-orbitals are spherical. P-orbitals are dumb-bell shaped, and D-orbitals take the shape of a clover leaf (like two dumb bell in a plane).

s and p orbitals do not have sp or d designations, while d orbitals are classified as d based on their shape and angular momentum quantum number. sp orbitals are formed by hybridization and are not based solely on the shape of individual atomic orbitals.

Atomic orbitals are regions in space where electrons are likely to be found around an atomic nucleus. They have specific shapes associated with their quantum numbers, which describe their size, shape, and orientation. The classification of atomic orbitals as sp or d depends on their shape and the angular momentum quantum number, l.

s Orbitals: These are spherical in shape and have l = 0. They are associated with the azimuthal quantum number (angular momentum) and are not divided into subshells. In terms of classification, s orbitals are not denoted as sp or d.

p Orbitals: These are -shaped and come in sets of three, oriented along the x, y, and z axes. They have l = 1. P orbitals are not denoted as sp or d; they are simply labeled as px, py, and pz.

d Orbitals: These have complex, multi-lobed shapes with five different orientations. They have l = 2 and are further divided into subshells, which can be labeled as dxy, dxz, dyz, dx²-y², and dz².

sp Orbitals: These are hybrid orbitals formed by mixing one s orbital and one p orbital. They have a linear shape and are typically found in molecules with sp hybridization, such as linear molecules like BeH2 or CO2.

For more such question on orbitals visit:

https://brainly.com/question/20319149

#SPJ6

Arrange the following in order of increasing boiling point: RbF, CO2, CH3OH, CH3Br. Explain your reasoning.

Answers

The following is the order from lowest boiling point to highest based on the types of forces these compounds have: CO2 CH3Br CH3OH RbF CO2 is a nonpolar molecular compound. The only intermolecular force present is a relatively weak dispersion force, because of the small molar mass. CO2 will have the lowest boiling point. ď‚· CH3Br is a polar molecule. Dispersion forces (present in all matter) and dipoleâ’dipole forces will be present. This compound has the next highest boiling point. ď‚· CH3OH is a polar molecule, which can form hydrogen bonds; these are especially strong dipole-dipole attractions. Dispersion forces and hydrogen bonding are present to give this substance the next highest boiling point. ď‚· RbF is an ionic compound. Ionâ’ion attractions are much stronger than any intermolecular force. RbF has the highest boiling point

We can arrange the given compound in order of increasing boiling point as CO2 <CH3Br <CH3OH <RbF.

The compound with the highest boiling point is RbF, since it has the strongest intermolecular force.

CH3OH, CH3Br can doesn't posses strong intermolecular force compare to RbF, and they can form hydrogen bond.

CO2 can form weak dispersion force and it's a non polar compound and it posses the boiling point.

What is boiling point?

This is the temperature at whereby the vapor pressure of a liquid equals the pressure.

At this temperature, the liquid changes into a vapor and the weaker the force of attraction the lower the boiling point.

Learn more about boiling point at :

https://brainly.com/question/14008526

Each degree on the Kelvin scale equals:
1°C
10°C
no relationship (different scale)
100°C

Answers

A change of 1 Kelvin is exactly the same as a change of 1 degree Celsius.

Answer is: 1°C.

A change of 1 Kelvin is the same as a change of 1 degree Celsius.

The temperature T in degrees Celsius (°C) is equal to the temperature T in Kelvin (K) minus 273,15: T(°C) = T(K) - 273.15.

For example:

T(He) = 4,2 K.

T(He) = 4,2 K - 273,15.

T(He) = -268,95°C.

The Celsius scale was based on 0°C for the freezing point of water and 100°C for the boiling point of water at 1 atm pressure.


Retry: 1.Examine Record A. Use the three basic rules to figure out the ages of the layers. In Chart A, list the layers from youngest to oldest with the youngest layer in the first row.

Answers

Answer:

C, E, H, A, B, F, K, D, L, G, J, I.

Explanation:

Hello,

In this case we are dating each layer based on its deepness as the deeper the layer is, the farther back in time it is (older). In such a way, the youngest layer is C and henceforth by going down, we find older and older layers no matter if the layer is horizontal or diagonal, we just go down by straight line, therefore, from youngest to oldest, the order turn out into:

C, E, H, A, B, F, K, D, L, G, J, I.

Best regards.

Other Questions
In which of the following is positive work done by a person on a suitcase 4(x+8)-4=34-2x steps A mangrove swamp is more likely to exist along the shores of which location? (A) Southern Argentina(B) The Great Lakes(C) Washington(D) Florida Why did William Penn establish his colony in New Jersey? How do you write 1/10 in percent When we are determining food quality, sensory evaluation is the most common method. True False Find the outlier in the data: 38, 38, 18, 28, 36, 30, 39, 32. How does the outlier affect the mean? If necessary, round to the nearest tenth. 43; raises it by 1.5. 18; lowers it by 2. 43; lowers it by 1.5. 18; raises it by 2. Find the value of x so that the function has the given value.j(x)=4/5x+7; j(x)=5 How are the variables on the graph related? Answer choices: A. As speed decreases, height stays constant. B. As speed decreases, height increases. C. As speed increases, height decreases. D. As speed increases, height increases. which term directly results in greater need for resources,jobs, health care, and educationA.population distributionB. globalizationC.population growthD. market economy there are 24 students in science class. mr james will give each pair of students 3 magnets . so far ,mr James has given 9 pairs of students their magnets . how many magnets doses mr james need sp that each pair of students has exactly 3 magnes? You put $550 in an account that earns 4.4% simple interest per year. How much interest do you earn in 6 month$1.21$12.10$121.00$145.20 Nike _________________ its products in foreign countries, where labor is cheap and production sites are owned by other companies. this strategy allows nike to experiment in new markets without incurring large start-up costs involved with building their own production facilities. Which best describes a conflict and its resolution in the glass of milk 2.For the circle with equation , answer each question.(a)What are the coordinates of the center?(b)What are the radius and diameter of the circle?(c)Graph the circle. Based on this excerpt from "How Much Land Does a Man Need?" by Leo Tolstoy, how is the author using the character of the Devil?"Of course our work is rough and coarse. But, on the other hand, it is sure; and we need not bow to any one. But you, in your towns, are surrounded by temptations; to-day all may be right, but to-morrow the Evil One may tempt your husband with cards, wine, or women, and all will go to ruin. Don't such things happen often enough?"Pahom, the master of the house, was lying on the top of the oven, and he listened to the women's chatter. "It is perfectly true," thought he. "Busy as we are from childhood tilling mother earth, we peasants have no time to let any nonsense settle in our heads. Our only trouble is that we haven't land enough. If I had plenty of land, I shouldn't fear the Devil himself!"The women finished their tea, chatted a while about dress, and then cleared away the tea-things and lay down to sleep. But the Devil had been sitting behind the oven, and had heard all that was said. He was pleased that the peasant's wife had led her husband into boasting, and that he had said that if he had plenty of land he would not fear the Devil himself. "All right," thought the Devil. "We will have a tussle. I'll give you land enough; and by means of that land I will get you into my power."as a foilas an antagonistas a dynamic characteras the protagonist the average length of people living in the same environment is called How does the law of conservation of mass apply to this reaction Mg+HCL->H2+MgCl2? If sin = -1/2 and is in Quadrant III, then tan = _____. Which of the following best illustrates a pair of sentences that are joined by an understood relationship?A. Luke put three dollars into the office football pool. He was looking forward to vacation.B. Detective Smiley scanned the dim hallway. He pulled his pistol from its holster.C. It rained for ten days and ten nights. Grandmother Grady called a company to drill a well.D. I don't understand a word you said. Have you taken a course in English literature? Steam Workshop Downloader