How can you tell if a molecule has a dipole moment?

Answers

Answer 1

How do you know if a molecule has a dipole moment?

The larger the difference in electronegativity between the two atoms, the more electronegative that bond is. To be considered a polar bond, the difference in electronegativity must be large. The dipole moment points in the direction of the vector quantity of each of the bond electronegativities added together


Related Questions

In a neutralization reaction, ______
and hydroxide ions react to form
______.

Answers

Explanation:

A reaction in which a hydrogen ion and hydroxide ion reacts and results in the formation of water is known as a neutralization reaction.

Basically in a neutralization reaction, a salt is also formed when an acid and a base reacts together along with formation of water and pH of a neutralized reaction is equal to 7.

For example, [tex]H^{+} + OH^{-} \rightarrow H_{2}O[/tex]

Therefore, we can conclude that in a neutralization reaction, hydrogen and hydroxide ions react to form water.

BRAINLIEST + 20 POINTS!!!
Which of the following statements is true about energy quantization at the atomic level?

The energy of a photon depends on the frequency of the emission.
The energy of a photon depends on the mass of the neutrons and protons.
An electron can only move from a lower energy level to a higher energy level.
An electron may emit or absorb a quarter of a photon during energy level transitions.

Answers

Answer:

The energy of a photon depends on the frequency of the emission.

Explanation:

E = hν  

where E is the energy of a photon, ν   is the frequency of photon and h is Planck’s constant.  

Energy of a photon is quantized and is directly proportional to the frequency of the emission.  

Quantized energy of a photon explained the photoelectric effect. It was proven that light not has wave nature but particle nature as well. This later gave rise to wave particle duality of light waves.

What feature is similar among all organisms?
A. They are composed of one or more cells that function to sustain life.
B. They are composed of multiple tissue types.
C. They can consume other organisms to create energy.
D. They can transform sunlight into food for sustenance.

Answers

The answer is A because all living things must contain a cell to be able to sustain life within

All organisms are composed of one or more cells that perform the basic functions of life.

Cells are the fundamental units of life.

General formula for double replacement reaction​

Answers

The general formula for “Double Replacement” would beAB+CD —> AD+CB.

I really hope this helps you.

H2 + O2 ----> H2O What is the mole ratio of hydrogen to water?

Answers

2:2

ioudhfihsOIUDHFIUOSAHD

The mole ratio of reactants and products is learned by comparing the coefficients of the balanced equation. The current equation is unbalanced, so adding some coefficients to help balance the reactants and products is necessary.

2H2 + O2 —— 2H2O

In this equation, you can count the number of hydrogens and oxygens on each side to verify that there are the same on each. Now, compare the coefficients:

2H2:2H2O

2:2

The mole ratio of hydrogen to water is 2:2, simplified to 1:1. Choosing which ratio is to be used is dependent on the context of the question, however both are technically correct.

Write an equation for the decomposition of Al(ClO3)3 , To produce aluminum Chloride and Oxygen?
Thank you :)

Answers

Answer:

2Al(ClO₃)₃ → 2AlCl₃ + 9O₂.

Explanation:

Aluminium chlorate is decomposed to produce aluminium chloride and oxygen according to the equation:

2Al(ClO₃)₃ → 2AlCl₃ + 9O₂.

That every 2.0 moles of aluminium chlorate is decomposed to produce 2.0 moles of aluminium chloride and 9.0 moles of oxygen.

The decomposition of aluminium chlorate ([tex]Al(ClO_3)_3[/tex]) to produce aluminium chloride ([tex]AlCl_3[/tex]) and oxygen gas ([tex]O_2[/tex]) can be represented by the following balanced chemical equation:

[tex]\[ 2 \text{Al(ClO}_3)_3 \rightarrow 2 \text{AlCl}_3 + 9 \text{O}_2 \][/tex]

To write the equation, we start with the reactants and products given in the question. Aluminium chlorate ([tex]Al(ClO_3)_3[/tex]) decomposes into aluminium chloride ([tex]AlCl_3[/tex]) and oxygen gas ([tex]O_2[/tex]). We need to ensure that the equation is balanced, meaning that the number of atoms of each element must be the same on both sides of the equation.

Starting with the aluminium atoms, we have one aluminium atom on both sides of the equation, so aluminium is balanced.

Next, we look at the chlorine atoms. There are three chlorine atoms in each [tex]Al(ClO_3)_3[/tex] molecule, for a total of six chlorine atoms in [tex]2Al(ClO_3)_3[/tex]. To balance the chlorine atoms on the product side, we need six chlorine atoms in the aluminium chloride, which gives us [tex]AlCl_3[/tex] for each aluminum atom, hence [tex]2AlCl_3[/tex].

Finally, we balance the oxygen atoms. There are nine oxygen atoms in each [tex]2Al(ClO_3)_3[/tex] (since there are three oxygen atoms in each [tex]ClO_3[/tex]group and we have six [tex]ClO_3[/tex] groups in total). To balance the oxygen atoms, we need nine oxygen atoms on the product side, which means we need 9/2 molecules of [tex]O_2[/tex], since each [tex]O_2[/tex] molecule contains two oxygen atoms. However, because we cannot have half a molecule, we multiply the entire equation by 2, resulting in 9 molecules of [tex]O_2[/tex].

This gives us the balanced equation:

[tex]\[ 2 \text{Al(ClO}_3)_3 \rightarrow 2 \text{AlCl}_3 + 9 \text{O}_2 \][/tex]

This equation correctly represents the conservation of mass, with an equal number of each type of atom on both sides of the reaction.

what is the mass of 50 carbon atoms? What is the mass of 50 hydrogen atoms?​

Answers

I’m not sure, but I would think it is 50x12 for each. So 600 amu for each

The mass of 50 carbon atoms is   [tex]\bold{99.07\;\times\;10^{-23}}[/tex] amu, and the mass of 50 hydrogen atoms is [tex]\bold{8.30\;\times\;10^{-23}}[/tex] amu.

Computation for the mass of carbon and hydrogen atom

The mass of an atom can be given by the Avogadro law.

According to the Avogadro law, 1 mole of an element is composed of [tex]\rm 6.023\;\times\;10^{23}[/tex] atoms. The molar mass of an element is the mass of a mole of substance.

Thus, the mass of atoms can be given by:

[tex]\rm 6.023\;\times\;10^2^3\;atoms=molar\;mass[/tex]

Mass of 50 carbon atoms can be given as:

Molar mass of carbon is 12 amu.

[tex]\rm 6.023\;\times\;10^2^3\;Carbon\;atoms=12.01\;amu\\\\50\;Carbon\;atoms=\dfrac{12.01}{6.023\;\times\;10^2^3}\;\times\;50\;amu\\\\50\;Carbon\;atoms=99.70\;\times\;10^{-23}\;amu[/tex]

The mass of 50 carbon atoms is [tex]99.70\;\times\;10^{-23}[/tex] amu.

The mass of 50 hydrogen atoms is given by:

Molar mass of hydrogen is 1 amu.

[tex]\rm 6.023\;\times\;10^2^3\;Hydrogen\;atoms=1\;amu\\\\50\;Hydrogen\;atoms=\dfrac{1}{6.023\;\times\;10^2^3}\;\times\;50\;amu\\\\50\;Hydrogen\;atoms=8.30\;\times\;10^{-23}\;amu[/tex]

The mass of 50 hydrogen atoms is [tex]8.30\;\times\;10^{-23}[/tex] amu.

Learn more about mass of an atom, here:

https://brainly.com/question/5566317

what causes matter to exist in three different states​

Answers

NOT 100% SURE

Thermal Energy..?

When I think of three states of matter I think of water as an example:

• Adding extreme heat to the liquid form of water can turn it into gas.

• Adding heat to ice can turn it into the liquid form of water.

• Freezing the liquid form of water can turn it into ice.

I would say temperature (thermal energy) has an effect of the different states of matter.

The Big Bang theory states that ________.

A.The universe will explode

B.The universe began as a small,dense ball of matter

C.The universe is contracting

D.The universe cannot expand anymore

Answers

I believe the correct answer is B

Final answer:

The Big Bang theory posits that the universe began as a highly compressed, hot, and dense state roughly 13.7 billion years ago, later expanding and cooling to its current form, with the cosmic microwave background (CMB) serving as a key piece of evidence.

Explanation:

The Big Bang theory states that the universe began as a small, dense ball of matter. This is often described as a hot, dense state, which then underwent rapid expansion and cooling to arrive at its present condition. According to this theory, the universe started about 13.7 billion years ago, and it continues to expand and cool today. The cosmic microwave background (CMB) is a critical piece of evidence supporting the theory, as it is the redshifted afterglow of the Big Bang and can be observed from any direction in space.

Contrary to the Big Bang being an explosion of matter into space, it is more accurately the expansion of space itself, with the universe's density decreasing over time as it expands. This expansion continues to be a subject of study, including whether the universe will eventually stop expanding and begin contracting in a 'big crunch' or continue to expand indefinitely, an idea connected to concepts like the cosmological constant and dark energy.

The number of grams of H2 in 1470 mL of H2 gas. ​

Answers

Final answer:

To find the number of grams of H2 in 1470 mL of H2 gas, convert the volume from mL to L, calculate the number of moles using the molar volume at STP, and then find the mass of H2 gas using stoichiometry and the molar mass of H2.

Explanation:

To determine the number of grams of H2 in 1470 mL of H2 gas, we need to use the concept of molar mass and stoichiometry. The molar mass of H2 is 2 g/mol, which means that one mole of H2 gas weighs 2 grams. We can use the molar volume of gases at STP (standard temperature and pressure), which is approximately 22.4 L/mol, to convert the volume of the gas into moles. From there, we can use stoichiometry to determine the mass of H2 gas in grams.

First, convert the volume of the gas from milliliters to liters by dividing by 1000. 1470 mL is equal to 1.47 L. Using the molar volume of gases at STP, we can find the number of moles: 1.47 L / 22.4 L/mol = 0.0656 mol.

Since each mole of H2 gas weighs 2 grams, the mass of H2 gas in grams is: 0.0656 mol * 2 g/mol = 0.1312 g.

Learn more about Calculating grams of H2 gas in a given volume here:

https://brainly.com/question/28746817

#SPJ11

The number of grams of H₂ in 1470 mL of H₂ gas is calculated to be 0.1312 grams.

To find the number of grams of H₂ in 1470 mL of H₂ gas, we need to use the ideal gas law, which is:

PV = nRT

Where:

P is the pressure (in atm)V is the volume (in liters)n is the number of molesR is the ideal gas constant (0.0821 L·atm/(mol·K))T is the temperature (in Kelvin)

For this calculation, we assume the gas is at standard temperature and pressure (STP; 0°C and 1 atm), where 1 mole of an ideal gas occupies 22.4 L.
First, convert the volume from mL to L:

1470 mL = 1.470 L

At STP, 1 mole of H₂ gas occupies 22.4 L. Thus, the number of moles of H₂ gas is:

n = V / 22.4 L = 1.470 L / 22.4 L/mol = 0.0656 mol

Next, we find the mass using the molar mass of H₂ (2 g/mol):

Mass = n × molar mass = 0.0656 mol × 2 g/mol = 0.1312 g

Therefore, the number of grams of H₂ in 1470 mL of H₂ gas is 0.1312 grams.

Which can be used to prevent initial entry of bacteria into the body

Answers

Washing your hands before eating?

Answer:

Inflammation.

Explanation:

The same reason you would die if your body temperature gets too high. Our bodies are meant to perform at an optimal temperature because the cells within our body perform cellular processes perfectly at that temperature. Same goes with bacteria. At high temperatures, proteins degrade and denature and fail to function. Your membrane transport proteins break apart: you can't get things in or out of your cells. You can no longer establish electron gradients for ATP synthesis: your body can no long provide itself with energy. Your ribosomes denature and fail to carry out protein synthesis: you cannot build new cells to replace the dying ones. You are dead.

Which unit can be used to express the rate of a reaction? A. mL / s B. mL / g C. g / mL D. mL / mol E. s / mL

Answers

Answer:A) mL / s

Explanation:This is the amount of milliliters per second

Which term describes a trace, print, or remain of an organism preserved over time in a rock?

A. skeleton

B. fossil

C. mineral

D. sedimentary rock

Answers

B. Fossil

Why? Well skeleton seems like another answer BUT the definition of a fossil is an imprint of an organism on rock.

Example: A dinosaur presses it’s foot in dirt and it leaves a footprint or ‘fossil’ behind

The term describes a trace, print, or remain of an organism preserved over time in a rock is fossil. Therefore, option B is correct.

What are fossils ?

Any surviving remains, impression, or evidence of a once-living thing from a previous geological epoch is referred to as a fossil. Examples include exoskeletons, bones, shells, animal or microbe imprints in stone, items preserved in amber, hair, petrified wood, and DNA traces. The fossil record is the collection of all fossils.

The majority of fossils are created when a living thing (such as an animal or plant) dies and is swiftly buried by sediment (such as mud, sand or volcanic ash).

The preserved remnants of plants and animals that were submerged in sediments like sand and mud beneath ancient seas, lakes, and rivers are known as fossils. Any preserved sign of life that is typically more than 10,000 years old is considered a fossil.

Thus, option B is correct.

To learn more about the fossils, follow the link;

https://brainly.com/question/6867325

#SPJ2

What happens when a mechanical wave travels through a medium?


A ) Energy is transferred.


B ) Energy is lost.


C ) Energy is gained.


D ) Energy fluctuates.

Answers

Your answer would be Option A. Energy is transferred.

I just took this quiz, and can 100% confirm this is the answer.

Hope this helps! :)  

Final answer:

When a mechanical wave travels through a medium, it transfers energy from one particle to another causing them to vibrate. The particles do not travel with the wave but rather vibrate about a central point.

Explanation:

When a mechanical wave travels through a medium such as air, water, or a solid material, the primary process is the transfer of energy. The mechanical wave causes particles in the medium to vibrate back and forth, thereby transferring energy from one particle to the next. However, it's important to note that while energy is transferred, the particles themselves don't travel with the wave but rather vibrate about a central point. This is different from losing, gaining or fluctuation of energy, but rather it's a consistent transfer of energy from one place to another.

Learn more about Mechanical Waves here:

https://brainly.com/question/24459019

#SPJ11

Which phrase best describes humidity?

Answers

Heat describes humidity

How much energy is equal to 1 kg of mass?

Answers

This implies, for instance, that 1 kilogram of matter is equivalent to an energy E = (1 kg)×(3×108 m/sec)2 = 9×1016 kg m2/sec2. An energy of 1 kg m2/sec2 is known as 1 joule, for short.

Could anyone possible help me?

Answers

#3 question D is Acid Rain

What is number “4” in SiCi4?

Answers

It is a subscript

Also do you mean Cl not Ci. I assume you do because then it means 4 chlorine in that compound.

What is the relationship between reaction rate and reaction time

Answers

Final answer:

Reaction rate and reaction time have an inverse relationship.

Explanation:

The reaction rate refers to how fast a chemical reaction occurs, while the reaction time indicates the duration it takes for the reaction to happen. In general, there is an inverse relationship between reaction rate and reaction time. The faster the reaction rate, the shorter the reaction time, and vice versa. For example, if we compare two reactions, one with a fast reaction rate and the other with a slow reaction rate, the reaction with the fast rate will have a shorter reaction time.

A measurement of how often something occurs in a given time period is _____.
A.) Amplitude
B.) Frequency
C.) Wavelength
D.) Sonic Boom

Answers

frequency

hope this helps :)

How do I balance chemical equations?

Answers

Count the atoms of each element in the reactants and the products. Use coefficients; place them in front of the compounds as needed.

Final answer:

To balance a chemical equation, follow these steps: Determine the correct formulas, count the number of atoms, balance the elements one at a time, check the balance, and reduce coefficients if needed.

Explanation:

In order to balance a chemical equation, you can follow the steps below:

Step 1: Plan the problem. Determine the correct chemical formulas for each reactant and product, and write the skeleton equation.Step 2: Count the number of atoms. Count the number of atoms of each element that appears as a reactant and as a product.Step 3: Balance the elements one at a time. Place coefficients in front of the formulas. Start by balancing elements that only appear in one chemical formula on each side of the equation.Step 4: Check the balance. Ensure that all atoms or polyatomic ions are equal on both sides of the equation.Step 5: Reduce coefficients (if needed). Make sure that all coefficients are in the lowest possible ratio.

For acidic solutions, which element is added to balance half-reactions?

A.
hydrogen

B.
hydroxide

C.
oxygen

D.
nitrogen

Answers

Answer:

We add A Hydrogen

Explanation:

When we have a half-reaction in an acidic media usually we add (H+) hydrogen plus or protons to the reaction to balance in both sides of the reaction the amount of hydrogen.

After this step the next one is equilibrate the charges (e-) and finally we add the two half-reactions to write a short version

Answer:

hydrogen

Explanation:

Plato

Which of the following are true about electricity and magnetism? I. An electric current can be produced by a changing magnetic force. II. A magnetic force can be produced by an electric current. III. Energy cannot be transferred by an electric current. IV. A magnetic force can attract a metal object only if the object is touching the magnet.

Answers

Answer;

I. An electric current can be produced by a changing magnetic force.

II. A magnetic force can be produced by an electric current.

Explanation;Electric current is the net movement of electric charges in a single direction, measured in amperes (A).Electric current produces a magnetic field. Electric currents and magnets exert force on each other, and this relationship has many uses. A temporary magnet, known as an electromagnet, can be made by passing electric current through a wire that is coiled around an iron core. A magnet can also be used to generate electricity. When a wire moves within a magnet's magnetic field, electricity is produced.

Answer:

I. An electric current can be produced by a changing magnetic force.

II. A magnetic force can be produced by an electric current.

A 25.5 ml aliquot of HCl of unknown concentration was titrared with .113 M NaOH. It took 51.2 ml of the base to reach the endpoint of the titration. The concentration (M) of the acid was ?

Answers

Answer;

0.227 M

Explanation;

Volume of HCl = 25.5 mL or 25.5 / 1000 => 0.0255 L

Molarity or concentration of NaOH  = 0.113 M

Volume of NaOH  = 51.2 mL / 1000 = 0.0512 L

Number of moles NaOH:

Moles = Molarity x Volume

            = 0.113 x  0.0512

            = 0.0057856 moles of NaOH

From the equation we can obtain the mole ratio:

HCl + NaOH = NaCl + H2O

1 mole HCl : 1 mole NaOH

Therefore;

Moles of  HCl : 0.0057856 moles NaOH

Hence; moles of HCl  =  0.0057856 x 1 / 1

                                    =  0.0057856 moles of HCl

Molarity of  HCl = moles of HCL / Volume of HCl

                         M =  0.0057856 / 0.0255

                              = 0.227 M

Calculate the theoretical yield of hydrogen gas (in L) at 295 K for a reaction of 1.50 g magnesium with excess hydrochloric acid. If 1.205 L of gas is produced, what is the percent yield of the reaction?

Answers

Answer:

80.33 %.

Explanation:

For the reaction:

Mg(s) + 2HCl(aq) → MgCl₂ + H₂.

Every 1.0 mole of Mg is dissolved in 2.0 moles of HCl and produce 1.0 mole of MgCl₂ and 1.0 mol H₂.To get the theoretical yield of hydrogen gas (in L):We want to calculate the no. of moles of Mg in 1.50 g:

n = mass/atomic mass = (1.50 g)/(24.3 g/mol) = 0.062 mol.

Using cross multiplication:

1.0 mol of Mg produces → 1.0 mol of hydrogen gas.

0.062 mol of Mg produces → 0.062 mol of hydrogen gas.

∵ PV = nRT.

∴ V of hydrogen (the theoretical yield) = nRT/P = (0.062 mol)(0.082 L.atm/mol.K)(295.0 K)/(1.0 atm) = 1.50 L.

The actual yield of the reaction = 1.205 L.

∴ The percent yield of the reaction = (actual yield)/(theoretical yield) x 100 = (1.205 L)/(1.50 L) x 100 = 80.33 %.

Final answer:

The theoretical yield of hydrogen gas at 295 K from reacting 1.50 g of magnesium with excess hydrochloric acid is 1.484 L. The percent yield, with an actual yield of 1.205 L of gas, is 81.19%.

Explanation:

Calculating Theoretical and Percent Yield

The student has asked to calculate the theoretical yield of hydrogen gas (in L) at 295 K for a reaction of 1.50 g magnesium with excess hydrochloric acid and then to determine the percent yield of the reaction given that 1.205 L of gas is produced.

To solve this, we first need to find the number of moles of magnesium (Mg) that will react. The molar mass of Mg is 24.305 g/mol, so:

Number of moles of Mg = Mass of Mg / Molar mass of Mg

= 1.50 g / 24.305 g/mol

= 0.0617 mol

According to the balanced chemical reaction, Mg(s) + 2 HCl(aq) → MgCl₂(aq) + H₂(g), 1 mole of Mg produces 1 mole of H₂. Therefore, the number of moles of H₂ will also be 0.0617 mol.

Now, using the ideal gas law, PV = nRT, where P (pressure) = 1 atm (standard pressure), V is the volume, n is the number of moles of gas, R is the ideal gas constant (0.0821 L·atm/K·mol), and T is the temperature in Kelvin:
= 0.0617 mol × 0.0821 L·atm/K·mol × 295 K / 1 atm

= 1.484 L

This is the theoretical yield. The percent yield is calculated as:

Percent yield = (Actual yield / Theoretical yield) × 100%

= (1.205 L / 1.484 L) × 100%

= 81.19%

how many atoms are in 1.5 mole of iron?

Answers

How many iron atoms are present in a piece of iron weighing 95.8 g? , shows that its molecules contain one S atom and two O atoms; calculate its molar mass. molecules, which consist of 6.02 x 1023 S atoms and 2(6.02 x 1023) O atoms. S): Concept 4.
Final answer:

There are approximately 9.033 x 10^23 atoms in 1.5 moles of iron. This is calculated by multiplying the number of moles by Avogadro's number.

Explanation:

The subject at hand involves calculations using Avogadro's number. Avogadro's number (6.022 x 1023) represents the number of atoms in a single mole of any substance. To calculate the number of atoms in a particular quantity of moles, you only need to multiply the amount of moles by Avogadro's number. Therefore, the number of atoms in 1.5 moles of iron would be 1.5 times Avogadro's number.

So, 1.5 (moles of iron) x 6.022 x 10^23 (atoms/mole) = 9.033 x 10^23 atoms of iron. Hence, there are about 9.033 x 10^23 atoms in 1.5 moles of iron.

Learn more about Mole to atom conversion here:

https://brainly.com/question/19875795

#SPJ3

How many atoms are in mercury (ii) biocarbonate?

Answers

Alias: Mercuric Hydrogen Carbonate; Mercury(II) Bicarbonate

Formula: Hg(HCO3)2

Molar Mass: 322.6237

given the equation Mg +2HCL --> MgCL2+H2, how many moles of hydrochloric acid are needed to react with O.50 mole of magnesium ?

Answers

Since mole ratio of magnesium to hydrochloric acid is 1:2, the answer is 1 mole of HCL.

The moles of hydrochloric acid are needed to react with O.50 mole of magnesium is 1 mole

What are moles ?

The amount of substance which contains same number of atoms, molecules or ions as the number of atoms present in 12 g of carbon (C-12) is called a mole.

1 mol = 6.023 * 10²³ atoms

In the question

An equation Mg +2HCl --> MgCl₂+H₂ is given

It is asked that  moles of hydrochloric acid  needed to react with O.50 mole of magnesium = ?

It can be seen that the equation given is balanced as the number of atoms of the elements in the reactants is equal to the atoms in the products.

The mole ratio of Mg to HCl is 1 : 2

The mole of Magnesium is 0.5

Therefore the mole of HCl required to react will be  1 mol

To know more about Mole

https://brainly.com/question/26416088

#SPJ2

Energy can generally be considered to be either kinetic energy or potential energy. Some specific forms of energy, such as electrical, magnetic, and gravitational energy, can operate in the space around objects and affect other objects that come near. In these examples,
A.
energy is continuously created.
B.
energy is continuously destroyed.
C.
energy exists in a field.
D.
all of these

Answers

C) Energy exists in a field.

C energy exists in a field

1. Which elements are known as d-block elements?
transition metals
alkali earth metals
halogens
alkali metals

Answers

The d-block elements are found in groups 3, 4, 5, 6, 7, 8, 9, 10, 11, and 12 of the periodic table.

So your answer is A) Transition metals

Answer:

The answer is Transition metals they are the d-block elements.

Explanation:

The transition metals are called d-block due to these elements have electrons in the outer orbital d.

Orbitals in atoms: The atoms have electrons that are negative charged particles moving around the nucleus. The electrons are distributed in orbitals, each orbital has an energy value and representations with letters the lowest energy orbital is s, then p, d and f.

The d-orbital due to its energetic value can hold up to 10 electrons and these elements are important due to they are required for many organic, inorganic, biological and technological process.

For example: a d-block element is the Iron Fe who has magnetic properties and it is required for the human body to form hemoglobin ( protein needed for oxygen transport in cells.

Other Questions
Factor completely.4p+36p+81Question 3 options:(2p9)2(2p+9)2(4p+6)2 RateMinutesMiles0053107151220172521The table shows how many miles Brandon has traveled after the specified period of time. Find Brandon's rate in miles per minute between 15 and 20 minutes. A)1 mile per minute B)5 miles per minute C)12 miles per minute D)17 miles per minute how did the U.S. government use propaganda during ww2 Read the excerpt from "Civil Peace" by Chinua Achebe.Jonathan Iwegbu counted himself extraordinarily lucky. "Happy survival! meant so much more to him than just a current fashion of greeting old friends in the first hazy days of peace. It went deep to his heart. He had come out of the war with five inestimable blessingshis head, his wife Marias head and the heads of three out of their four children. As a bonus he also had his old bicyclea miracle too but naturally not to be compared to the safety of five human heads.What can you most clearly determine about the storys setting from this excerpt?a. The story takes place right before a war.b. The story takes place in the middle of a war.c. The story takes place right after a war.d. The story takes place years before the start of a war. sara has 24 sweets tim also has 24 sweets sara gives tim x sweets sara then eats 7 of her sweets tim then eats half of his sweetswrite an expression for the number of sweets sara and tim have now Read the excerpt below and answer the question. The Dust Bowl years spanned 1930-1936, when a million acres of farmland across the Plains became unusable due to severe drought and over-farming. When Dust Bowl conditions devastated farmers, many defaulted on their bank loans, which helped lead to the widespread bank failure. Franklin D. Roosevelt called for restoration in America with a promise that there are better days ahead. What is the best definition you can infer for the word "restoration" from the excerpt above? bringing back to former position or condition re-establish monarchy replacement giving back Which of the following is not a typical type of weather data collected? Help me please. FUN AND EASY assignment!! please check it out!!!Imagine and create a character that lived and experienced the cold war!Part B 1. What was the first time you remember hearing about the Soviet Union (or the USSR) and its conflict with the United States? Tell me about it. 2. What do you remember seeing or reading in the news about the Cold War? 3. What books did you read or movies did you watch that villainized the Soviet Union or dealt with the Cold War? How did they shape your impressions at that time? 4. What were you taught in school and at home about the Soviet Union? What did your school and family teach about nuclear threats and nuclear war? 5. Were you or any of your family members ever afraid that there would be a hot war or nuclear war between the United States and the Soviet Union? When did you feel that way? If yes, did you do anything to prepare or get ready for it? 6. What aspects of the Space Race do you remember? Was "Space Race" a phrase that you remember using at the time? What did it mean to you? 7. How was the rivalry between the United States and the Soviet Union promoted in sports? Can you think of any specific examples? 8. Do you remember the Berlin Wall coming down? How did it make you feel? How have your feelings about that era changed since 1989 and the Berlin Wall coming down? 9. How do you think future generations will remember the Cold War? What lessons should students today take away from the Cold War? 10. How does psychological warfare today compare to psychological warfare during the Cold War? 11. Where you a participant of the cold war? 12. Do you think the cold war was necessary? What helps a literary critic determine a story's complex theme? A. The public's reaction to the story B. The number of characters in a story C. The order of events within the story D. The specific details within the story What is the best definition for a paragraph's topic sentence? a sentence that begins the paragraph a sentence that helps the reader to organize her thoughts a sentence that tells the reader what will be discussed a sentence that is the first sentence of the paragraph Which of the following is the best example of kinetic energy? A book sitting on a bookshelf A golfer preparing to putt the ball A race car in position at the start line A satellite orbiting the Earth Predict how many times you will roll a number less than 5 if you roll a standard number cube 250 times PLEASE HELP ME ||Thousands of years ago the climate of the Bering land bridge was A. subarctic B. semiarid C. tropics D. tundra Lawrence is 54 years old, and he notices that now he cannot eat as much as he did when he was in his thirties without gaining weight. Why is this happening? For every decade past the age of 30, the body's basal metabolism declines by 1% to 2% due to the steady decrease of lean body mass. For every decade past the age of 30, the body's capacity for physical activity declines by 1% to 2% due to the steady decrease of lung function. For every decade past the age of 30, the body's response to the thermic effect of food declines by 1% to 2% due to the increasing internal body temperature. All of the above are reasons why Lawrence cannot eat as much in his fifties as he did in his thirties without gaining weight. Which letter indicates the amplitude of the wave?a. Ab. Bc. Cd. Dis it b? What was the significance of the Zimmerman telegram and how did it contribute to the u.s involvement in world war 1 High School Grade 9.Can anyone please help me with this Grade 9 World History Question?I need an answer soon as possible. Place the following events in order. These events lead to the outbreak of World War II in Europe. Adolf Hitler establishes the Third ReichGreat Britain and France declare war on GermanyGermany annexes AustriaGermany invades Poland Germany and the Soviet Union establish the Nazi-Soviet PactMunich Conference/German annexation of SudetenlandGerman invasion of Czechoslovakia Hitler sends German troops to the Rhineland(1 - first event, 8 - last event) What does the graph show about the distribution of income during the late 1800s?a) Most people were in the low income bracket and only a few earned large incomes.B) Most people were in the high income bracket and only a few had low incomes.C )The entire population earned low incomes.D )The entire population earned high incomes. Complete the passage using appropriate adjectives or adverbs.Antonio, Carla, Miguel y Lola trabajan __________ en la mudanza. Es __________ para Antonio y Carla levantar los muebles porque son muy fuertes. Pero Miguel y Lola no son muy fuertes y no pueden levantar los muebles __________. Ellos levantan los muebles __________. Despus de trabajar, todos quieren sentarse en sillones __________. Identify which of the following molecules can exhibit hydrogen bonding as a pure liquid. Steam Workshop Downloader