How many lines of symmetry are
found in a regular polygon with 40

Answers

Answer 1
This is assuming that 40 refers to sides.

Since 40 is an even number, you can have lines of symmetry going from any vertex to the opposite one. Since there can be two identical lines, we just cut in half 40 to 20 so there are no repeats. We can do this for halfway between two vertices as well, so that's another 20. Twenty  + 20 = 40 and thus, your answer is 40 lines of symmetry.
Answer 2
Final answer:

A regular polygon has the same number of lines of symmetry as it has sides. Therefore, a regular polygon with 40 sides will have 40 lines of symmetry.

Explanation:

In Mathematics, symmetry is a significant aspect when dealing with geometric figures, such as polygons. In a regular polygon, the number of lines of symmetry is equal to the number of sides. Therefore, a regular polygon with 40 sides will have 40 lines of symmetry.

This is because, in a regular polygon, all sides and angles are equal, meaning it can be reflected or folded over each of its sides and still remain the same shape. So, you can draw a line from each vertex to the opposite side (or vertex in some cases) and get a perfect fold or reflection.

Remember, this is only true for regular polygons, as irregular polygons won't have the same number of lines of symmetry because their sides and angles may not be equal.

Learn more about Symmetry in Regular Polygons here:

https://brainly.com/question/33820017

#SPJ2


Related Questions

in a survey respondents were asked which type of movie they watched most often. the bar graph shows how many males and how many females said they watched each type of movie most often.

how many more males said they watched action movies than drama movies

2
4
5
8

Answers

males that watched action movies : 13
males that watched drama movies : 5

so there are (13 - 5) = 8 more that watched action then drama

Answer:

Option D) 8

Step-by-step explanation:

We are given the following information in the question:

A bar graph is given that shows how many males and how many females said they watched each type of movie most often.

To find:

We have to find that how many males said that they watched action movies than drama movies .

In the bar graph:

Number of action movies watched by males = 13

Number of drama movies watched by males = 5

Number of males males said that they watched action movies than drama movies  = 13 - 5  =  8

Males watched 8 action movies more than the drama movies.

Hence, the correct option is D.

A rabbit lure on a greyhound racetrack is set to travel once around the track at 50 feet per second, and then its speed is increased to 65 feet per second for the second loop around the track. If the total time it takes for the lure to go around the track twice is 184 seconds, what is the distance once around the track?

Answers

184 sec = Circumference / 50 fps + Circumference / 65 fps 
184 = 65 Circumference/3250 + 50 Circumference/3250 
184 = 115 Circumflex/3250 
598000 = 115 Circumflex 
Circumflex = 5200 ft
the answer would be 5200ft

The equations y = -0.38x + 56.6 and y = 0.38x + 43.4 represent the percent of men and women, respectively, receiving bachelor's degrees, where x is the number of years since 1968. in approximately what year did the same percent of men and women receive bachelor's degrees?

Answers

Begin by using simultaneous equations to find the values of x and y. 

y=-0.38x+56.6
y=0.38x+43.4 

-0.38x+56.6=0.38x+43.4 
-0.38x-0.38x=-56.6+43.4 
-0.76x=-13.3 
x=-13.3/-0.76 
x=17.5 

y=0.38(17.5)+56.6
y=63.25 

Knowing that the initial year was 1968, add 17.5 years to find to find out when the same percent of men and women received a bachelor's degree. 

1968+17.5= 1985.5 

So, in the year 1985 and half, both men and women got the same number of bachelor's degrees. 

Hope I helped :) 

If the decay of 742 mg of an isotope is described by the function A(t)= 742e-0.03t, where t is time in years. Find the amount left after 84 years. Round your answer to the nearest mg. 

Answers

57.701 mg before rounding

Answer:

The amount left after 84 years is 59.70 mg.                        

Step-by-step explanation:

Given : If the decay of 742 mg of an isotope is described by the function [tex]A(t)= 742e^{-0.03t}[/tex], where t is time in years.

To find : The amount left after 84 years?

Solution :

The function of decay of 742 mg of an isotope is given by,

[tex]A(t)= 742e^{-0.03t}[/tex]

We have to find the amount left after 84 years.

i.e. put t=84 in the given function,

[tex]A(84)= 742e^{-0.03\times 84}[/tex]

[tex]A(84)= 742e^{-2.52}[/tex]

[tex]A(84)= 59.701[/tex]

Therefore, The amount left after 84 years is 59.70 mg.

I brought 1 1/4 lbs of grapes. 2 1/2 lbs of cherries and 2lbs of bananas. How much total pounds of fruit did i buy?

Answers

First, add the whole numbers together:
1 + 2 + 2 = 5
Now, add the fractions together:
1/4 = 2/8
1/2 = 4/8
2/8 + 4/8 = 6/8 or 3/4
Add your two amounts together to get:
5 3/4 lbs of fruit

Hope this helps!! :)
1 + 2 + 2 = 5

1/4 + 1/2

1/4 + 2/4 = 3/4

The answer will be 5 3/4

Hope I helped

Triangle A′B′C′ is the image of triangle ABC after a dilation. What is the scale factor of the dilation?

Answers

Unfortunately, I can't really explain it that well, but AB is 6, and A'B' is 2.
6 / 3 = 2
BC is 3, and B'C' is 1.
3 / 3 = 1
Therefore the dilation factor would be 1/3.

Hope this helps! :)

Antonio purchased adult and child tickets for the fair. Tickets cost $29.35 for each adult and $17.45 for each child. Let x represent the number of adult tickets purchased and y represent the number of child tickets purchased. Write an expression to represent the total cost of the tickets Antonio purchased.


$29.35y + $17.45x

$29.35x + $17.45y

($29.35 + $17.45)(x + y)

($29.35 - $17.45)(x + y)

Answers

The Correct Answer for your problem is: B

29.35x + 17.45y Is the correct selection. 

identify the like terms 3x,4y,4z,5x

Answers

the like terms are 5x and 3x because they both are apart of the x family !

what is the value for x (5x+15) (3x-3)

Answers

Final answer:

The value of x in the expression (5x+15) (3x-3) is 15x^2 + 30x - 45.

Explanation:

The expression (5x+15) (3x-3) represents the multiplication of two binomials. To find the value of x, we can use the distributive property to simplify the expression:

Multiply the terms within the first set of parentheses: 5x * 3x = 15x^2.Multiply the terms within the second set of parentheses: 5x * -3 = -15x.Multiply the terms between the parentheses: 15 * 3x = 45x.Multiply the constant terms within the parentheses: 15 * -3 = -45.

Putting it all together, we have 15x^2 - 15x + 45x - 45. Combining like terms, the expression simplifies to 15x^2 + 30x - 45.

So, the value for x in the given expression is 15x^2 + 30x - 45.

find f(-5) if f(x) = ???????

Answers

f(x) = Ιx+1Ι

x = -5

Ι-5Ι = 5

so equation is 5+1

answer is 6

Solve for x.

7(x - 3) = 4(x + 5)

Answers

7(x-3) = 4(x+5)

distribute:

7x-21 = 4x+20

add 21 to both sides

7x = 4x +41

subtract 4x from both sides

3x = 41

divide both sides by 3

x = 41 /3 = 13.67 ( repeating 6's) so it can be 13 2/3 as a fraction

the answer is 13 2/3



Can someone please help me with math

Answers

1 meter is 3.3 ft.....so 70 meters is (70 * 3.3) = 231 ft.....so ft per second is 231 ft per second

at 2 seconds.....231 * 2 = 462 ft

Does believing in god increases the probability that god does exist

Answers

No.

If he exists then he does. More or less people "believing" doesn't change a fact.

It's like how we can't see all colors and other creatures can see "more" colors than us; and then having us claim they don't exist. Whether we decide to believe there's more colors we can't see or not will not change the fact of whether there IS or ISNT.

KInda if you love him then he loves personally i dont believe in him but thats everyone decision

Carly is 3 times her brother's age. The sun of their age is no more than 24 years.

Answers

brothers age = x

 carly's age = 3x

3x +x <=24

4x<=24

x<=24/4 = 6

brothers age is x<=6

 

Carly is 18 and her brother is 6

Jeffrey is planning to tile his bathroom. He is taking measurements before he goes to the hardware store to buy the tile. What is the best unit of measure for Jeffrey to use?

Answers

Square feet because it is an ideal unit to measure rooms.

Answer:

i think the answer would be square feet

Step-by-step explanation:


¿A Sandra qué le gusta hacer los viernes?

A A Sandra le gusta comer papas fritas los viernes.

B A Sandra le gusta comer agua los viernes.

C A Sandra le gusta beber pizza los viernes.

D A Sandra le gusta beber galletas los viernes.

Answers

I think the answer is A it makes the most sense. 
A states that "Sandra likes to eat fries on fridays."

B states that Sandra likes to eat water on fridays? (makes no sense)
C states that Sandra likes to drink pizza on fridays? (again makes no sense)
D states that Sandra likes to drink cookies on fridays? (NO SENSE)
Best answer choice is A.
La respuesta correcta es A: A Sandra le gusta comer papas fritas los viernes. Es el unico respuesta que es lógico. La traducción para la frase es: Sandra likes to eat french fries on Friday. 

What is the slope of a line that is perpendicular to the line that goes through (5,4) and (-2,-3)?

Answers

First, let us solve for the slope of the line which it intersects with:

m’ = (y2 – y1) / (x2 – x1)

m’ = (-3 – 4) / (-2 – 5)

m’ = 1

 

The slope of the perpendicular line is the negative reciprocal, therefore:

m = - 1 / m’

m = - 1 / 1

m = -1

 

So the slope of the line is -1.

What's 4.50+4.50+2.39+2.39+1.99? What's the answer minus 25?? pls halp meh '-'

Answers

4.50+4.50=9.00=9
+
2.39+2.39=4.78
+
1.99
=
15.77

15.77-25=-9.23

Solve x + 9 = 18 - 2x

Answers

Add 2x to both sides,
3x+9=18
Subtract 9 from both sides. 3x=9
Divide both sides by 3. 
x=3

The solution to the equation x + 9 = 18 - 2x is x = 3.

What is the solution to the equation?

Given the equation in the question:

x + 9 = 18 - 2x

To solve the equation x + 9 = 18 - 2x, first, collect and combine the x terms on one side of the equation and the constant terms on the other side:

x + 9 = 18 - 2x

Add 2x to both sides of the equation:

x + 2x + 9 = 18 - 2x + 2x

x + 2x + 9 = 18

3x + 9 = 18

Subtract 9 from both sides of the equation:

3x + 9 - 9 = 18 - 9

3x = 18 - 9

3x = 9

Isolate x by dividing both sides by 3:

x = 9/3

x = 3

Therefore, the value of x is 3.

Learn more about equations here: brainly.com/question/14686792

#SPJ6

Terry bought 2 1/2 dozen chocolate chip cookies. She paid $15 for her purchase. If there were 12 cookies in each dozen, what was the cost per cookie?


$0.17


$0.83


$1.25


$0.50

Answers

Your answer Is $0.50 have a nice day my friend 

A sealed rectangular box measuring 8 x 6 x 18 contains 864 sugar cubes, each measuring 1 x 1 x 1. How many sugar cubes are touching the box?

Answers

Final answer:

A total of 456 sugar cubes touching the box.

Explanation:

To calculate the number of sugar cubes touching the box, we must consider the cubes that lie along each face of the box without double-counting the cubes that touch corners and edges.

The box dimensions are 8 x 6 x 18 inches, and each sugar cube is 1 x 1 x 1 inch.

For the top and bottom faces (6 x 18), we have

6*18 = 108 sugar cubes touching the box on each face, totaling 216 for both the top and bottom.

For the front and back faces (8 x 18), since we must exclude the top and bottom rows, we have

(8-2) x (18-2) = 6 x 16 = 96 sugar cubes for one face and 192 for both.

For the sides (8 x 6), excluding the top and bottom rows again, we have

(8-2) x (6-2) = 6 x 4 = 24 sugar cubes on one side and 48 in total for the two sides.

Adding all these together, we get 216 (top and bottom) + 192 (front and back) + 48 (sides) = 456 sugar cubes touching the box.

Remember, this method assumes a single layer of sugar cubes is in direct contact with the inside surface of the box.

What is the numerator of the fraction equivalent to 25/135 that has a denominator of27

Answers

It's 5 because 5/27 is equal to 25/135

What is the expanded equivalent of cos(a – b)?

Answers

cos A cos B - sin A sin B
That should be your answer  Hope this helps

The expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Given that,

The equation is cos(a - b).We need to find the expanded equivalent of the above equation.

Based on the above information, the calculation is as follows:

= cos (a - b)

=  cos(a)cos(b)+sin(a)sin(b)

Therefore we can conclude that the expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Learn more: brainly.com/question/12736770

2x7+2 ?
What does x =

Answers

The x is the variable so you have to find what the equation equals in order too find out what variable x is.  2 x7+2 = 16. So now x = 16

To which graph does the point (8, −2) belong?

Answers

When you're given a list like that, the easiest way to find the answer is to just test the point in each one! Plug in -2 for y and 8 for x, and see which of the inequalities those values satisfy.

Let n be a nonzero integer. find a domain on which f (x) = (1 − xn)1/n coincides with its inverse. hint: the answer depends on whether n is even or odd.

Answers

I believe that the correct equation given is:

f(x) = (1-x^n)^(1/n)

 

From this, we can say that:

 

When n is an odd number then f(x) is cubic root function. The domain is (-infinite, +finite) 
When n is an even number then f(x) is sqrt root function. The domain is (0, +finite) 

What is the smallest number greater than 100 that is :
a)divisible by two ?
b)divisible by ten?
c)divisible by four ?

Answers

I'd start by listing out the multiplies of all three past 100, like this:
102, 104, 106, 108, 110, 112, 114, 116, 118, 120, 122, 124, 126, 128, 130
104, 108, 112, 116, 120, 124, 128, 132, 136
110, 120, 130, 140
Now it's just a matter of finding the number that is the same for all three of them, which is 120.

The smallest number greater than 100 divisible by 2 is 102, divisible by ten is 110, divisible by four is 104.

What is Divisibility Test?

It is an easy method of determining the divisibility of a number by a particular divisor, by just observing the number and not actually dividing it.

The number is 100

A smallest number greater than 100 has to be found which is divisible by 2.

All even numbers are divisible by 2, a number which has 0, 2, 4, 6, 8 at its ones position are divisible by 2.

The smallest number from 100 which is divisible by 2 is 102.

A smallest number greater than 100 has to be found which is divisible by 10.

A number is divisible by 10, if it has 0 at its ones position.

The number after 100 which has 0 at its ones position is 110.

A smallest number greater than 100 has to be found which is divisible by 4.

If last two digit of a number forms 00 or are divisible by 4, then the number is divisible by 4.

The smallest number from 100 which is divisible by 4 is 104.

To know more about Divisibility Rule

https://brainly.com/question/10703980

#SPJ5

Which equation best represents the line graphed above?

Answers

x=2 because for any y value the x value is always 2
the answer is y=2. i hope it helps

If you know that two triangles are congruent, you know that any unmarked corresponding parts are also congruent by

Answers

The SSS, SAS, ASA, AAS, and HL theorems. These theorems state that if any of those combinations of angles or sides are congruent, the triangles are congruent. That means that you can apply it in reverse, because if two triangles are congruent then SSS, SAS, ASA, AAS, and HL (if a right triangle) are also all congruent.

Please help!
This graph shows the amount of rain that falls in a given amount of time.


What is the slope of the line and what does it mean in this situation?


Select from the drop-down menus to correctly complete each statement

The slope of the line is ___

This means that ___ mm of rain falls every ___

Answers

the slope is 5/2. count up 5 then go right 2. this means that 5 mm of rain falls every 2 hrs

To find the slope, we use the formula for slope,

[tex]m=\frac{y_{2}-y_{2}} {x_{2}-x_{1}}[/tex]

Letting the point (2,5) be [tex](x_{1},y_{1})[/tex] and the point (4,10) be [tex](x_{2},y_{2})[/tex].

Now plugging in these values in the formula for slope, we get,

[tex]m=\frac{10-5}{4-2} =\frac{5}{2}[/tex]. The slope is [tex]\frac{5}{2}[/tex].

This basically means 5 mm of rain falls in every 2 hours, or 2.5 mm of rain falls every hour ([tex]\frac{5}{2} =2.5[/tex])


ANSWER: Slope is [tex]\frac{5}{2}[/tex] and 5 mm of rain falls every 2 hours.

Other Questions
A young woman struggles to find enough confidence to participate in the school debate team. She is shy and uncomfortable in crowds and never raises her hand in class. Which type of conflict does this show? Diffusion by which mechanism occurs more rapidly in metal alloys? What is one advantage and one disadvantage of the global economy for American workers? Which structure is found in both cartilage and bone Dave rented a limousine for his wife's birthday. The hourly rate is $70. They used the limousine for 4 hours, plus Dave gave the driver a 20% tip. How much did he spend in total for the hourly charges plus tip? Question options: Dave gave the driver a 20% tip. How much did he spend in total for the hourly charges plus tip?Question 2 options:A) $364B) $224C) $392D) $336 Martin had 7 pounds of grapes left, and he gave away 2/5 of them. Explain how to use compatible numbers to estimate the amount of grapes he gave away. Look at image for deh question. The reading speed of second grade students is approximately normal, with a mean of 88 words per minute (wpm) and a standard deviation of 12 wpm. a) What is the probability a randomly selected student will read more than 95 words per minute? b) What is the probability that a random sample of 12 second grade students results in a mean reading rate of more than 95 words per minute? c) What is the probability that a random sample of 24 second grade students results in a mean reading rate of more than 95 words per minute? d) What effect does increasing the sample size have on the probability? Provide an explanation for this result. Marketing manager joe driscoll stated that the company believes that all brands and product categories can be reinvigorated, actively using cross promotions during the latter stages of __________. how much apple juice does each person get if 6 people share 2 and 2/3 quarts equally certain percent of body fat in human beings A- is not needed and fat should be gotten rid of B- is the same for males and femalesC-is needed by women for reproduction and breastfeeding D- none of the above Which best describes the successes and challenges of modern-day Mexico? A) It has experienced economic growth and a growing middle class, but poverty continues to linger and government corruption remains. B) It has eradicated government corruption and poverty, but economic growth has been stagnant and the middle class remains small. C) It has expanded the economy and increased global trade, but the middle class remains small and an individuals rights have diminished. D) It has dealt with high level government corruption and drug cartel violence, but an individuals rights and the middle class have decreased Heartworms are an example of what types of parasite? What were John Calvins followers in England and an American colonies called? After 4 seconds, the car in Problem # 2 applies the brakes and comes to a full stop after 2 seconds. What is the acceleration of the car and what is the braking distance? #2 A car accelerates from rest at 4 m/s^2. What is the velocity of the car after 4 second? During the cold winter months, the surface of a lake becomes hard ice. This is due to which change of state? Condensation Evaporation Melting Freezing Find each percent increase. From 24 teachers to 30 teachers. When an ocean and a continent plate converge, why does the ocean plate always subduct? byu? Jose is surveying shoppers about their use of the new pharmacy in a grocery store. Which of the following questions in his survey is a statistical question?Who is the manager of the pharmacy? Where is the pharmacy located in the store? How many pharmacists are there in the pharmacy? How many hours do you spend at the pharmacy each month? ABC with vertices A(-3, 0), B(-2, 3), C(-1, 1) is rotated 180 clockwise about the origin. It is then reflected across the line y = -x. What are the coordinates of the vertices of the image?A(. A'(0, 3), B'(2, 3), C'(1, 1)B(. A'(0, -3), B'(3, -2), C'(1, -1)C(. A'(-3, 0), B'(-3, 2), C'(-1, 1)D(. A'(0, -3), B'(-2, -3), C'(-1, -1) Steam Workshop Downloader