Alfred Wegener proposed the continental drift theory in four reasons. One, he hypothesized that the continents were once a giant continent. Two, he observed that there are fossils found of the same kind in the different locations. Three, he found that the edge of opposing continents somehow fits if they are combined, almost like a puzzle. And four, there are glacial scars that are left behind by a larger glacial continent. His greatest weakness of Alfred Wegeners’ continental drift theory was he could not explain what kind of force that caused this continents to move far from each other.
An s sublevel is represented by the quantum number
Antimony (III) sulfide is reacted with excess iron. If 175.6 grams of pure antimony is produced, what mass of antimony (III) sulfide was required to start with? Sb2S3(s) + 3Fe(s)→2Sb(s) +3FeS(s)
Which of the following is the weakest? A. hydrogen bond B. polar covalent bond C. dipole interaction D. ionic bond
The answer is A. Hydrogen bond
Molecules that have nonpolar covalent bonds donot form hydrogen bonds. Strenght. Hydrogen bonds are classified as weak bonds because they are easily and rapidly formed and broken under normal biological conditions.
Hope I helped :)
-Bucky
if the burning of magnesium is incomplete how will this procedural error affect the reported mass of 1) magnesium in magnesium oxide ? explain 2) oxygen in magnesium oxide ? explain
How many moles of KMnO4 can be produced from 0.886 moles of carbon dioxide?
Answer:
2.48
Explanation:
Which of these is a major source of organic compounds? petroleum coal natural gas all of these
Answer: The correct answer is all of these.
Explanation:
Organic compounds are defined as the chemical compounds where one or more carbon atoms are covalently bonded to other atoms of hydrogen, oxygen or nitrogen.
They occur naturally in nature and the main sources of these organic compounds are petroleum, coal and natural gases.
Petroleum are the naturally occurring substances which contain organic compounds in the form of gases, liquid or semi-solid. Thus, they are a major source of organic compound.
Coal is also a form of fossil fuel which are the major source of organic compound.
Natural gas contains hydrocarbons and also is the major source of organic compounds.
Thus, the correct answer is all of these.
Which of the following is an example of applied research? Determining the components of the human genome. Studying the behavior of gorillas when raising their offspring. Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances. Working with carbon to determine its bonding characteristics.
Answer:
Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances.
Explanation:
Applied research refers to research targeted at solving a specific problem in the society. Simply put, it is a research that focuses on bringing solution to practical problems in the society.
Chloroflourocarbons(CFCs) are known to cause damage to the ozone layer. Hence any research aimed at its substitution is targeted at solving a practical problem in the society hence it is an applied research.
What is the name of this molecule?
CH2 - CH2 - CH3
|
CH3 - CH2 - CH - CH2 - CH = CH3
which of the following materials is necessary to stop a beta particle
Knowing the solubility of an unknown substance in water can help to identify what it is. true or false
TRUE. Knowing the solubility of an unknown substance in water can indeed help identify it, as different substances have various solubility levels and behaviours. Electrolytes, which dissolve to yield ions, their temperature dependency, and equilibrium conditions can give further hints to the substance's identity.
Explanation:The statement that knowing the solubility of an unknown substance in water can help to identify what it is, is true. Solubility can be defined as the maximum concentration of a substance that can be achieved under specified conditions in a solvent like water. Different substances have different levels of solubility, ranging from insoluble to sparingly soluble, to soluble and to miscible. Substances that dissolve to yield ions are called electrolytes, and their ionization when dissolved also varies, offering further clues to their identity. For example, soluble ionic substances and strong acids ionize completely and are strong electrolytes, while weak acids and bases ionize to a small extent and are weak electrolytes. Nonelectrolytes do not produce ions when dissolved in water. Also, considering the temperature dependency of solubility and the equilibrium conditions, we can identify the substance based on its solubility behavior.
Learn more about Solubility here:https://brainly.com/question/28170449
#SPJ3
Liquid nitrogen has different properties from gaseous nitrogen. Is it a chemical change when liquid nitrogen warms to gaseous nitrogen?
Answer:
No, because the different properties are physical while the chemical properties remain the same.
Explanation:
Why are p waves called push-pull waves?
Because they move in a horizontal path
Explanation;P waves or the primary waves are the first waves to arrive during an earthquake. They are the fastest waves created by an earthquake.P waves travel through the interior of the earth and an pass through both solid and molten rock. These waves are also known as compressional waves due to their pulling and pushing. When particles are subjected to a P wave they move in the same direction as the wave motion which is the direction of energy travel.15) Which of the these is a balanced chemical equation?
A) CO(g) + O2(g) → CO2(g)
B) CO(g) + 2O2(g) → 2CO2(g)
C) 2CO(g) + O2(g) → 2CO2(g)
D) 2CO(g) + 2O2(g) → 2CO2(g)
Answer:
c
Explanation:
Consider the reaction below. C2H4(g) + H2(g) to C2H6(g) Which change would likely cause the greatest increase in the rate of the reaction?
a decrease temperature and decrease pressure
b increase temperature and decrease pressure
c decrease temperature and increase pressure
d increase temperature and increase pressure
Answer: Option (d) is the correct answer.
Explanation:
In the given reaction, [tex]C_{2}H_{4}(g) + H_{2}(g) \rightarrow C_{2}H_{6}(g)[/tex] greatest increase in rate of reaction only occur when we increase the temperature and also increase the pressure.
This is because increase in pressure will bring the molecules closer to each other whereas increase in temperature will help in more number of collisions between reactant molecules.
Thus, this will lead to increase in formation of products. Hence, we can conclude that rate of reaction will increase with increase in temperature and increase in pressure.
1. Ernest Rutherford discovery of radioactivity 2. James Chadwick discovery of the electron 3. Henri Becquerel discovery of the neutron 4. J.J. Thomson discovery of the atomic nucleus
Answer:
1. Ernerst Rutherford =====> Discovery of Atomic Nucleus
2. James Chadwick =====> Discovery of Neutron
3. Henri Becquerel =====> Discovery of Radioactivity
4. J.J. Thomson =====> Discovery of Electron
Explanation:
What is the value of in a spontaneous reaction?
a cylinder rod formed from silicon is 46.0cm long and has a mass of 3.10kg. The density of silicon is 2.33g/cm3. what is the diameter of the cylinder?
A scientist wished to carry out a chemical reaction in which two moles of aluminum combine with three moles of sulfur. He has 2.70 g of aluminum to react. How many grams of sulfur must he take to satisfy all the aluminum atoms?
1.51 g
2.14 g
3.41 g
4.81 g
Answer : The correct option is, 4.81 g
Explanation : Given,
Mass of aluminium = 2.70 g
Molar mass of aluminium = 26.98 g/mole
Molar mass of sulfur = 32.07 g/mole
First we have to calculate the moles of aluminium.
[tex]\text{Moles of Al}=\frac{\text{Mass of Al}}{\text{Molar mass of Al}}=\frac{2.7g}{26.98g/mole}=0.1mole[/tex]
Now we have to calculate the moles of sulfur.
According to the question,
As, 2 moles of aluminium react with 3 moles of sulfur
So, 0.1 mole of aluminium react with [tex]\frac{3}{2}\times 0.1=0.15mole[/tex] of sulfur
Now we have to calculate the mass of sulfur.
[tex]\text{Mass of sulfur}=\text{Moles of sulfur}\times \text{Molar mass of sulfur}[/tex]
[tex]\text{Mass of sulfur}=0.15mole\times 32.07g/mole=4.81g[/tex]
Therefore, the mass of sulfur he take must be, 4.81 g
A chemist mixes oxygen gas and hydrogen gas to form water, which is composed of one oxygen and two hydrogen atoms per molecule. What has occurred?
Answer:
A chemical change.
Explanation:
I just took the test and got it right.
How many moles of Mg(OH)2 are needed to completely neutralize 2.48 mol HNO3
the answer is 1.24 mol Mg(OH)2
The required moles of Mg(OH)₂ that are needed to completely neutralize 2.48 mol of HNO₃ is 1.24 moles.
What is the stoichiometry?Stoichiometry of the reaction gives idea about the relative amount of moles of reactants and products present in the given chemical reaction.
Given chemical reaction is:
Mg(OH)₂ + 2HNO₃ → Mg(NO₃)₂ + 2H₂O
From the stoichiometry of the reaction, it is clear that:
2 moles of HNO₃ = reacts with 1 moles of Mg(OH)₂
2.48 moles of HNO₃ = reacts with (1/2)(2.48)=1.24 moles of Mg(OH)₂
Hence required moles of Mg(OH)₂ is 1.24mol.
To know more about stoichiometry, visit the below link:
https://brainly.com/question/14935523
#SPJ2
Calculate the standard free-energy change for the following reaction at 25 °C. Standard reduction potentials can be found here.
Since there are no given data for us to solve this problem, I will explain what a Standard Reduction Potential is. For example, if a student had an experiment and he wanted to know what is the most efficient and powerful redox reaction involving an uncommon combination of chemicals. The student would most likely record information in the Standard Reduction Potential that showed the voltage generated by the reaction in Aqueous Solution at 25 degrees Celsius and 1 atmosphere. This is a list of half reaction of ions in the solution at standard temperature and pressure.
Convert 30 g/L to the unit g/mL.
A) 30,000 g/mL
B) 300 g m/L
C) 0.03 g/mL
D) 0.0003 g/mL
When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. What can Gerald assume occurred?
i am not explaining step by step so the answer is straight to the point. sorry i fyou wanted if an explanation.
THE ANSWER IS: A.) CHEMICAL CHANGE
When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. Its a type of chemical change.
What is chemical change?Chemical synthesis, and, alternatively, chemical breakdown into two or more separate molecules, occurs when one material reacts with another to create a new substance. These processes have been referred to as chemical change, and they are typically irreversible barring additional chemical reactions.
What is baking soda?The organic compounds sodium bicarbonate, also referred to as baking soda and bicarbonate of soda, have the formula [tex]NaHCO_{3}[/tex] . That is a salt made up of the cation sodium and the anion bicarbonate. Sodium bicarbonate ( [tex]NaHCO_{3}[/tex] ) would be a white, crystalline substance that frequently takes the form of a fine powder.
Now, it is found that when Gerald mixes baking soda and vinegar, the materials combine to turn into a gas is a kind of chemical change.
To know more about chemical change and baking soda
https://brainly.com/question/23693316
#SPJ2
The phase change in which a substance changes from a liquid to a solid is A. freezing. B. melting. C. sublimation. D. condensation.
freezing. Think of what happens when you put water in the freezer
[03.04]When one atom of potassium (K) combines with one atom of fluorine (F), an ionic bond forms, resulting in potassium fluoride (KF). Which of the following describes the arrangement of valence electrons in a bond between K and F?
The valence electrons are shared equally between K and F.
The valence electrons spend more time around the atom of K.
The valence electrons spend more time around the atom of F.
The valence electrons are given up by the K and gained by the F.
The valence electrons are transferred from the potassium atom to the fluorine atom, resulting in the formation of an ionic bond in potassium fluoride (KF), with potassium becoming a cation and fluorine becoming an anion.
Explanation:When one atom of potassium (K) combines with one atom of fluorine (F), an ionic bond forms, resulting in potassium fluoride (KF). In this process, the valence electrons are not shared equally between K and F, nor do they spend more time around the atom of K. Instead, the valence electrons are transferred from the potassium atom to the fluorine atom, due to the difference in electronegativity between the two elements. Potassium, which has just one electron in its valence shell, easily donates this electron, becoming a positively charged ion, or cation. Fluorine, which has seven electrons in its valence shell, gladly accepts this electron to complete its octet, becoming a negatively charged ion, or anion, as a result.
A prairie dog runs into its burrow as a coyote approaches.This behavior helps the prairie dog
Answer:
sample response: Prairie dogs create a safe home for their young by creating underground burrows, which protect them from hailstorms, blizzards, floods, droughts, and fires. The burrow contains many different chambers, including a nursery that is very deep underground. This protects the young from predators as well as changes in the temperature outside. The burrows even include observation posts where they can watch for predators.
Explanation:
Which of the following is the correct name for the compound MgBr2
Answer : The correct name for the compound [tex]MgBr_2[/tex] is, Magnesium bromide.
Explanation :
Ionic compound : It is defined as the compound which is formed when electron gets transferred from one atom to another atom.
Ionic compound are usually formed when a metal reacts with a non-metal.
The rules for naming the ionic compounds is given as :
The positive ion (cation) is named first.The negative ion (anion) is named next.The suffix is added at the end of the negative ion (anion). The suffix used is '-ide'.Hence, the correct name for the compound [tex]MgBr_2[/tex] is, Magnesium bromide.
Anouk does 150 J of work using a hammer to pull a nail out of a piece of wood, and the hammer does 105 J of work on the nail. What is the efficiency of the hammer? 1.4% 7% 70% 143%
Answer:
70%
Explanation:
105 divided by 150 equal to 0.7. then u multiply 0.7 by 100. equal 70. so its C because efficiency = (effective work)/(executed work) * 100%
hope it helped :3
Answer:
70%
Explanation:
105 divided by 150 equal to 0.7. then u multiply 0.7 by 100. equal 70. so its C because efficiency = (effective work)/(executed work) * 100%
which of the following would you list under cash inflow in a financial plan
In a financial plan, cash inflows represent the sources of revenue or capital coming into the business. This could be from sale of products or services, investment income, funds raised from investors or loans, or reinvested profits.
Explanation:In a financial plan, cash inflows represent the sources of revenue earned by the business. Such cash inflows could be listed as follows:
Sale proceeds from goods or services: This makes up the operating revenue for businesses. Investment income: if the firm has made investments, then the income from these investments such as interest, dividends, or returns would be considered a cash inflow. Funds raised from early-stage investors, loans from banks or bonds, or by selling stock would also get listed under cash inflow as they represent capital coming into the firm. Reinvested profits, while they're not fresh cash coming in, represent an internal cash inflow, repurposing earned money for further business growth
Under cash flows, we focus primarily on the channels that bring cash into the organization.
Learn more about Cash Inflows here:https://brainly.com/question/10714011
#SPJ2
1.What does the Law of Conservation of Energy tells us?
2.Give an example of 1 way that heat is transferred in your home by conduction, convection and radiation.
3.What is the difference between renewable and nonrenewable resources?
4. Energyville has run out of fossil fuels and is in an energy crisis. What is one type of renewable energy source that you might recommend to the mayor of Energyville and why do you think that it should be considered?
5. Develop an action plan that includes one specific way that you can conserve energy in your own home.
Final answer:
The Law of Conservation of Energy highlights the transformation, not the depletion, of energy. In homes, heat transfers via conduction, convection, and radiation. Solar energy is advised for Energyville for its renewable qualities, while swapping to LED lights at home conserves energy.
Explanation:
The Law of Conservation of Energy teaches us that energy cannot be created or destroyed, only transformed from one form to another. This principle is fundamental in understanding how energy interacts and transforms in the universe.
Conduction: Heat moving through the walls of your house.
Convection: Warm air circulating inside a room.
Radiation: Heat from the sun warming your home's surfaces.
Renewable vs Nonrenewable Resources: Renewable resources, such as solar and wind, can be replenished over time and have lower environmental impacts, whereas nonrenewable resources, like coal and oil, are finite and typically more polluting.
For Energyville, I recommend solar energy as a renewable source due to its accessibility, decreasing cost, and low environmental impact compared to other energy sources.
One way to conserve energy at home is to replace incandescent bulbs with LED lights, which use less energy and last longer, significantly reducing energy consumption and costs.