Which expression is equivalent 219 X minus 6X +2 And why?

Which Expression Is Equivalent 219 X Minus 6X +2 And Why?

Answers

Answer 1

19x - 6x + 2

Two terms have an X in them, so you can combine them :

19x -6x = 13x

You now have 13x +2, which can be rewritten as 2 + 13x

The 3rd answer is correct.

Answer 2

Hey there!

The correct choice is C. 2 + 13x

Like the answer says, all you have to do is combine the x’s and rearrange: 13x +2 can be rearranged as 2 + 13x

Hope this helps you!

God bless ❤️

xXxGolferGirlxXx


Related Questions

The first step in determining the solution to the system of equations, y = –x^2 – 4x – 3 and y = 2x + 5, algebraically is to set the two equations equal as –x^2 – 4x – 3 = 2x + 5. What is the next step?

Answers

Answer:

The next step is to put all terms into the left side of the equation and group the like trems

Step-by-step explanation:

The first step in determining the solution to the system of equations, [tex]y =-x^2-4x-3[/tex] and [tex]y = 2x + 5[/tex], algebraically is to set the two equations equal as [tex]-x^2-4x-3 = 2x + 5.[/tex]

The next step is to put all terms into the left side of the equation and group the like trems:

[tex]-x^2-4x-3-2x-5=0,\\ \\-x^2+(-4x-2x)+(-3-5)=0,\\ \\-x^2-6x-8=0.[/tex]

Now you can multiply this equation by -1:

[tex]x^2+6x+8=0[/tex]

and solve it using quadratic formula:

[tex]x_{1,2}=\dfrac{-6\pm \sqrt{6^2-4\cdot 8\cdot 1}}{2\cdot 1}=\dfrac{-6\pm\sqrt{4}}{2}=\dfrac{-6\pm 2}{2}=-4,\ -2.[/tex]

two bottled waters and an order of cheese nachos costs $5.50. Three bottled waters and two orders of cheese nachos costs $9.50​

Answers

1.50 waters 2.80 nachos

hope this helps :)

The cost of each nachos is $2.50 and the cost of each water bottle is $1.50.

What is a linear system of equations?

A system of linear equations consists of two or more equations made up of two or more variables such that all equations in the system are considered simultaneously. The solution to a system of linear equations in two variables is any ordered pair that satisfies each equation independently.

Let x be the cost of each water bottle and y be the cost of each nachos.

Two bottled water and an order of cheese nachos costs $5.50.

So, 2x+y=5.50 -------(I)

Three bottled water and two orders of cheese nachos costs $9.50​

3x+2y=9.50 -------(II)

Multiply equation (I) by 2, we get

4x+2y=11 -------(III)

Subtract equation (II) from equation (III), we get

4x+2y-(3x+2y)=11-9.50

x=$1.50

Substitute x=1.50 in equation (I), we get

2(1.50)+y=5.50

y=$2.50

Therefore, the cost of each nachos is $2.50.

To learn more about the linear system of an equations visit:

https://brainly.com/question/27664510.

#SPJ2

"Your question is incomplete, probably the complete question/missing part is:"

Two bottled waters and an order of cheese nachos costs $5.50. Three bottled waters and two orders of cheese nachos costs $9.50​. How much money does the nachos cost.

At a local basketball game, all tickets are the same price and all souvenirs are the same price. Mr. Smith bought 2 tickets for this basketball game and 1 souvenir for a total of $17.25. Ms. Lockhart bought 5 tickets to the same game and 2 souvenirs for a total of $42.00. How much was a ticket to this game?


*please explain!*

Answers

Answer:

The answer is $7.50.

Step-by-step explanation:

First you have to find the price of the souvenirs which were $2.25, just by doing each common price. Then you just do the answer you got divided by two.

The one ticket for this basketball game is $ 7.50, and one ticket for a souvenir is $2.25.

What is a linear equation?

It is defined as the relation between two variables if we plot the graph of the linear equation we will get a straight line.

If in the linear equation one variable is present then the equation is known as the linear equation in one variable.

Let's suppose the price of the one ticket = $x

And the price of the one souvenir = $y

We have:

2x + y = 17.25 ....(1)

5x + 2y = 42.00 ....(2)  (from the quetion)

From the equation (1):

y = 17.25 - 2x

Put the value of y in the equation (2), we get:

5x +2(17.25 -2x) = 42

5x + 34.5 - 4x = 42

x = 42 - 34.5

x = $ 7.50

and y = 17.25 - 2x ⇒ 17.25 - 2(7.5) ⇒ $2.25

Thus, the one ticket for this basketball game is $ 7.50, and one ticket for a souvenir is $2.25.

Learn more about the linear equation here:

brainly.com/question/11897796

what is the equation for an arithmetic sequence with a first term of 7 and a second term of 3?

Answers

Answer:

HOPEFULLY THIS HELPS YOU

Arithmetic sequence: an = a1 + (n-1)d

In this case: an = 7 +(n-1)(-4)

Click on this one Choixongdong!
Which equation does the graph below represent?


y = 2x

y = 1/2 x

y = 1/2 + x

y = 2 + x

Answers

Answer:

y = 1/2 x

Step-by-step explanation:

slope = 1/2 and y-intercept = 0

so equation

y = 1/2 x

For which of the following is the arc between the two hands of a clock greater than a semicircle?
The long arm is at 12 and the short arm is in-between the 12 and the 1

A The hands are at 11 and 6; arc measured clockwise


B The hands are at 11 and 6; arc measured counterclockwise


C The hands are at 2 and 8; arc measured counterclockwise


D The hands are at 2 and 8; arc measured clockwise

Answers

Answer:

A

Step-by-step explanation:

Each hour is 30 degrees. 11 to 6 is 7 hours so 30 * 7 = 210 degrees, which is greater than a semicircle, which is 180 degrees.

Answer:

A. The hands are at 11 and 6; arc measured clockwise

Step-by-step explanation:

A semicircle measures 180º and when you measure the distance from 11 to 6 the difference in the hands of the clock by each hour is given by the equation:

[tex]\frac{360}{12}[/tex]= 30

So there are 7 numbers between the 11 and the 6 if you measure it clockwise, that means that the angle formed by the two hands of the clock measured clockwise is:

7*30= 210

Wich is greater than 180º, which is why that is the correct answer.

in circle O, AD and BE are diameters. the measure of arc AB is 55 and the measure of arc CD is 25 what is the measure of EAC

Answers

Answer:

arc EAC = 280 degrees

Step-by-step explanation:

Given: the measure of arc AB is 55  and the measure of arc CD is 25

Vertical angles are equal so <AOB = <DOE = 55

In a circle, the degree measure of an arc is equal to the measure of the central angle.

so if <DOE = 55 then arc DE = 55

As you know, the arc angle to a full angle in a circle = 360

so

arc EAC = 360 - arc CD - arc DE

arc EAC = 360 - 55 - 25

arc EAC = 280

Answer:

arc EAC = 280 degrees

The measure of EAC = 280°

What is a Circle?

A circle is a round-shaped figure with all points lie in the same plane, the distance between all the points on the circle and the center of the circle is equal.

The line that passes through the center of the circle and has end point on the circumference is called the diameter, the radius is half the measure of the diameter.

The circumference is the perimeter of the circle, it is the distance that is covered by a man to take one round around the circle.

The area is defined as the space required by a two dimensional object in space.

The chord AD and BE is the diameter of the circle,

They intersect each other, the sector formed by the circle is of equal measure.

The measure of arc AB is 55 and,

The measure of arc CD is 25

The sector ED = AB = 55 degree.

The measure of EAC = 360 - measure of ED and DC

The measure of EAC = 360 - 55 - 25

The measure of EAC = 280°

To know more about Circle

https://brainly.com/question/11833983

#SPJ5

help me on this math please​

Answers

9514 1404 393

Answer:

  A (and C)

Step-by-step explanation:

A relationship that is a direct proportion is described by the equation ...

  y = kx

for some constant k.

You can examine the tables to see what the value of k is by looking at ...

  k = y/x

__

In table A, the values of k are 125/5 = 250/10 = 500/20 = 25.

In table B, the values of k are 100/50 = 2, 250/20 = 125, 50/10 = 5. These are not constant, so the relation is not a proportional one.

In table C, the values of k are -125/5 = -250/10 = -500/20 = -25.

In table D, the values of k are 8/2 = 4, 10/4 = 2.5, 12/6 = 2. These values are not constant, so the relation is not a proportional one.

__

We see that the tables of A and C both represent proportional relationships. We usually expect the value of k to be positive, but there is nothing in the definition of a proportional relationship that demands that be the case.

If this is a single-answer question, choose A.

If this is an "all that apply" question, choose A and C.

Jean needs 2 gallons olive oil to make a recipe. If olive oil cost $ 8.00 a quart, how much money will she need to buy the olive oil?

Answers

$64.00



1 gallon = 4 quarts

2 gallons = 4 quarts * 2 = 8 quarts

8 quarts * $8.00 = $64.00



Please consider marking this answer as Brainliest to help me advance.

Answer:

Step-by-step explanation:

There are 4 quarts in a gallon.

So, that is $32 a gallon.

2 gallons is $64

Which of the following statements about cubes is false?

Answers

Answer:

B and D

Step-by-step explanation:

The surface area is the area of each face of the cube. The volume is the amount that will fill the cube. These are two separate processes which cannot give you the same measurement by calculating one part of the surface area. B is false.

Doubling the sides of the cube will not double the surface area. It will quadruple it. D is false too.

the dimensions of a figure as shown below 2 ft 3 ft 4 ft 3 ft 3 ft 4 ft
what is the volume of this figure?
Step By Step Explanation ​

Answers

Answer:

the answer for this is 57 I believe

Step-by-step explanation:

I cue the shape into a small rectangle with sides of 3, 3, and 1 which comes out to 9 cubic feet, and then I took the rest of the shape which became a bigger rectangle with sides of 2, 6, and 4 which comes out to 48 cubic feet. 48+9=57. Sorry if I am wrong, I tried my best. Hope this helps!

Answer: 36

Step-by-step explanation:

1) Chop the image like a hamburger, leaving the top part sticking out. You can draw a line.

2) Find the length, width, and height. 2*3*4=24

3) Find the top part that was separated from the bottom part with the line that you drew. The height of the bottom prism was 2 and the height on the other side of the prism was 3. 3-2=1

4) So, you got the height of the piece that is cut out like a small square on the top left corner of the shape. That height will be used as the height for the top part now.

5) You found the height, which was 1. Now the length is shown at the bottom of the bottom prism, which is 3. All that's left is to find the width. The width is the same as the bottom prism, which is 4. 1*3*4=12

6) Add the two volumes together to find the whole volume. 24+12=36

I need help solving this

Answers

Answer:

80 is the volume

Step-by-step explanation:

l*b*h

5*2*8

80

L*W*H

8*5 = 40

40*2 = 80

The volume is 80 cm^3

Help me plz tgbdsfvg

Answers

Answer:

angle 2 is 43 as the opposite side of the angle is always equal angle 1 and 3 are:

step 1

43+43=86

step 2

360-86=274

step 3

274÷4=68.5

we subtracted 86 with 360 because 360 is the sum of all the angles we then divided  the answer by 2 as we were suppose to find two angles angle 1 and 3 are opposite angles so they both will be same

      hope this information helps u :)

Answer:

see explanation

Step-by-step explanation:

∠1 and 43° form a straight angle = 180°, hence

∠1 = 180° - 43° = 137°

∠2 = 43° ( vertical to 43° )

∠3 = 137° ( vertical to ∠1 )

what is the y-intercept of y-5=1/3(x+6)​

Answers

So y = 1/3x + 7, therefore the gradient is 1/3 and the y-intercept is 7.

The area of a square garden is 98 m2. How long is the diagonal?

Answers

Answer:

The diagonal  is about 14 m

Step-by-step explanation:

A = s^2

98 = s^2

so

s = √98

diagonal c^2 = 98 + 98

c^2 = 196

c = √196

c  ≈ 14

Answer:

The diagonal  is about 14 m

Answer:

C= 14

Step-by-step explanation:

The side is the square root of the area

S × S = A

S = √98

The diagonal is the hypotenuse of a right triangle formed by the two sides so

a²  + b² = c²

Where C = the diagonal A = √98 , B = √98

so C²= (√98)² + (√98)²

This gives: C²= 98 + 98 or

C² = 196

√C² = √196

C= 14

A circle has a circumference of 14pi. What is the area in terms of pi?

Answers

Step-by-step explanation:

Divide the circumference by pi to get diameter, which is 14. Divide 14 by 2 for the radius, which is 7. Now square the radius to get 49, and multiply by pi for the area.

Area is 49pi.

The area of the circle in terms of π with a circumference of 14π is 49π units².

Given a circle.

Also, given that:

Circumference of the circle = 14π

It is required to find the area of the circle.

It is known that:

Circumference of a circle is:

C = 2πr, where r is the radius.

So, here,

2πr = 14π

2r = 14

r = 7

So, the radius of the circle is 7.

So, the area of the circle is:

A = πr²

  = π(7)²

  = 49π

Hence, the area is 49π.

Learn more about Area here :

https://brainly.com/question/14452062

#SPJ2

2.) What is the value of x?

Answers

Answer:

54

Step-by-step explanation:

add all of the numbers then subtract from 100

(URGENT)
What is the volume of the square pyramid with base edges 4m and height 3m?

Answers

The volume of a square pyramid is a^2 * h/3, assuming a is the base edge and h is the height. Plug the numbers in and you get your answer.

The volume of the square pyramid with base edges of 4 m and height 3 m is [tex]16 \, \text{m}^3[/tex]

To find the volume of a square pyramid, you can use the formula:

[tex]\[ \text{Volume} = \frac{1}{3} \times \text{Base Area} \times \text{Height} \][/tex]

For a square pyramid, the base area is the area of the square base. The formula for the area of a square is \( \text{Area} = \text{side}^2 \).[tex]\[ \text{Volume} = \frac{1}{3} \times \text{Base Area} \times \text{Height} \][/tex]

Given:

- Base edges = 4 m

- Height = 3 m

1. Calculate the Base Area:

  The base of the square pyramid is a square, so its area is:

Base Area = [tex]\text{side}^2[/tex]

Base Area = [tex]4^2[/tex]

Base Area = [tex]16 \, \text{m}^2[/tex]

2. Plug the Values into the Volume Formula:

  Now, we can plug the values into the volume formula:

Volume  = [tex]\frac{1}{3} \times \text{Base Area} \times \text{Height}[/tex]

Volume = [tex]\frac{1}{3} \times 16 \, \text{m}^2 \times 3 \, \text{m}[/tex]

Volume  = [tex]\frac{1}{3} \times 48 \, \text{m}^3[/tex]

Volume  = [tex]16 \, \text{m}^3[/tex]

So, the volume of the square pyramid with base edges 4 m and height 3 m is [tex]16 \, \text{m}^3[/tex]

On a map, the North Carolina cities of Raleigh, Durham, and Chapel Hill form a triangle, as shown below. What are the approximate values of the missing measures on the map?

Answers

Answer

The approximate values are:

c = 55.2°

r = 22.8°

x = 9.9 miles

Explanation

- To find angle [tex]c[/tex], we are using the rule of sines: [tex]\frac{a}{sin(A)} =\frac{b}{sin(B)} =\frac{c}{sin(C)}[/tex]

For our triangle [tex]a=21,A=c,b=x,B=r,c=25[/tex] and [tex]C=102[/tex]

Replacing the values we get: [tex]\frac{21}{sin(c)} =\frac{x}{sin(r)} =\frac{25}{sin(102)}[/tex]

We can pick up two suited values to find [tex]c[/tex]:

[tex]\frac{21}{sin(c)} =\frac{25}{sin(102)}[/tex]

[tex]21=\frac{25sin(c)}{sin(102)}[/tex]

[tex]21sin(102)=25sin(c)[/tex]

[tex]sin(c)=\frac{21sin(102)}{25}[/tex]

[tex]c=sin^{-1}(\frac{21sin(102)}{25})[/tex]

[tex]c=55.2[/tex]

- Now that we have angle [tex]c[/tex], we can use the angle sum theorem to find angle [tex]r[/tex].

The angle sum theorem states the the interior angles of a triangle add up to 180°, so:

[tex]r+c+102=180[/tex]

[tex]r+55.2+102=180[/tex]

[tex]r+157.2=180[/tex]

[tex]r=22.8[/tex]

- Now that we have angle [tex]r[/tex], we can use the rule of sines, one more time, to find side [tex]x[/tex]

[tex]\frac{21}{sin(c)} =\frac{x}{sin(r)} =\frac{25}{sin(102)}[/tex]

[tex]\frac{x}{sin(r)} =\frac{25}{sin(102)}[/tex]

[tex]\frac{x}{sin(22.8)} =\frac{25}{sin(102)}[/tex]

[tex]x=\frac{25sin(22.8)}{sin(102)}[/tex]

[tex]x=9.9[/tex]

Answer: 1) r=23° , c=55° , x=10°

Step-by-step explanation:

correct on edge 2020

A path starts and ends at the same vertex true or false

Answers

the statement is true

Vertex a path starts and ends at the same vertex is true

A van has room for six students and two teachers. How many vans are needed for a total of 48 students and 16 teachers

Answers

You would need 8 vans because:

48/6 = 8

16/2=8

Plus, if you add the number of students and teachers together it equals 64. Then divide it by the number of people who can fit into the van, which is 8.

64/8=8 vans

there will be needed 10 buses so other people can fit in

What is it?plz tell me i need help

Answers

Answer:

The answer is 195 :)))

Step-by-step explanation:

The answer is 195! Easy

Look at the photo! Please answer ASAP will give brainliest on the last one it says answer and square feet

Answers

1. A and D, since they both fill the shape with tiles of the same size.

2. 9 square feet, since you just count the number of gray tiles.

Can two cars be traveling the same speed but have difference velocities

Answers

Answer: Objects have the same velocity only if they are moving at the same speed and in the same direction. Objects moving at different speeds, in different directions, or both have different velocities.

What is the total surface area of this rectangular pyramid?


square meters

Answers

Answer:

The total surface area = 10956 m²

Step-by-step explanation:

∵ The pyramid is rectangular pyramid

∴ It has a rectangular base with dimensions of 50 m and 78 m

∴ It has four faces each two opposite are congruent

* to find the total surface area, we will find the area of

  each face and add them together

- Area base = L × W

∴  Area base = 50 × 78 = 3900 m² ⇒ (1)

- Area of triangular face of dimensions:

 base = 50 m and height = 60 m

∵ Area triangle = 1/2 × base × height

∴ Area triangle = 1/2 × 50 × 60 = 1500 m²

∵ We have another triangle congruent to this triangle (opposite faces)

∴ Area of the two congruent faces = 1500 × 2 = 3000 m² ⇒ (2)

- Area of triangular face of dimensions:

 base = 78 m and height = 52 m

∵ Area triangle = 1/2 × base × height

∴ Area triangle = 1/2 × 78 × 52 = 2028 m²

∵ We have another triangle congruent to this triangle (opposite faces)

∴ Area of the two congruent faces = 2028 × 2 = 4056 m² ⇒ (3)

∴ Add (1) , (2) and (3)

∴ The total surface area = 3900 + 3000 + 4056 = 10956 m²

Answer:

The total answer is : 10956 m²

Step-by-step explanation:

3. Factor by identifying a common factor in each term.

g) 6xy2 = (3x) (?)

h) 25a3b2 = (5a2b2) (?)
i) 6x + 6y + 6p

PLEASE HELP

Answers

Answer:

[tex]\large\boxed{g)\ 6xy^2=(3x)(2y^2)}\\\boxed{h)\ 25a^3b^2=(5a^2b^2)(5a)}\\\boxed{i)\ 6x+6y+6p=6(x+y+p)}[/tex]

Step-by-step explanation:

[tex]g)\ 6xy^2=3\cdot2\cdot x\cdot y\cdot y=(3\cdot x)(2\cdot y\cdot y)=(3x)(2y^2)\\\\h)\ 25a^3b^2=5\cdot5\cdot a\cdot a\cdot a\cdot b\cdot b=(5\cdot a\cdot a\cdot b\cdot b)(5\cdot a)=(5a^2b^2)(5a)\\\\i)\ 6x+6y+6p=6\cdot x+6\cdot y+6\cdot p=6(x+y+p)[/tex]

Other way for g) and h):

[tex]g)\ \dfrac{6xy^2}{3x}=\dfrac{6}{3}\cdot\dfrac{xy^2}{x}=2y^2\\\\6xy^2=(3x)(2y^2)\\\\h)\ \dfrac{25a^3b^2}{5a^2b^2}=\dfrac{25}{5}\cdot\dfrac{a^3}{a^2}\cdot\dfrac{b^2}{b^2}=5a\\\\25a^3b^2=(5a^2b^2)(5a)[/tex]

Final answer:

To factor by identifying a common factor in each term, divide out the greatest common factor of the terms.

Explanation:

To factor by identifying a common factor in each term, we look for a number or variable that can be divided out of each term. Let's go through the expressions one by one:

g) 6xy2 = (3x) ?

We can see that both terms have a common factor of 3x. Dividing each term by 3x gives us 2y2.

h) 25a3b2 = (5a2b2) ?

Again, both terms have a common factor, which is 5a2b2. Dividing each term by 5a2b2 gives us 5a.

i) 6x + 6y + 6p

Here, all three terms have a common factor of 6. Dividing each term by 6 gives us x + y + p.

Learn more about Factoring here:

https://brainly.com/question/33624529

#SPJ3

Which pair of angles are corresponding? 10 points <3

Answers

Answer: Angles 1 and 5

Step-by-step explanation: Corresponding angles are angles that have the same measures.

Since angle 1 and 5 have the same measure on these lines, that means that the answer must be angle 1 and 5.

Write a number story to fit this number sentence. 20- (3x6) =2​

Answers

Answer: Bonnie went to a meadow to pick flowers there was 20 flowers in one area and had decided to pick 18 of the flowers, how many flowers are left?

Step-by-step explanation: I don't know.... Just something random, hope I was able to help!

A Number story was written to describe the given mathematical equation.

Mercy had 20 balls, 6 were of green color, 6 were of blue color, 6

were of red color, 2 were of yellow colors. One day six of her friends came

to her home and each of them liked the balls Mercy had. All of them

requested Mercy to offer one ball of each color i.e. green, blue, and red. Since they were the best friends of Mercy so Mercy couldn't deny it.

She offered each friend 3 balls of green, blue, and red color each. Since She offered 3 balls to each of her friends i.e 18 balls, she was left with

20-(3*6) = 2 yellow color balls.

Thus, a number story was written to describe the given mathematical equation.

What is the total area! Pls help! Formula: A=1/2bh for triangle and A=bh for rectangle! Ty!

Answers

100 in^2
20, represents the full base. but the rectangle’s base is 10. both triangles are equal so 20-10 equals 10 and split them evenly on both sides.
6•5=30/2=15
since you have two equal triangles your total answer is 30. then you do 10•7 which is 70.

How to integrate sec^3x

Answers

1 Use Integration by Parts on \int \sec^{3}x \, dx∫sec

​3

​​ xdx.

Let u=\sec{x}u=secx, dv=\sec^{2}xdv=sec

​2

​​ x, du=\sec{x}\tan{x} \, dxdu=secxtanxdx, v=\tan{x}v=tanx

2 Substitute the above into uv-\int v \, duuv−∫vdu.

\sec{x}\tan{x}-\int \tan^{2}x\sec{x} \, dxsecxtanx−∫tan

​2

​​ xsecxdx

3 Use Pythagorean Identities: \tan^{2}x=\sec^{2}x-1tan

​2

​​ x=sec

​2

​​ x−1.

\sec{x}\tan{x}-\int (\sec^{2}x-1)\sec{x} \, dxsecxtanx−∫(sec

​2

​​ x−1)secxdx

4 Expand (\sec^{2}x-1)\sec{x}(sec

​2

​​ x−1)secx.

\sec{x}\tan{x}-\int \sec^{3}x-\sec{x} \, dxsecxtanx−∫sec

​3

​​ x−secxdx

5 Use Sum Rule: \int f(x)+g(x) \, dx=\int f(x) \, dx+\int g(x) \, dx∫f(x)+g(x)dx=∫f(x)dx+∫g(x)dx.

\sec{x}\tan{x}-\int \sec^{3}x \, dx+\int \sec{x} \, dxsecxtanx−∫sec

​3

​​ xdx+∫secxdx

6 Set it as equal to the original integral \int \sec^{3}x \, dx∫sec

​3

​​ xdx.

\int \sec^{3}x \, dx=\sec{x}\tan{x}-\int \sec^{3}x \, dx+\int \sec{x} \, dx∫sec

​3

​​ xdx=secxtanx−∫sec

​3

​​ xdx+∫secxdx

7 Add \int \sec^{3}x \, dx∫sec

​3

​​ xdx to both sides.

\int \sec^{3}x \, dx+\int \sec^{3}x \, dx=\sec{x}\tan{x}+\int \sec{x} \, dx∫sec

​3

​​ xdx+∫sec

​3

​​ xdx=secxtanx+∫secxdx

8 Simplify \int \sec^{3}x \, dx+\int \sec^{3}x \, dx∫sec

​3

​​ xdx+∫sec

​3

​​ xdx to 2\int \sec^{3}x \, dx2∫sec

​3

​​ xdx.

2\int \sec^{3}x \, dx=\sec{x}\tan{x}+\int \sec{x} \, dx2∫sec

​3

​​ xdx=secxtanx+∫secxdx

9 Divide both sides by 22.

\int \sec^{3}x \, dx=\frac{\sec{x}\tan{x}+\int \sec{x} \, dx}{2}∫sec

​3

​​ xdx=

​2

​secxtanx+∫secxdx

​​  

10 Original integral solved.

\frac{\sec{x}\tan{x}+\int \sec{x} \, dx}{2}

​2

​secxtanx+∫secxdx

​​  

11 Use Trigonometric Integration: the integral of \sec{x}secx is \ln{(\sec{x}+\tan{x})}ln(secx+tanx).

\frac{\sec{x}\tan{x}+\ln{(\sec{x}+\tan{x})}}{2}

​2

​secxtanx+ln(secx+tanx)

​​  

12 Add constant.

\frac{\sec{x}\tan{x}+\ln{(\sec{x}+\tan{x})}}{2}+C

​2

​secxtanx+ln(secx+tanx)

​​ +C

To integrate sec³(x), use integration by parts and trigonometric identities, ultimately resulting in the integral: 1/2 * (sec(x) * tan(x) + ln|sec(x) + tan(x)|) + C.

To integrate sec³(x), we can use integration by parts. Let’s denote the integral by I:

I = ∫ sec³(x) dx

First, we use the identity:

sec³(x) = sec(x) * sec²(x)

We know that sec²(x) = 1 + tan²(x), so:

sec³(x) = sec(x) * (1 + tan²(x)) = sec(x) + sec(x) * tan²(x)

Now, we use integration by parts:

Let u = sec(x) and dv = sec(x) * tan²(x) dx.

Then, du = sec(x) * tan(x) dx and v = tan(x).

Using integration by parts formula ∫ u dv = uv - ∫ v du, we get:

I = ∫ sec(x) * sec²(x) dx = sec(x) * tan(x) - ∫ tan(x) * sec(x) * tan(x) dx

Which simplifies to:

I = sec(x) * tan(x) - ∫ sec(x) * tan²(x) dx

We already know sec²(x) = 1 + tan²(x), so:

tan²(x) = sec²(x) - 1∫ sec(x) * tan2(x) dx = ∫ sec(x)(sec²(x) - 1) dx = ∫ sec³(x) dx - ∫ sec(x) dxI = sec(x) * tan(x) - ∫ sec(x) * tan²(x) dx∫ sec³(x) dx = sec(x) * tan(x) - ∫ sec³(x) dx + ∫ sec(x) dx2∫ sec³(x) dx = sec(x) * tan(x) + ln|sec(x) + tan(x)| + C∫ sec³(x) dx = 1/2 * (sec(x) * tan(x) + ln|sec(x) + tan(x)|) + C
Other Questions
When the author writes, "Fred Johnson is currently working on it while sitting in a cubicle checking the four thousand emails on his palm pilot," which literary technique is being used?A)analogyB)comparisonC)exaggerationD)understatement Although most of the latin american revolutions started with the ideas of democracy the majority of them did not end up as democracies. what kind of governments did they end up with instead and why did this happen? (essay question) re asking cause i need HELPPPPP Why is kinetic energy a constant for a satellite in a circular orbit but not for a satellite in an elliptical orbit? What is the answer 7/6 + 13/6= Why is an independent judiciary a key element of a democracy? For the following question, find the value of the variable(s). If your answer is not an integer, leave it in simplest radical form. Please help!! The diameter of the planet mars is approximately 6.794 10^6 meters. Which is an equivalent way to express that measure?a- 6.794 billion metersb- 679.4 million metersc- 67.94 million metersd- 6.794 million meters What is the solution to the equation g/13=52A.4B.19C.650D.676 What is the difference between micro-evolution and macro-evolution? 1. Macro evolution is a change in the gene pool and micro evolution is the formation of a new species. 2. Micro evolution is the change in the gene pool and macro evolution is the formation of a new species. 3. There is no difference. 4. Micro evolution only happens in the Galapagos island and Marco evolution only happens in Trinidad. Please please help! What is the value of x? Factor completely.4p+36p+81Question 3 options:(2p9)2(2p+9)2(4p+6)2 RateMinutesMiles0053107151220172521The table shows how many miles Brandon has traveled after the specified period of time. Find Brandon's rate in miles per minute between 15 and 20 minutes. A)1 mile per minute B)5 miles per minute C)12 miles per minute D)17 miles per minute how did the U.S. government use propaganda during ww2 Read the excerpt from "Civil Peace" by Chinua Achebe.Jonathan Iwegbu counted himself extraordinarily lucky. "Happy survival! meant so much more to him than just a current fashion of greeting old friends in the first hazy days of peace. It went deep to his heart. He had come out of the war with five inestimable blessingshis head, his wife Marias head and the heads of three out of their four children. As a bonus he also had his old bicyclea miracle too but naturally not to be compared to the safety of five human heads.What can you most clearly determine about the storys setting from this excerpt?a. The story takes place right before a war.b. The story takes place in the middle of a war.c. The story takes place right after a war.d. The story takes place years before the start of a war. sara has 24 sweets tim also has 24 sweets sara gives tim x sweets sara then eats 7 of her sweets tim then eats half of his sweetswrite an expression for the number of sweets sara and tim have now Read the excerpt below and answer the question. The Dust Bowl years spanned 1930-1936, when a million acres of farmland across the Plains became unusable due to severe drought and over-farming. When Dust Bowl conditions devastated farmers, many defaulted on their bank loans, which helped lead to the widespread bank failure. Franklin D. Roosevelt called for restoration in America with a promise that there are better days ahead. What is the best definition you can infer for the word "restoration" from the excerpt above? bringing back to former position or condition re-establish monarchy replacement giving back Which of the following is not a typical type of weather data collected? Help me please. FUN AND EASY assignment!! please check it out!!!Imagine and create a character that lived and experienced the cold war!Part B 1. What was the first time you remember hearing about the Soviet Union (or the USSR) and its conflict with the United States? Tell me about it. 2. What do you remember seeing or reading in the news about the Cold War? 3. What books did you read or movies did you watch that villainized the Soviet Union or dealt with the Cold War? How did they shape your impressions at that time? 4. What were you taught in school and at home about the Soviet Union? What did your school and family teach about nuclear threats and nuclear war? 5. Were you or any of your family members ever afraid that there would be a hot war or nuclear war between the United States and the Soviet Union? When did you feel that way? If yes, did you do anything to prepare or get ready for it? 6. What aspects of the Space Race do you remember? Was "Space Race" a phrase that you remember using at the time? What did it mean to you? 7. How was the rivalry between the United States and the Soviet Union promoted in sports? Can you think of any specific examples? 8. Do you remember the Berlin Wall coming down? How did it make you feel? How have your feelings about that era changed since 1989 and the Berlin Wall coming down? 9. How do you think future generations will remember the Cold War? What lessons should students today take away from the Cold War? 10. How does psychological warfare today compare to psychological warfare during the Cold War? 11. Where you a participant of the cold war? 12. Do you think the cold war was necessary? What helps a literary critic determine a story's complex theme? A. The public's reaction to the story B. The number of characters in a story C. The order of events within the story D. The specific details within the story What is the best definition for a paragraph's topic sentence? a sentence that begins the paragraph a sentence that helps the reader to organize her thoughts a sentence that tells the reader what will be discussed a sentence that is the first sentence of the paragraph Steam Workshop Downloader